Putnam Archive

492 problems1985–20258 subjectsrated 1–10

492 problemsNewest first
A12025

Let m0m_0 and n0n_0 be distinct positive integers. For every positive integer kk, define mkm_k and nkn_k to be the relatively prime positive integers such that mknk=2mk1+12nk1+1.\frac{m_k}{n_k} = \frac{2m_{k-1} + 1}{2n_{k-1}+1}. Prove that 2mk+12m_k+1 and 2nk+12n_k+1 are relatively prime for all but finitely many positive integers kk.

A22025

Find the largest real number aa and the smallest real number bb such that ax(πx)sinxbx(πx)ax(\pi-x) \leq \sin x \leq bx(\pi-x) for all xx in the interval [0,π][0, \pi].

A32025

Alice and Bob play a game with a string of nn digits, each of which is restricted to be 00, 11, or 22. Initially all the digits are 00. A legal move is to add or subtract 11 from one digit to create a new string that has not appeared before. A player with no legal move loses, and the other player wins. Alice goes first, and the players alternate moves. For each n1n \geq 1, determine which player has a strategy that guarantees winning.

A42025

Find the minimal value of kk such that there exist kk-by-kk real matrices A1,,A2025A_1, \dots, A_{2025} with the property that AiAj=AjAiA_i A_j = A_j A_i if and only if ij{0,1,2024}|i-j| \in \{0,1,2024\}.

A52025

Let nn be an integer with n2n \geq 2. For a sequence s=(s1,,sn1)s = (s_1,\dots,s_{n-1}) where each si=±1s_i = \pm 1, let f(s)f(s) be the number of permutations (a1,,an)(a_1,\dots,a_n) of {1,2,,n}\{1,2,\dots,n\} such that si(ai+1ai)>0s_i(a_{i+1}-a_i) > 0 for all ii. For each nn, determine the sequences ss for which f(s)f(s) is maximal.

A62025

Let b0=0b_0 = 0 and, for n0n \geq 0, define bn+1=2bn2+bn+1b_{n+1} = 2b_n^2 + b_n + 1. For each k1k \geq 1, show that b2k+12b2kb_{2^{k+1}} - 2b_{2^k} is divisible by 22k+22^{2k+2} but not by 22k+32^{2k+3}.

B12025

Suppose that each point in the plane is colored either red or green, subject to the following condition: For every three noncollinear points A,B,CA,B,C of the same color, the center of the circle passing through A,BA,B and CC is also this color. Prove that all points of the plane are the same color.

B22025

Let f ⁣:[0,1][0,)f\colon [0,1] \to [0, \infty) be strictly increasing and continuous. Let RR be the region bounded by x=0x=0, x=1x=1, y=0y=0, and y=f(x)y=f(x). Let x1x_1 be the xx-coordinate of the centroid of RR. Let x2x_2 be the xx-coordinate of the centroid of the solid generated by rotating RR around the xx-axis. Prove that x1<x2x_1 < x_2.

B32025

Suppose SS is a nonempty set of positive integers with the property that if nn is in SS, then every positive divisor of 2025n15n2025^n -15^n is in SS. Must SS contain all positive integers?

B42025

For n2n \geq 2, let A=[ai,j]i,j=1nA = [a_{i,j}]_{i,j=1}^n be an nn-by-nn matrix of nonnegative integers such that

  1. (a)
    ai,j=0a_{i,j} = 0 when i+jni+j\leq n;
  2. (b)
    ai+1,j{ai,j,ai,j+1}a_{i+1,j} \in \{a_{i,j}, a_{i,j}+1\} when 1in11 \leq i \leq n-1 and 1jn1 \leq j \leq n; and
  3. (c)
    ai,j+1{ai,j,ai,j+1}a_{i,j+1} \in \{a_{i,j}, a_{i,j}+1\} when 1in1 \leq i \leq n and 1jn11 \leq j \leq n-1.

Let SS be the sum of the entries of AA, and let NN be the number of nonzero entries of AA. Prove that S(n+2)N3.S \leq \frac{(n+2)N}{3}.

B52025

Let pp be a prime number greater than 33. For each k{1,,p1}k \in \{1,\dots,p-1\}, let I(k){1,2,,p1}I(k) \in \{1,2,\dots,p-1\} be such that kI(k)1(modp)k \cdot I(k) \equiv 1 \pmod{p}. Prove that the number of integers k{1,,p2}k \in \{1,\dots,p-2\} such that I(k+1)<I(k)I(k+1) < I(k) is greater than p/41p/4-1.

B62025

Let N={1,2,3,}\mathbb{N} = \{1,2,3,\dots\}. Find the largest real constant rr such that there exists a function g ⁣:NNg\colon \mathbb{N} \to \mathbb{N} such that g(n+1)g(n)(g(g(n)))rg(n+1)-g(n) \geq (g(g(n)))^r for all nNn \in \mathbb{N}.

A12024

Determine all positive integers nn for which there exist positive integers aa, bb, and cc satisfying 2an+3bn=4cn.2a^n + 3b^n = 4c^n.

A22024

For which real polynomials pp is there a real polynomial qq such that p(p(x))x=(p(x)x)2q(x)p(p(x)) - x = (p(x) - x)^2 q(x) for all real xx?

A32024

Let SS be the set of bijections T ⁣:{1,2,3}×{1,2,,2024}{1,2,,6072}T \colon \{1,2,3\} \times \{1,2,\dots,2024\} \to \{1,2,\dots,6072\} such that T(1,j)<T(2,j)<T(3,j)T(1,j) < T(2,j) < T(3,j) for all j{1,2,,2024}j \in \{1,2,\dots,2024\} and T(i,j)<T(i,j+1)T(i,j) < T(i,j+1) for all i{1,2,3}i \in \{1,2,3\} and j{1,2,,2023}j \in \{1,2,\dots,2023\}. Do there exist aa and cc in {1,2,3}\{1,2,3\} and bb and dd in {1,2,,2024}\{1,2,\dots,2024\} such that the fraction of elements TT in SS for which T(a,b)<T(c,d)T(a,b) < T(c,d) is at least 1/31/3 and at most 2/32/3?

A42024

Find all primes p>5p > 5 for which there exists an integer aa and an integer rr satisfying 1rp11 \leq r \leq p-1 with the following property: the sequence 1,a,a2,,ap51,a,a^2,\dots,a^{p-5} can be rearranged to form a sequence b0,b1,b2,,bp5b_0,b_1,b_2,\dots,b_{p-5} such that bnbn1rb_n-b_{n-1}-r is divisible by pp for 1np51 \leq n \leq p-5.

A52024

Consider a circle Ω\Omega with radius 9 and center at the origin (0,0)(0,0), and a disc Δ\Delta with radius 1 and center at (r,0)(r,0), where 0r80 \leq r \leq 8. Two points PP and QQ are chosen independently and uniformly at random on Ω\Omega. Which value(s) of rr minimize the probability that the chord PQ\overline{PQ} intersects Δ\Delta?

A62024

Let c0,c1,c2,c_0,c_1,c_2,\dots be the sequence defined so that 13x114x+9x24=k=0ckxk\frac{1-3x-\sqrt{1-14x+9x^2}}{4} = \sum_{k=0}^\infty c_k x^k for sufficiently small xx. For a positive integer nn, let AA be the nn-by-nn matrix with i,ji,j-entry ci+j1c_{i+j-1} for ii and jj in {1,,n}\{1,\dots,n\}. Find the determinant of AA.

B12024

Let nn and kk be positive integers. The square in the iith row and jjth column of an nn-by-nn grid contains the number i+jki+j-k. For which nn and kk is it possible to select nn squares from the grid, no two in the same row or column, such that the numbers contained in the selected squares are exactly 1,2,,n1,2,\dots,n?

B22024

Two convex quadrilaterals are called partners if they have three vertices in common and they can be labeled ABCDABCD and ABCEABCE so that EE is the reflection of DD across the perpendicular bisector of the diagonal AC\overline{AC}. Is there an infinite sequence of convex quadrilaterals such that each quadrilateral is a partner of its successor and no two elements of the sequence are congruent? [A diagram has been omitted.]

B32024

Let rnr_n be the nnth smallest positive solution to tanx=x\tan x = x, where the argument of tangent is in radians. Prove that 0<rn+1rnπ<1(n2+n)π0 < r_{n+1} - r_n - \pi < \frac{1}{(n^2+n)\pi} for n1n \geq 1.

B42024

Let nn be a positive integer. Set an,0=1a_{n,0} = 1. For k0k \geq 0, choose an integer mn,km_{n,k} uniformly at random from the set {1,,n}\{1,\dots,n\}, and let an,k+1={an,k+1,if mn,k>an,k;an,k,if mn,k=an,k;an,k1,if mn,k<an,k.a_{n,k+1} = \begin{cases} a_{n,k} + 1, & \mbox{if $m_{n,k} > a_{n,k};$} \\ a_{n,k}, & \mbox{if $m_{n,k} = a_{n,k}$;} \\ a_{n,k}-1, & \mbox{if $m_{n,k} < a_{n,k}$.} \end{cases} Let E(n)E(n) be the expected value of an,na_{n,n}. Determine limnE(n)/n\lim_{n\to \infty} E(n)/n.

B52024

Let kk and mm be positive integers. For a positive integer nn, let f(n)f(n) be the number of integer sequences x1,,xk,y1,,ym,zx_1,\dots,x_k,y_1,\dots,y_m,z satisfying 1x1xkzn1 \leq x_1 \leq \cdots \leq x_k \leq z \leq n and 1y1ymzn1 \leq y_1 \leq \cdots \leq y_m \leq z \leq n. Show that f(n)f(n) can be expressed as a polynomial in nn with nonnegative coefficients.

B62024

For a real number aa, let Fa(x)=n1nae2nxn2F_a(x) = \sum_{n \geq 1} n^a e^{2n} x^{n^2} for 0x<10 \leq x < 1. Find a real number cc such that

limx1Fa(x)e1/(1x)=0for all a<c, andlimx1Fa(x)e1/(1x)=for all a>c.\begin{align*} & \lim_{x \to 1^-} F_a(x) e^{-1/(1-x)} = 0 \qquad \mbox{for all $a < c$, and} \\ & \lim_{x \to 1^-} F_a(x) e^{-1/(1-x)} = \infty \qquad \mbox{for all $a > c$.} \end{align*}
A12023

For a positive integer nn, let fn(x)=cos(x)cos(2x)cos(3x)cos(nx)f_n(x) = \cos(x) \cos(2x) \cos(3x) \cdots \cos(nx). Find the smallest nn such that fn(0)>2023|f_n''(0)| > 2023.

A22023

Let nn be an even positive integer. Let pp be a monic, real polynomial of degree 2n2n; that is to say, p(x)=x2n+a2n1x2n1++a1x+a0p(x) = x^{2n} + a_{2n-1} x^{2n-1} + \cdots + a_1 x + a_0 for some real coefficients a0,,a2n1a_0, \dots, a_{2n-1}. Suppose that p(1/k)=k2p(1/k) = k^2 for all integers kk such that 1kn1 \leq |k| \leq n. Find all other real numbers xx for which p(1/x)=x2p(1/x) = x^2.

A32023

Determine the smallest positive real number rr such that there exist differentiable functions f ⁣:RRf\colon \mathbb{R} \to \mathbb{R} and g ⁣:RRg\colon \mathbb{R} \to \mathbb{R} satisfying

  1. (a)
    f(0)>0f(0) > 0,
  2. (b)
    g(0)=0g(0) = 0,
  3. (c)
    f(x)g(x)|f'(x)| \leq |g(x)| for all xx,
  4. (d)
    g(x)f(x)|g'(x)| \leq |f(x)| for all xx, and
  5. (e)
    f(r)=0f(r) = 0.
A42023

Let v1,,v12v_1, \dots, v_{12} be unit vectors in R3\mathbb{R}^3 from the origin to the vertices of a regular icosahedron. Show that for every vector vR3v \in \mathbb{R}^3 and every ε>0\varepsilon > 0, there exist integers a1,,a12a_1,\dots,a_{12} such that a1v1++a12v12v<ε\| a_1 v_1 + \cdots + a_{12} v_{12} - v \| < \varepsilon.

A52023

For a nonnegative integer kk, let f(k)f(k) be the number of ones in the base 3 representation of kk. Find all complex numbers zz such that k=0310101(2)f(k)(z+k)2023=0.\sum_{k=0}^{3^{1010}-1} (-2)^{f(k)} (z+k)^{2023} = 0.

A62023

Alice and Bob play a game in which they take turns choosing integers from 11 to nn. Before any integers are chosen, Bob selects a goal of “odd” or “even”. On the first turn, Alice chooses one of the nn integers. On the second turn, Bob chooses one of the remaining integers. They continue alternately choosing one of the integers that has not yet been chosen, until the nnth turn, which is forced and ends the game. Bob wins if the parity of {k ⁣:the number k was chosen on the kth turn}\{k\colon \mbox{the number $k$ was chosen on the $k$th turn}\} matches his goal. For which values of nn does Bob have a winning strategy?

B12023

Consider an mm-by-nn grid of unit squares, indexed by (i,j)(i,j) with 1im1 \leq i \leq m and 1jn1 \leq j \leq n. There are (m1)(n1)(m-1)(n-1) coins, which are initially placed in the squares (i,j)(i,j) with 1im11 \leq i \leq m-1 and 1jn11 \leq j \leq n-1. If a coin occupies the square (i,j)(i,j) with im1i \leq m-1 and jn1j \leq n-1 and the squares (i+1,j),(i,j+1)(i+1,j), (i,j+1), and (i+1,j+1)(i+1,j+1) are unoccupied, then a legal move is to slide the coin from (i,j)(i,j) to (i+1,j+1)(i+1,j+1). How many distinct configurations of coins can be reached starting from the initial configuration by a (possibly empty) sequence of legal moves?

B22023

For each positive integer nn, let k(n)k(n) be the number of ones in the binary representation of 2023n2023 \cdot n. What is the minimum value of k(n)k(n)?

B32023

A sequence y1,y2,,yky_1,y_2,\dots,y_k of real numbers is called zigzag if k=1k=1, or if y2y1,y3y2,,ykyk1y_2-y_1, y_3-y_2, \dots, y_k-y_{k-1} are nonzero and alternate in sign. Let X1,X2,,XnX_1,X_2,\dots,X_n be chosen independently from the uniform distribution on [0,1][0,1]. Let a(X1,X2,,Xn)a(X_1,X_2,\dots,X_n) be the largest value of kk for which there exists an increasing sequence of integers i1,i2,,iki_1,i_2,\dots,i_k such that Xi1,Xi2,,XikX_{i_1},X_{i_2},\dots,X_{i_k} is zigzag. Find the expected value of a(X1,X2,,Xn)a(X_1,X_2,\dots,X_n) for n2n \geq 2.

B42023

For a nonnegative integer nn and a strictly increasing sequence of real numbers t0,t1,,tnt_0,t_1,\dots,t_n, let f(t)f(t) be the corresponding real-valued function defined for tt0t \geq t_0 by the following properties:

  1. (a)
    f(t)f(t) is continuous for tt0t \geq t_0, and is twice differentiable for all t>t0t>t_0 other than t1,,tnt_1,\dots,t_n;
  2. (b)
    f(t0)=1/2f(t_0) = 1/2;
  3. (c)
    limttk+f(t)=0\lim_{t \to t_k^+} f'(t) = 0 for 0kn0 \leq k \leq n;
  4. (d)
    For 0kn10 \leq k \leq n-1, we have f(t)=k+1f''(t) = k+1 when tk<t<tk+1t_k < t< t_{k+1}, and f(t)=n+1f''(t) = n+1 when t>tnt>t_n.

Considering all choices of nn and t0,t1,,tnt_0,t_1,\dots,t_n such that tktk1+1t_k \geq t_{k-1}+1 for 1kn1 \leq k \leq n, what is the least possible value of TT for which f(t0+T)=2023f(t_0+T) = 2023?

B52023

Determine which positive integers nn have the following property: For all integers mm that are relatively prime to nn, there exists a permutation π ⁣:{1,2,,n}{1,2,,n}\pi\colon \{1,2,\dots,n\} \to \{1,2,\dots,n\} such that π(π(k))mk(modn)\pi(\pi(k)) \equiv mk \pmod{n} for all k{1,2,,n}k \in \{1,2,\dots,n\}.

B62023

Let nn be a positive integer. For ii and jj in {1,2,,n}\{1,2,\dots,n\}, let s(i,j)s(i,j) be the number of pairs (a,b)(a,b) of nonnegative integers satisfying ai+bj=nai +bj=n. Let SS be the nn-by-nn matrix whose (i,j)(i,j) entry is s(i,j)s(i,j). For example, when n=5n=5, we have S=[6322230101210012000121112]S = \begin{bmatrix} 6 & 3 & 2 & 2 & 2 \\ 3 & 0 & 1 & 0 & 1 \\ 2 & 1 & 0 & 0 & 1 \\ 2 & 0 & 0 & 0 & 1 \\ 2 & 1 & 1 & 1 & 2 \end{bmatrix}. Compute the determinant of SS.

A12022

Determine all ordered pairs of real numbers (a,b)(a,b) such that the line y=ax+by = ax+b intersects the curve y=ln(1+x2)y = \ln(1+x^2) in exactly one point.

A22022

Let nn be an integer with n2n \geq 2. Over all real polynomials p(x)p(x) of degree nn, what is the largest possible number of negative coefficients of p(x)2p(x)^2?

A32022

Let pp be a prime number greater than 5. Let f(p)f(p) denote the number of infinite sequences a1,a2,a3,a_1, a_2, a_3, \dots such that an{1,2,,p1}a_n \in \{1, 2, \dots, p-1\} and anan+21+an+1(modp)a_n a_{n+2} \equiv 1 + a_{n+1} \pmod{p} for all n1n \geq 1. Prove that f(p)f(p) is congruent to 0 or 2 (mod5)\pmod{5}.

A42022

Suppose that X1,X2,X_1, X_2, \dots are real numbers between 0 and 1 that are chosen independently and uniformly at random. Let S=i=1kXi/2iS = \sum_{i=1}^k X_i/2^i, where kk is the least positive integer such that Xk<Xk+1X_k < X_{k+1}, or k=k = \infty if there is no such integer. Find the expected value of SS.

A52022

Alice and Bob play a game on a board consisting of one row of 2022 consecutive squares. They take turns placing tiles that cover two adjacent squares, with Alice going first. By rule, a tile must not cover a square that is already covered by another tile. The game ends when no tile can be placed according to this rule. Alice's goal is to maximize the number of uncovered squares when the game ends; Bob's goal is to minimize it. What is the greatest number of uncovered squares that Alice can ensure at the end of the game, no matter how Bob plays?

A62022

Let nn be a positive integer. Determine, in terms of nn, the largest integer mm with the following property: There exist real numbers x1,,x2nx_1,\dots,x_{2n} with 1<x1<x2<<x2n<1-1 < x_1 < x_2 < \cdots < x_{2n} < 1 such that the sum of the lengths of the nn intervals [x12k1,x22k1],[x32k1,x42k1],,[x2n12k1,x2n2k1][x_1^{2k-1}, x_2^{2k-1}], [x_3^{2k-1},x_4^{2k-1}], \dots, [x_{2n-1}^{2k-1}, x_{2n}^{2k-1}] is equal to 1 for all integers kk with 1km1 \leq k \leq m.

B12022

Suppose that P(x)=a1x+a2x2++anxnP(x) = a_1 x + a_2 x^2 + \cdots + a_n x^n is a polynomial with integer coefficients, with a1a_1 odd. Suppose that eP(x)=b0+b1x+b2x2+e^{P(x)} = b_0 + b_1 x + b_2 x^2 + \cdots for all xx. Prove that bkb_k is nonzero for all k0k \geq 0.

B22022

Let ×\times represent the cross product in R3\mathbb{R}^3. For what positive integers nn does there exist a set SR3S \subset \mathbb{R}^3 with exactly nn elements such that S={v×w:v,wS}?S = \{v \times w: v, w \in S\}?

B32022

Assign to each positive real number a color, either red or blue. Let DD be the set of all distances d>0d > 0 such that there are two points of the same color at distance dd apart. Recolor the positive reals so that the numbers in DD are red and the numbers not in DD are blue. If we iterate this recoloring process, will we always end up with all the numbers red after a finite number of steps?

B42022

Find all integers nn with n4n \geq 4 for which there exists a sequence of distinct real numbers x1,,xnx_1,\dots,x_n such that each of the sets

{x1,x2,x3},{x2,x3,x4},,{xn2,xn1,xn},{xn1,xn,x1}, and {xn,x1,x2}\begin{gather*} \{x_1,x_2,x_3\}, \{x_2,x_3,x_4\}, \dots, \\ \{x_{n-2},x_{n-1},x_n\}, \{x_{n-1},x_n, x_1\}, \mbox{ and } \{x_n, x_1, x_2\} \end{gather*}

forms a 3-term arithmetic progression when arranged in increasing order.

B52022

For 0p1/20 \leq p \leq 1/2, let X1,X2,X_1, X_2, \dots be independent random variables such that Xi={1with probability p,1with probability p,0with probability 12p,X_i = \begin{cases} 1 & \mbox{with probability $p$,} \\ -1 & \mbox{with probability $p$,} \\ 0 & \mbox{with probability $1-2p$,} \end{cases} for all i1i \geq 1. Given a positive integer nn and integers b,a1,,anb, a_1, \dots, a_n, let P(b,a1,,an)P(b, a_1, \dots, a_n) denote the probability that a1X1++anXn=ba_1 X_1 + \cdots + a_n X_n = b. For which values of pp is it the case that P(0,a1,,an)P(b,a1,,an)P(0, a_1, \dots, a_n) \geq P(b, a_1, \dots, a_n) for all positive integers nn and all integers b,a1,,anb, a_1, \dots, a_n?

B62022

Find all continuous functions f:R+R+f: \mathbb{R}^+ \to \mathbb{R}^+ such that f(xf(y))+f(yf(x))=1+f(x+y)f(xf(y)) + f(yf(x)) = 1 + f(x+y) for all x,y>0x,y > 0.

A12021

A grasshopper starts at the origin in the coordinate plane and makes a sequence of hops. Each hop has length 55, and after each hop the grasshopper is at a point whose coordinates are both integers; thus, there are 1212 possible locations for the grasshopper after the first hop. What is the smallest number of hops needed for the grasshopper to reach the point (2021,2021)(2021, 2021)?

A22021

For every positive real number xx, let g(x)=limr0((x+1)r+1xr+1)1r.g(x) = \lim_{r \to 0} ((x+1)^{r+1} - x^{r+1})^{\frac{1}{r}}. Find limxg(x)x\lim_{x \to \infty} \frac{g(x)}{x}.

A32021

Determine all positive integers NN for which the sphere x2+y2+z2=Nx^2 + y^2 + z^2 = N has an inscribed regular tetrahedron whose vertices have integer coordinates.

A42021

Let I(R)=x2+y2R2(1+2x21+x4+6x2y2+y41+y22+x4+y4)dxdy.I(R) = \iint_{x^2+y^2 \leq R^2} \left( \frac{1+2x^2}{1+x^4+6x^2y^2+y^4} - \frac{1+y^2}{2+x^4+y^4} \right)\,dx\,dy. Find limRI(R),\lim_{R \to \infty} I(R), or show that this limit does not exist.

A52021

Let AA be the set of all integers nn such that 1n20211 \leq n \leq 2021 and gcd(n,2021)=1\gcd(n, 2021) = 1. For every nonnegative integer jj, let S(j)=nAnj.S(j) = \sum_{n \in A} n^j. Determine all values of jj such that S(j)S(j) is a multiple of 2021.

A62021

Let P(x)P(x) be a polynomial whose coefficients are all either 00 or 11. Suppose that P(x)P(x) can be written as a product of two nonconstant polynomials with integer coefficients. Does it follow that P(2)P(2) is a composite integer?

B12021

Suppose that the plane is tiled with an infinite checkerboard of unit squares. If another unit square is dropped on the plane at random with position and orientation independent of the checkerboard tiling, what is the probability that it does not cover any of the corners of the squares of the checkerboard?

B22021

Determine the maximum value of the sum S=n=1n2n(a1a2an)1/nS = \sum_{n=1}^\infty \frac{n}{2^n} (a_1 a_2 \cdots a_n)^{1/n} over all sequences a1,a2,a3,a_1, a_2, a_3, \cdots of nonnegative real numbers satisfying k=1ak=1.\sum_{k=1}^\infty a_k = 1.

B32021

Let h(x,y)h(x,y) be a real-valued function that is twice continuously differentiable throughout R2\mathbb{R}^2, and define ρ(x,y)=yhxxhy.\rho(x,y) = yh_x - xh_y. Prove or disprove: For any positive constants dd and rr with d>rd>r, there is a circle S\mathcal{S} of radius rr whose center is a distance dd away from the origin such that the integral of ρ\rho over the interior of S\mathcal{S} is zero.

B42021

Let F0,F1,F_0, F_1, \dots be the sequence of Fibonacci numbers, with F0=0F_0 = 0, F1=1F_1 = 1, and Fn=Fn1+Fn2F_n = F_{n-1} + F_{n-2} for n2n \geq 2. For m>2m > 2, let RmR_m be the remainder when the product k=1Fm1kk\prod_{k=1}^{F_m-1} k^k is divided by FmF_m. Prove that RmR_m is also a Fibonacci number.

B52021

Say that an nn-by-nn matrix A=(aij)1i,jnA = (a_{ij})_{1 \leq i,j \leq n} with integer entries is very odd if, for every nonempty subset SS of {1,2,,n}\{1,2,\dots,n\}, the S|S|-by-S|S| submatrix (aij)i,jS(a_{ij})_{i,j \in S} has odd determinant. Prove that if AA is very odd, then AkA^k is very odd for every k1k \geq 1.

B62021

Given an ordered list of 3N3N real numbers, we can trim it to form a list of NN numbers as follows: We divide the list into NN groups of 33 consecutive numbers, and within each group, discard the highest and lowest numbers, keeping only the median.

Consider generating a random number XX by the following procedure: Start with a list of 320213^{2021} numbers, drawn independently and uniformly at random between 0 and 1. Then trim this list as defined above, leaving a list of 320203^{2020} numbers. Then trim again repeatedly until just one number remains; let XX be this number. Let μ\mu be the expected value of X12|X - \frac{1}{2}|. Show that μ14(23)2021.\mu \geq \frac{1}{4} \left( \frac{2}{3} \right)^{2021}.

A12020

How many positive integers NN satisfy all of the following three conditions?

  1. (i)
    NN is divisible by 2020.
  2. (ii)
    NN has at most 2020 decimal digits.
  3. (iii)
    The decimal digits of NN are a string of consecutive ones followed by a string of consecutive zeros.
A22020

Let kk be a nonnegative integer. Evaluate j=0k2kj(k+jj).\sum_{j=0}^k 2^{k-j} \binom{k+j}{j}.

A32020

Let a0=π/2a_0 = \pi/2, and let an=sin(an1)a_n = \sin(a_{n-1}) for n1n \geq 1. Determine whether n=1an2\sum_{n=1}^\infty a_n^2 converges.

A42020

Consider a horizontal strip of N+2N+2 squares in which the first and the last square are black and the remaining NN squares are all white. Choose a white square uniformly at random, choose one of its two neighbors with equal probability, and color this neighboring square black if it is not already black. Repeat this process until all the remaining white squares have only black neighbors. Let w(N)w(N) be the expected number of white squares remaining. Find limNw(N)N.\lim_{N \to \infty} \frac{w(N)}{N}.

A52020

Let ana_n be the number of sets SS of positive integers for which kSFk=n,\sum_{k \in S} F_k = n, where the Fibonacci sequence (Fk)k1(F_k)_{k \geq 1} satisfies Fk+2=Fk+1+FkF_{k+2} = F_{k+1} + F_k and begins F1=1,F2=1,F3=2,F4=3F_1 = 1, F_2 = 1, F_3 = 2, F_4 = 3. Find the largest integer nn such that an=2020a_n = 2020.

A62020

For a positive integer NN, let fNf_N[Corrected from FNF_N in the source.] be the function defined by fN(x)=n=0NN+1/2n(N+1)(2n+1)sin((2n+1)x).f_N(x) = \sum_{n=0}^N \frac{N+1/2-n}{(N+1)(2n+1)} \sin((2n+1)x). Determine the smallest constant MM such that fN(x)Mf_N(x) \leq M for all NN and all real xx.

B12020

For a positive integer nn, define d(n)d(n) to be the sum of the digits of nn when written in binary (for example, d(13)=1+1+0+1=3)d(13) = 1+1+0+1=3). Let S=k=12020(1)d(k)k3.S = \sum_{k=1}^{2020} (-1)^{d(k)} k^3. Determine SS modulo 2020.

B22020

Let kk and nn be integers with 1k<n1 \leq k < n. Alice and Bob play a game with kk pegs in a line of nn holes. At the beginning of the game, the pegs occupy the kk leftmost holes. A legal move consists of moving a single peg to any vacant hole that is further to the right. The players alternate moves, with Alice playing first. The game ends when the pegs are in the kk rightmost holes, so whoever is next to play cannot move and therefore loses. For what values of nn and kk does Alice have a winning strategy?

B32020

Let x0=1x_0 = 1, and let δ\delta be some constant satisfying 0<δ<10 < \delta < 1. Iteratively, for n=0,1,2,n=0,1,2,\dots, a point xn+1x_{n+1} is chosen uniformly from the interval [0,xn][0, x_n]. Let ZZ be the smallest value of nn for which xn<δx_n < \delta. Find the expected value of ZZ, as a function of δ\delta.

B42020

Let nn be a positive integer, and let VnV_n be the set of integer (2n+1)(2n+1)-tuples v=(s0,s1,,s2n1,s2n)\mathbf{v} = (s_0, s_1, \cdots, s_{2n-1}, s_{2n}) for which s0=s2n=0s_0 = s_{2n} = 0 and sjsj1=1|s_j - s_{j-1}| = 1 for j=1,2,,2nj=1,2,\cdots,2n. Define q(v)=1+j=12n13sj,q(\mathbf{v}) = 1 + \sum_{j=1}^{2n-1} 3^{s_j}, and let M(n)M(n) be the average of 1q(v)\frac{1}{q(\mathbf{v})} over all vVn\mathbf{v} \in V_n. Evaluate M(2020)M(2020).

B52020

For j{1,2,3,4}j \in \{1, 2, 3, 4\}, let zjz_j be a complex number with zj=1|z_j| = 1 and zj1z_j \neq 1. Prove that 3z1z2z3z4+z1z2z3z40.3 - z_1 - z_2 - z_3 - z_4 + z_1 z_2 z_3 z_4 \neq 0.

B62020

Let nn be a positive integer. Prove that k=1n(1)k(21)0.\sum_{k=1}^n (-1)^{\lfloor k(\sqrt{2}-1) \rfloor} \geq 0. (As usual, x\lfloor x \rfloor denotes the greatest integer less than or equal to xx.)

A12019

Determine all possible values of the expression A3+B3+C33ABCA^3+B^3+C^3-3ABC where A,BA, B, and CC are nonnegative integers.

A22019

In the triangle ABC\triangle ABC, let GG be the centroid, and let II be the center of the inscribed circle. Let α\alpha and β\beta be the angles at the vertices AA and BB, respectively. Suppose that the segment IGIG is parallel to ABAB and that β=2tan1(1/3)\beta = 2 \tan^{-1} (1/3). Find α\alpha.

A32019

Given real numbers b0,b1,,b2019b_0, b_1, \dots, b_{2019} with b20190b_{2019} \neq 0, let z1,z2,,z2019z_1,z_2,\dots,z_{2019} be the roots in the complex plane of the polynomial P(z)=k=02019bkzk.P(z) = \sum_{k=0}^{2019} b_k z^k. Let μ=(z1++z2019)/2019\mu = (|z_1| + \cdots + |z_{2019}|)/2019 be the average of the distances from z1,z2,,z2019z_1,z_2,\dots,z_{2019} to the origin. Determine the largest constant MM such that μM\mu \geq M for all choices of b0,b1,,b2019b_0,b_1,\dots, b_{2019} that satisfy 1b0<b1<b2<<b20192019.1 \leq b_0 < b_1 < b_2 < \cdots < b_{2019} \leq 2019.

A42019

Let ff be a continuous real-valued function on R3\mathbb{R}^3. Suppose that for every sphere SS of radius 1, the integral of f(x,y,z)f(x,y,z) over the surface of SS equals 0. Must f(x,y,z)f(x,y,z) be identically 0?

A52019

Let pp be an odd prime number, and let Fp\mathbb{F}_p denote the field of integers modulo pp. Let Fp[x]\mathbb{F}_p[x] be the ring of polynomials over Fp\mathbb{F}_p, and let q(x)Fp[x]q(x) \in \mathbb{F}_p[x] be given by q(x)=k=1p1akxk,q(x) = \sum_{k=1}^{p-1} a_k x^k, where ak=k(p1)/2modp.a_k = k^{(p-1)/2} \mod{p}. Find the greatest nonnegative integer nn such that (x1)n(x-1)^n divides q(x)q(x) in Fp[x]\mathbb{F}_p[x].

A62019

Let gg be a real-valued function that is continuous on the closed interval [0,1][0,1] and twice differentiable on the open interval (0,1)(0,1). Suppose that for some real number r>1r>1, limx0+g(x)xr=0.\lim_{x \to 0^+} \frac{g(x)}{x^r} = 0. Prove that either limx0+g(x)=0orlim supx0+xrg(x)=.\lim_{x \to 0^+} g'(x) = 0 \qquad \mbox{or} \qquad \limsup_{x \to 0^+} x^r |g''(x)| = \infty.

B12019

Denote by Z2\mathbb{Z}^2 the set of all points (x,y)(x,y) in the plane with integer coordinates. For each integer n0n \geq 0, let PnP_n be the subset of Z2\mathbb{Z}^2 consisting of the point (0,0)(0,0) together with all points (x,y)(x,y) such that x2+y2=2kx^2 + y^2 = 2^k for some integer knk \leq n. Determine, as a function of nn, the number of four-point subsets of PnP_n whose elements are the vertices of a square.

B22019

For all n1n \geq 1, let an=k=1n1sin((2k1)π2n)cos2((k1)π2n)cos2(kπ2n).a_n = \sum_{k=1}^{n-1} \frac{\sin \left( \frac{(2k-1)\pi}{2n} \right)}{\cos^2 \left( \frac{(k-1)\pi}{2n} \right) \cos^2 \left( \frac{k\pi}{2n} \right)}. Determine limnann3.\lim_{n \to \infty} \frac{a_n}{n^3}.

B32019

Let QQ be an nn-by-nn real orthogonal matrix, and let uRnu \in \mathbb{R}^n be a unit column vector (that is, uTu=1u^T u = 1). Let P=I2uuTP = I - 2uu^T, where II is the nn-by-nn identity matrix. Show that if 11 is not an eigenvalue of QQ, then 11 is an eigenvalue of PQPQ.

B42019

Let F\mathcal{F} be the set of functions f(x,y)f(x,y) that are twice continuously differentiable for x1x \geq 1, y1y \geq 1 and that satisfy the following two equations (where subscripts denote partial derivatives):

xfx+yfy=xyln(xy),x2fxx+y2fyy=xy.\begin{gather*} xf_x + yf_y = xy \ln(xy), \\ x^2 f_{xx} + y^2 f_{yy} = xy. \end{gather*}

For each fFf \in \mathcal{F}, let m(f)=mins1(f(s+1,s+1)f(s+1,s)f(s,s+1)+f(s,s)).m(f) = \min_{s \geq 1} \left(f(s+1,s+1) - f(s+1,s) - f(s,s+1) + f(s,s) \right). Determine m(f)m(f), and show that it is independent of the choice of ff.

B52019

Let FmF_m be the mmth Fibonacci number, defined by F1=F2=1F_1 = F_2 = 1 and Fm=Fm1+Fm2F_m = F_{m-1} + F_{m-2} for all m3m \geq 3. Let p(x)p(x) be the polynomial of degree 10081008 such that p(2n+1)=F2n+1p(2n+1) = F_{2n+1} for n=0,1,2,,1008n=0,1,2,\dots,1008. Find integers jj and kk such that p(2019)=FjFkp(2019) = F_j - F_k.

B62019

Let Zn\mathbb{Z}^n be the integer lattice in Rn\mathbb{R}^n. Two points in Zn\mathbb{Z}^n are called neighbors if they differ by exactly 11 in one coordinate and are equal in all other coordinates. For which integers n1n \geq 1 does there exist a set of points SZnS \subset \mathbb{Z}^n satisfying the following two conditions?

  1. (1)
    If pp is in SS, then none of the neighbors of pp is in SS.
  2. (2)
    If pZnp \in \mathbb{Z}^n is not in SS, then exactly one of the neighbors of pp is in SS.
A12018

Find all ordered pairs (a,b)(a,b) of positive integers for which 1a+1b=32018.\frac{1}{a} + \frac{1}{b} = \frac{3}{2018}.

A22018

Let S1,S2,,S2n1S_1, S_2, \dots, S_{2^n-1} be the nonempty subsets of {1,2,,n}\{1,2,\dots,n\} in some order, and let MM be the (2n1)×(2n1)(2^n-1) \times (2^n-1) matrix whose (i,j)(i,j) entry is mij={0if SiSj=;1otherwise.m_{ij} = \begin{cases} 0 & \mbox{if }S_i \cap S_j = \emptyset; \\ 1 & \mbox{otherwise.} \end{cases} Calculate the determinant of MM.

A32018

Determine the greatest possible value of i=110cos(3xi)\sum_{i=1}^{10} \cos(3x_i) for real numbers x1,x2,,x10x_1,x_2,\dots,x_{10} satisfying i=110cos(xi)=0\sum_{i=1}^{10} \cos(x_i) = 0.

A42018

Let mm and nn be positive integers with gcd(m,n)=1\gcd(m,n) = 1, and let ak=mknm(k1)na_k = \left\lfloor \frac{mk}{n} \right\rfloor - \left\lfloor \frac{m(k-1)}{n} \right\rfloor for k=1,2,,nk=1,2,\dots,n. Suppose that gg and hh are elements in a group GG and that gha1gha2ghan=e,gh^{a_1} gh^{a_2} \cdots gh^{a_n} = e, where ee is the identity element. Show that gh=hggh= hg. (As usual, x\lfloor x \rfloor denotes the greatest integer less than or equal to xx.)

A52018

Let f:RRf: \mathbb{R} \to \mathbb{R} be an infinitely differentiable function satisfying f(0)=0f(0) = 0, f(1)=1f(1)= 1, and f(x)0f(x) \geq 0 for all xRx \in \mathbb{R}. Show that there exist a positive integer nn and a real number xx such that f(n)(x)<0f^{(n)}(x) < 0.

A62018

Suppose that A,B,C,A,B,C, and DD are distinct points, no three of which lie on a line, in the Euclidean plane. Show that if the squares of the lengths of the line segments ABAB, ACAC, ADAD, BCBC, BDBD, and CDCD are rational numbers, then the quotient area(ABC)area(ABD)\frac{\mathrm{area}(\triangle ABC)}{\mathrm{area}(\triangle ABD)} is a rational number.

B12018

Let P\mathcal{P} be the set of vectors defined by P={(ab)0a2,0b100, and a,bZ}.\mathcal{P} = \left\{ \left. \begin{pmatrix} a \\ b \end{pmatrix} \right| 0 \leq a \leq 2, 0 \leq b \leq 100, \mbox{ and } a,b \in \mathbb{Z} \right\}. Find all vP\mathbf{v} \in \mathcal{P} such that the set P{v}\mathcal{P} \setminus \{ \mathbf{v} \} obtained by omitting vector v\mathbf{v} from P\mathcal{P} can be partitioned into two sets of equal size and equal sum.

B22018

Let nn be a positive integer, and let fn(z)=n+(n1)z+(n2)z2++zn1f_n(z) = n + (n-1) z + (n-2)z^2 + \cdots + z^{n-1}. Prove that fnf_n has no roots in the closed unit disk {zC ⁣:z1}\{z \in \mathbb{C}\colon |z| \leq 1 \}.

B32018

Find all positive integers n<10100n < 10^{100} for which simultaneously nn divides 2n2^n, n1n-1 divides 2n12^n-1, and n2n-2 divides 2n22^n - 2.

B42018

Given a real number aa, we define a sequence by x0=1x_0 = 1, x1=x2=ax_1 = x_2 = a, and xn+1=2xnxn1xn2x_{n+1} = 2x_n x_{n-1} - x_{n-2} for n2n \geq 2. Prove that if xn=0x_n = 0 for some nn, then the sequence is periodic.

B52018

Let f=(f1,f2)f = (f_1, f_2) be a function from R2\mathbb{R}^2 to R2\mathbb{R}^2 with continuous partial derivatives fixj\frac{\partial f_i}{\partial x_j} that are positive everywhere. Suppose that f1x1f2x214(f1x2+f2x1)2>0\frac{\partial f_1}{\partial x_1} \frac{\partial f_2}{\partial x_2} - \frac{1}{4} \left( \frac{\partial f_1}{\partial x_2} + \frac{\partial f_2}{\partial x_1} \right)^2 > 0 everywhere. Prove that ff is one-to-one.

B62018

Let SS be the set of sequences of length 20182018 whose terms are in the set {1,2,3,4,5,6,10}\{1,2,3,4,5,6,10\} and sum to 38603860. Prove that the cardinality of SS is at most 23860(20182048)2018.2^{3860} \cdot \left( \frac{2018}{2048} \right)^{2018}.

A12017

Let SS be the smallest set of positive integers such that

  1. (a)
    22 is in SS,
  2. (b)
    nn is in SS whenever n2n^2 is in SS, and
  3. (c)
    (n+5)2(n+5)^2 is in SS whenever nn is in SS.

Which positive integers are not in SS?

(The set SS is “smallest” in the sense that SS is contained in any other such set.)

A22017

Let Q0(x)=1Q_0(x) = 1, Q1(x)=xQ_1(x) = x, and Qn(x)=(Qn1(x))21Qn2(x)Q_n(x) = \frac{(Q_{n-1}(x))^2 - 1}{Q_{n-2}(x)} for all n2n \geq 2. Show that, whenever nn is a positive integer, Qn(x)Q_n(x) is equal to a polynomial with integer coefficients.

A32017

Let aa and bb be real numbers with a<ba<b, and let ff and gg be continuous functions from [a,b][a,b] to (0,)(0, \infty) such that abf(x)dx=abg(x)dx\int_a^b f(x)\,dx = \int_a^b g(x)\,dx but fgf \neq g. For every positive integer nn, define In=ab(f(x))n+1(g(x))ndx.I_n = \int_a^b \frac{(f(x))^{n+1}}{(g(x))^n}\,dx. Show that I1,I2,I3,I_1, I_2, I_3, \dots is an increasing sequence with limnIn=\lim_{n \to \infty} I_n = \infty.

A42017

A class with 2N2N students took a quiz, on which the possible scores were 0,1,,100,1,\dots,10. Each of these scores occurred at least once, and the average score was exactly 7.47.4. Show that the class can be divided into two groups of NN students in such a way that the average score for each group was exactly 7.47.4.

A52017

Each of the integers from 11 to nn is written on a separate card, and then the cards are combined into a deck and shuffled. Three players, AA, BB, and CC, take turns in the order A,B,C,A,A,B,C,A,\dots choosing one card at random from the deck. (Each card in the deck is equally likely to be chosen.) After a card is chosen, that card and all higher-numbered cards are removed from the deck, and the remaining cards are reshuffled before the next turn. Play continues until one of the three players wins the game by drawing the card numbered 11.

Show that for each of the three players, there are arbitrarily large values of nn for which that player has the highest probability among the three players of winning the game.

A62017

The 30 edges of a regular icosahedron are distinguished by labeling them 1,2,,301,2,\dots,30. How many different ways are there to paint each edge red, white, or blue such that each of the 20 triangular faces of the icosahedron has two edges of the same color and a third edge of a different color? [Note: the top matter on each exam paper included the logo of the Mathematical Association of America, which is itself an icosahedron.]

B12017

Let L1L_1 and L2L_2 be distinct lines in the plane. Prove that L1L_1 and L2L_2 intersect if and only if, for every real number λ0\lambda\neq 0 and every point PP not on L1L_1 or L2L_2, there exist points A1A_1 on L1L_1 and A2A_2 on L2L_2 such that PA2=λPA1\overrightarrow{PA_2} = \lambda \overrightarrow{PA_1}.

B22017

Suppose that a positive integer NN can be expressed as the sum of kk consecutive positive integers N=a+(a+1)+(a+2)++(a+k1)N = a + (a+1) +(a+2) + \cdots + (a+k-1) for k=2017k=2017 but for no other values of k>1k>1. Considering all positive integers NN with this property, what is the smallest positive integer aa that occurs in any of these expressions?

B32017

Suppose that f(x)=i=0cixif(x) = \sum_{i=0}^\infty c_i x^i is a power series for which each coefficient cic_i is 00 or 11. Show that if f(2/3)=3/2f(2/3) = 3/2, then f(1/2)f(1/2) must be irrational.

B42017

Evaluate the sum

k=0(3ln(4k+2)4k+2ln(4k+3)4k+3ln(4k+4)4k+4ln(4k+5)4k+5)=3ln22ln33ln44ln55+3ln66ln77ln88ln99+3ln1010.\begin{gather*} \sum_{k=0}^\infty \left( 3 \cdot \frac{\ln(4k+2)}{4k+2} - \frac{\ln(4k+3)}{4k+3} - \frac{\ln(4k+4)}{4k+4} - \frac{\ln(4k+5)}{4k+5} \right) \\ = 3 \cdot \frac{\ln 2}{2} - \frac{\ln 3}{3} - \frac{\ln 4}{4} - \frac{\ln 5}{5} + 3 \cdot \frac{\ln 6}{6} - \frac{\ln 7}{7} \\ - \frac{\ln 8}{8} - \frac{\ln 9}{9} + 3 \cdot \frac{\ln 10}{10} - \cdots . \end{gather*}

(As usual, lnx\ln x denotes the natural logarithm of xx.)

B52017

A line in the plane of a triangle TT is called an equalizer if it divides TT into two regions having equal area and equal perimeter. Find positive integers a>b>ca>b>c, with aa as small as possible, such that there exists a triangle with side lengths a,b,ca, b, c that has exactly two distinct equalizers.

B62017

Find the number of ordered 6464-tuples (x0,x1,,x63)(x_0,x_1,\dots,x_{63}) such that x0,x1,,x63x_0,x_1,\dots,x_{63} are distinct elements of {1,2,,2017}\{1,2,\dots,2017\} and x0+x1+2x2+3x3++63x63x_0 + x_1 + 2x_2 + 3x_3 + \cdots + 63 x_{63} is divisible by 2017.

A12016

Find the smallest positive integer jj such that for every polynomial p(x)p(x) with integer coefficients and for every integer kk, the integer p(j)(k)=djdxjp(x)x=kp^{(j)}(k) = \left. \frac{d^j}{dx^j} p(x) \right|_{x=k} (the jj-th derivative of p(x)p(x) at kk) is divisible by 2016.

A22016

Given a positive integer nn, let M(n)M(n) be the largest integer mm such that (mn1)>(m1n).\binom{m}{n-1} > \binom{m-1}{n}. Evaluate limnM(n)n.\lim_{n \to \infty} \frac{M(n)}{n}.

A32016

Suppose that ff is a function from R\mathbb{R} to R\mathbb{R} such that f(x)+f(11x)=arctanxf(x) + f\left( 1 - \frac{1}{x} \right) = \arctan x for all real x0x \neq 0. (As usual, y=arctanxy = \arctan x means π/2<y<π/2-\pi/2 < y < \pi/2 and tany=x\tan y = x.) Find 01f(x)dx.\int_0^1 f(x)\,dx.

A42016

Consider a (2m1)×(2n1)(2m-1) \times (2n-1) rectangular region, where mm and nn are integers such that m,n4m, n \geq 4. This region is to be tiled using tiles of the two types shown:

[ Figure omitted — see the original source for the diagram. ]

(The dotted lines divide the tiles into 1×11 \times 1 squares.) The tiles may be rotated and reflected, as long as their sides are parallel to the sides of the rectangular region. They must all fit within the region, and they must cover it completely without overlapping.

What is the minimum number of tiles required to tile the region?

A52016

Suppose that GG is a finite group generated by the two elements gg and hh, where the order of gg is odd. Show that every element of GG can be written in the form gm1hn1gm2hn2gmrhnrg^{m_1} h^{n_1} g^{m_2} h^{n_2} \cdots g^{m_r} h^{n_r} with 1rG1 \leq r \leq |G| and m1,n1,m2,n2,,mr,nr{1,1}m_1, n_1, m_2, n_2, \ldots, m_r, n_r \in \{-1, 1\}. (Here G|G| is the number of elements of GG.)

\,

A62016

Find the smallest constant CC such that for every real polynomial P(x)P(x) of degree 3 that has a root in the interval [0,1][0,1], 01P(x)dxCmaxx[0,1]P(x).\int_0^1 \left| P(x) \right|\,dx \leq C \max_{x \in [0,1]} \left| P(x) \right|.

B12016

Let x0,x1,x2,x_0,x_1,x_2,\dots be the sequence such that x0=1x_0=1 and for n0n \geq 0, xn+1=ln(exnxn)x_{n+1} = \ln(e^{x_n} - x_n) (as usual, the function ln\ln is the natural logarithm). Show that the infinite series x0+x1+x2+x_0 + x_1 + x_2 + \cdots converges and find its sum.

B22016

Define a positive integer nn to be squarish if either nn is itself a perfect square or the distance from nn to the nearest perfect square is a perfect square. For example, 2016 is squarish, because the nearest perfect square to 2016 is 452=202545^2 = 2025 and 20252016=92025-2016=9 is a perfect square. (Of the positive integers between 1 and 10, only 6 and 7 are not squarish.)

For a positive integer NN, let S(N)S(N) be the number of squarish integers between 1 and NN, inclusive. Find positive constants α\alpha and β\beta such that limNS(N)Nα=β,\lim_{N \to \infty} \frac{S(N)}{N^\alpha} = \beta, or show that no such constants exist.

B32016

Suppose that SS is a finite set of points in the plane such that the area of triangle ABC\triangle ABC is at most 1 whenever AA, BB, and CC are in SS. Show that there exists a triangle of area 4 that (together with its interior) covers the set SS.

B42016

Let AA be a 2n×2n2n \times 2n matrix, with entries chosen independently at random. Every entry is chosen to be 0 or 1, each with probability 1/21/2. Find the expected value of det(AAt)\det(A-A^t) (as a function of nn), where AtA^t is the transpose of AA.

B52016

Find all functions ff from the interval (1,)(1, \infty) to (1,)(1, \infty) with the following property: if x,y(1,)x,y \in (1, \infty) and x2yx3x^2 \leq y \leq x^3, then (f(x))2f(y)(f(x))3(f(x))^2 \leq f(y) \leq (f(x))^3.

B62016

Evaluate k=1(1)k1kn=01k2n+1.\sum_{k=1}^\infty \frac{(-1)^{k-1}}{k} \sum_{n=0}^\infty \frac{1}{k2^n + 1}.

A12015

Let AA and BB be points on the same branch of the hyperbola xy=1xy=1. Suppose that PP is a point lying between AA and BB on this hyperbola, such that the area of the triangle APBAPB is as large as possible. Show that the region bounded by the hyperbola and the chord APAP has the same area as the region bounded by the hyperbola and the chord PBPB.

A22015

Let a0=1a_0=1, a1=2a_1=2, and an=4an1an2a_n=4a_{n-1}-a_{n-2} for n2n\geq 2. Find an odd prime factor of a2015a_{2015}.

A32015

Compute log2(a=12015b=12015(1+e2πiab/2015))\log_2 \left( \prod_{a=1}^{2015} \prod_{b=1}^{2015} (1+e^{2\pi i a b/2015}) \right) Here ii is the imaginary unit (that is, i2=1i^2=-1).

A42015

For each real number xx, let f(x)=nSx12n,f(x) = \sum_{n\in S_x} \frac{1}{2^n}, where SxS_x is the set of positive integers nn for which nx\lfloor nx \rfloor is even. What is the largest real number LL such that f(x)Lf(x) \geq L for all x[0,1)x \in [0,1)? (As usual, z\lfloor z \rfloor denotes the greatest integer less than or equal to zz.)

A52015

Let qq be an odd positive integer, and let NqN_q denote the number of integers aa such that 0<a<q/40 < a < q/4 and gcd(a,q)=1\gcd(a,q) = 1. Show that NqN_q is odd if and only if qq is of the form pkp^k with kk a positive integer and pp a prime congruent to 55 or 77 modulo 88.

A62015

Let nn be a positive integer. Suppose that AA, BB, and MM are n×nn\times n matrices with real entries such that AM=MBAM = MB, and such that AA and BB have the same characteristic polynomial. Prove that det(AMX)=det(BXM)\det(A-MX) = \det(B-XM) for every n×nn\times n matrix XX with real entries.

B12015

Let ff be a three times differentiable function (defined on R\mathbb{R} and real-valued) such that ff has at least five distinct real zeros. Prove that f+6f+12f+8ff + 6f' + 12f'' + 8f''' has at least two distinct real zeros.

B22015

Given a list of the positive integers 1,2,3,4,1,2,3,4,\dots, take the first three numbers 1,2,31,2,3 and their sum 66 and cross all four numbers off the list. Repeat with the three smallest remaining numbers 4,5,74,5,7 and their sum 1616. Continue in this way, crossing off the three smallest remaining numbers and their sum, and consider the sequence of sums produced: 6,16,27,36,6, 16, 27, 36, \dots. Prove or disprove that there is some number in the sequence whose base 10 representation ends with 20152015.

\,

B32015

Let SS be the set of all 2×22 \times 2 real matrices M=(abcd)M = \begin{pmatrix} a & b \\ c & d \end{pmatrix} whose entries a,b,c,da,b,c,d (in that order) form an arithmetic progression. Find all matrices MM in SS for which there is some integer k>1k>1 such that MkM^k is also in SS.

B42015

Let TT be the set of all triples (a,b,c)(a,b,c) of positive integers for which there exist triangles with side lengths a,b,ca,b,c. Express (a,b,c)T2a3b5c\sum_{(a,b,c) \in T} \frac{2^a}{3^b 5^c} as a rational number in lowest terms.

B52015

Let PnP_n be the number of permutations π\pi of {1,2,,n}\{1,2,\dots,n\} such that ij=1 implies π(i)π(j)2|i-j| = 1 \mbox{ implies } |\pi(i) -\pi(j)| \leq 2 for all i,ji,j in {1,2,,n}\{1,2,\dots,n\}. Show that for n2n \geq 2, the quantity Pn+5Pn+4Pn+3+PnP_{n+5} - P_{n+4} - P_{n+3} + P_n does not depend on nn, and find its value.

B62015

For each positive integer kk, let A(k)A(k) be the number of odd divisors of kk in the interval [1,2k)[1, \sqrt{2k}). Evaluate k=1(1)k1A(k)k.\sum_{k=1}^\infty (-1)^{k-1} \frac{A(k)}{k}.

A12014

Prove that every nonzero coefficient of the Taylor series of (1x+x2)ex(1 - x + x^2)e^x about x=0x=0 is a rational number whose numerator (in lowest terms) is either 11 or a prime number.

A22014

Let AA be the n×nn \times n matrix whose entry in the ii-th row and jj-th column is 1min(i,j)\frac{1}{\min(i,j)} for 1i,jn1 \leq i,j \leq n. Compute det(A)\det(A).

A32014

Let a0=5/2a_0 = 5/2 and ak=ak122a_k = a_{k-1}^2 - 2 for k1k \geq 1. Compute k=0(11ak)\prod_{k=0}^\infty \left(1 - \frac{1}{a_k} \right) in closed form.

A42014

Suppose XX is a random variable that takes on only nonnegative integer values, with E[X]=1E\left[ X \right] = 1, E[X2]=2E\left[ X^2 \right] = 2, and E[X3]=5E \left[ X^3 \right] = 5. (Here E[y]E\left[ y \right] denotes the expectation of the random variable YY.) Determine the smallest possible value of the probability of the event X=0X=0.

A52014

Let Pn(x)=1+2x+3x2++nxn1.P_n(x) = 1 + 2 x + 3 x^2 + \cdots + n x^{n-1}. Prove that the polynomials Pj(x)P_j(x) and Pk(x)P_k(x) are relatively prime for all positive integers jj and kk with jkj \neq k.

A62014

Let nn be a positive integer. What is the largest kk for which there exist n×nn \times n matrices M1,,MkM_1, \dots, M_k and N1,,NkN_1, \dots, N_k with real entries such that for all ii and jj, the matrix product MiNjM_i N_j has a zero entry somewhere on its diagonal if and only if iji \neq j?

B12014

A base 1010 over-expansion of a positive integer NN is an expression of the form N=dk10k+dk110k1++d0100N = d_k 10^k + d_{k-1} 10^{k-1} + \cdots + d_0 10^0 with dk0d_k \neq 0 and di{0,1,2,,10}d_i \in \{0,1,2,\dots,10\} for all ii. For instance, the integer N=10N = 10 has two base 10 over-expansions: 10=1010010 = 10 \cdot 10^0 and the usual base 10 expansion 10=1101+010010 = 1 \cdot 10^1 + 0 \cdot 10^0. Which positive integers have a unique base 10 over-expansion?

B22014

Suppose that ff is a function on the interval [1,3][1,3] such that 1f(x)1-1 \leq f(x) \leq 1 for all xx and 13f(x)dx=0\int_1^3 f(x)\,dx = 0. How large can 13f(x)xdx\int_1^3 \frac{f(x)}{x}\,dx be?

\,

B32014

Let AA be an m×nm \times n matrix with rational entries. Suppose that there are at least m+nm+n distinct prime numbers among the absolute values of the entries of AA. Show that the rank of AA is at least 2.

B42014

Show that for each positive integer nn, all the roots of the polynomial k=0n2k(nk)xk\sum_{k=0}^n 2^{k(n-k)} x^k are real numbers.

B52014

In the 75th annual Putnam Games, participants compete at mathematical games. Patniss and Keeta play a game in which they take turns choosing an element from the group of invertible n×nn \times n matrices with entries in the field Z/pZ\mathbb{Z}/p \mathbb{Z} of integers modulo pp, where nn is a fixed positive integer and pp is a fixed prime number. The rules of the game are:

  1. (1)
    A player cannot choose an element that has been chosen by either player on any previous turn.
  2. (2)
    A player can only choose an element that commutes with all previously chosen elements.
  3. (3)
    A player who cannot choose an element on his/her turn loses the game.

Patniss takes the first turn. Which player has a winning strategy? (Your answer may depend on nn and pp.)

B62014

Let f:[0,1]Rf: [0,1] \to \mathbb{R} be a function for which there exists a constant K>0K>0 such that f(x)f(y)Kxy\left| f(x) - f(y) \right| \leq K \left| x - y \right| for all x,y[0,1]x,y \in [0,1]. Suppose also that for each rational number r[0,1]r \in [0,1], there exist integers aa and bb such that f(r)=a+brf(r) = a + br. Prove that there exist finitely many intervals I1,,InI_1, \dots, I_n such that ff is a linear function on each IiI_i and [0,1]=i=1nIi[0,1] = \bigcup_{i=1}^n I_i.

A12013

Recall that a regular icosahedron is a convex polyhedron having 12 vertices and 20 faces; the faces are congruent equilateral triangles. On each face of a regular icosahedron is written a nonnegative integer such that the sum of all 20 integers is 39. Show that there are two faces that share a vertex and have the same integer written on them.

A22013

Let SS be the set of all positive integers that are not perfect squares. For nn in SS, consider choices of integers a1,a2,,ara_1, a_2, \dots, a_r such that n<a1<a2<<arn < a_1< a_2 < \cdots < a_r and na1a2arn \cdot a_1 \cdot a_2 \cdots a_r is a perfect square, and let f(n)f(n) be the minumum of ara_r over all such choices. For example, 2362 \cdot 3 \cdot 6 is a perfect square, while 232 \cdot 3, 242 \cdot 4, 252 \cdot 5, 2342 \cdot 3 \cdot 4, 2352 \cdot 3 \cdot 5, 2452 \cdot 4 \cdot 5, and 23452 \cdot 3 \cdot 4 \cdot 5 are not, and so f(2)=6f(2) = 6. Show that the function ff from SS to the integers is one-to-one.

A32013

Suppose that the real numbers a0,a1,,ana_0, a_1, \dots, a_n and xx, with 0<x<10 < x < 1, satisfy a01x+a11x2++an1xn+1=0.\frac{a_0}{1-x} + \frac{a_1}{1-x^2} + \cdots + \frac{a_n}{1 - x^{n+1}} = 0. Prove that there exists a real number yy with 0<y<10 < y < 1 such that a0+a1y++anyn=0.a_0 + a_1 y + \cdots + a_n y^n = 0.

A42013

A finite collection of digits 00 and 11 is written around a circle. An arc of length L0L \geq 0 consists of LL consecutive digits around the circle. For each arc ww, let Z(w)Z(w) and N(w)N(w) denote the number of 00's in ww and the number of 11's in ww, respectively. Assume that Z(w)Z(w)1\left| Z(w) - Z(w') \right| \leq 1 for any two arcs w,ww, w' of the same length. Suppose that some arcs w1,,wkw_1,\dots,w_k have the property that Z=1kj=1kZ(wj) and N=1kj=1kN(wj)Z = \frac{1}{k} \sum_{j=1}^k Z(w_j) \mbox{ and } N = \frac{1}{k} \sum_{j=1}^k N(w_j) are both integers. Prove that there exists an arc ww with Z(w)=ZZ(w) = Z and N(w)=NN(w) = N.

A52013

For m3m \geq 3, a list of (m3)\binom{m}{3} real numbers aijka_{ijk} (1i<<j<km1 \leq i < < j < k \leq m) is said to be area definite for Rn\mathbb{R}^n if the inequality 1i<j<kmaijkArea(ΔAiAjAk)0\sum_{1 \leq i < j < k \leq m} a_{ijk} \cdot \mathrm{Area}(\Delta A_i A_j A_k) \geq 0 holds for every choice of mm points A1,,AmA_1,\dots,A_m in Rn\mathbb{R}^n. For example, the list of four numbers a123=a124=a134=1a_{123} = a_{124} = a_{134} = 1, a234=1a_{234} = -1 is area definite for R2\mathbb{R}^2. Prove that if a list of (m3)\binom{m}{3} numbers is area definite for R2\mathbb{R}^2, then it is area definite for R3\mathbb{R}^3.

A62013

Define a function w:Z×ZZw: \mathbb{Z} \times \mathbb{Z} \to \mathbb{Z} as follows. For a,b2\left| a \right|, \left| b \right| \leq 2, let w(a,b)w(a,b) be as in the table shown; otherwise, let w(a,b)=0w(a,b) = 0.

w(a,b)w(a,b)bb
-2-1012
-2-1-22-2-1
-1-24-44-2
aa02-412-42
1-24-44-2
2-1-22-2-1

For every finite subset SS of Z×Z\mathbb{Z} \times \mathbb{Z}, define A(S)=(s,s)S×Sw(ss).A(S) = \sum_{(\mathbf{s}, \mathbf{s}') \in S \times S} w(\mathbf{s} - \mathbf{s}'). Prove that if SS is any finite nonempty subset of Z×Z\mathbb{Z} \times \mathbb{Z}, then A(S)>0A(S) > 0. (For example, if S={(0,1),(0,2),(2,0),(3,1)}S = \{(0,1), (0,2), (2,0), (3,1)\}, then the terms in A(S)A(S) are 12,12,12,12,4,4,0,0,0,0,1,1,2,2,4,412, 12, 12, 12, 4, 4, 0, 0, 0,0,-1,-1,-2,-2,-4,-4.)

B12013

For positive integers nn, let the numbers c(n)c(n) be determined by the rules c(1)=1c(1) = 1, c(2n)=c(n)c(2n) = c(n), and c(2n+1)=(1)nc(n)c(2n+1) = (-1)^n c(n). Find the value of n=12013c(n)c(n+2).\sum_{n=1}^{2013} c(n) c(n+2).

B22013

Let C=N=1CNC = \bigcup_{N=1}^\infty C_N, where CNC_N denotes the set of those `cosine polynomials' of the form f(x)=1+n=1Nancos(2πnx)f(x) = 1 + \sum_{n=1}^N a_n \cos(2 \pi n x) for which:

  1. (i)
    f(x)0f(x) \geq 0 for all real xx, and
  2. (ii)
    an=0a_n = 0 whenever nn is a multiple of 33.

Determine the maximum value of f(0)f(0) as ff ranges through CC, and prove that this maximum is attained.

B32013

Let P\mathcal{P} be a nonempty collection of subsets of {1,,n}\{1,\dots, n\} such that:

  1. (i)
    if S,SPS, S' \in \mathcal{P}, then SSPS \cup S' \in \mathcal{P} and SSPS \cap S' \in \mathcal{P}, and
  2. (ii)
    if SPS \in \mathcal{P} and SS \neq \emptyset, then there is a subset TST \subset S such that TPT \in \mathcal{P} and TT contains exactly one fewer element than SS.

Suppose that f:PRf: \mathcal{P} \to \mathbb{R} is a function such that f()=0f(\emptyset) = 0 and f(SS)=f(S)+f(S)f(SS) for all S,SP.f(S \cup S') = f(S) + f(S') - f(S \cap S') \mbox{ for all $S,S' \in \mathcal{P}$.} Must there exist real numbers f1,,fnf_1,\dots,f_n such that f(S)=iSfif(S) = \sum_{i \in S} f_i for every SPS \in \mathcal{P}?

B42013

For any continuous real-valued function ff defined on the interval [0,1][0,1], let

μ(f)=01f(x)dx,Var(f)=01(f(x)μ(f))2dx,M(f)=max0x1f(x).\begin{gather*} \mu(f) = \int_0^1 f(x)\,dx, \, \mathrm{Var}(f) = \int_0^1 (f(x) - \mu(f))^2\,dx, \\ M(f) = \max_{0 \leq x \leq 1} \left| f(x) \right|. \end{gather*}

Show that if ff and gg are continuous real-valued functions defined on the interval [0,1][0,1], then Var(fg)2Var(f)M(g)2+2Var(g)M(f)2.\mathrm{Var}(fg) \leq 2 \mathrm{Var}(f) M(g)^2 + 2 \mathrm{Var}(g) M(f)^2.

B52013

Let X={1,2,,n}X = \{1, 2, \dots, n\}, and let kXk \in X. Show that there are exactly knn1k \cdot n^{n-1} functions f:XXf: X \to X such that for every xXx \in X there is a j0j \geq 0 such that f(j)(x)kf^{(j)}(x) \leq k. [Here f(j)f^{(j)} denotes the jjth iterate of ff, so that f(0)(x)=xf^{(0)}(x) = x and f(j+1)(x)=f(f(j)(x))f^{(j+1)}(x) = f(f^{(j)}(x)).]

B62013

Let n1n \geq 1 be an odd integer. Alice and Bob play the following game, taking alternating turns, with Alice playing first. The playing area consists of nn spaces, arranged in a line. Initially all spaces are empty. At each turn, a player either

  • places a stone in an empty space, or
  • removes a stone from a nonempty space ss, places a stone in the nearest empty space to the left of ss (if such a space exists), and places a stone in the nearest empty space to the right of ss (if such a space exists).

Furthermore, a move is permitted only if the resulting position has not occurred previously in the game. A player loses if he or she is unable to move. Assuming that both players play optimally throughout the game, what moves may Alice make on her first turn?

A12012

Let d1,d2,,d12d_1, d_2, \dots, d_{12} be real numbers in the open interval (1,12)(1, 12). Show that there exist distinct indices i,j,ki, j, k such that di,dj,dkd_i, d_j, d_k are the side lengths of an acute triangle.

A22012

Let * be a commutative and associative binary operation on a set SS. Assume that for every xx and yy in SS, there exists zz in SS such that xz=yx * z = y. (This zz may depend on xx and yy.) Show that if a,b,ca,b,c are in SS and ac=bca*c = b*c, then a=ba=b.

A32012

Let f:[1,1]Rf: [-1, 1] \to \RR be a continuous function such that

  • (i)
    f(x)=2x22f(x22x2)f(x) = \frac{2-x^2}{2} f \left( \frac{x^2}{2-x^2} \right) for every xx in [1,1][-1, 1],
  • (ii)
    f(0)=1f(0) = 1, and
  • (iii)
    limx1f(x)1x\lim_{x \to 1^-} \frac{f(x)}{\sqrt{1-x}} exists and is finite.

Prove that ff is unique, and express f(x)f(x) in closed form.

A42012

Let qq and rr be integers with q>0q > 0, and let AA and BB be intervals on the real line. Let TT be the set of all b+mqb+mq where bb and mm are integers with bb in BB, and let SS be the set of all integers aa in AA such that rara is in TT. Show that if the product of the lengths of AA and BB is less than qq, then SS is the intersection of AA with some arithmetic progression.

A52012

Let Fp\FF_p denote the field of integers modulo a prime pp, and let nn be a positive integer. Let vv be a fixed vector in Fpn\FF_p^n, let MM be an n×nn \times n matrix with entries of Fp\FF_p, and define G:FpnFpnG: \FF_p^n \to \FF_p^n by G(x)=v+MxG(x) = v + Mx. Let G(k)G^{(k)} denote the kk-fold composition of GG with itself, that is, G(1)(x)=G(x)G^{(1)}(x) = G(x) and G(k+1)(x)=G(G(k)(x))G^{(k+1)}(x) = G(G^{(k)}(x)). Determine all pairs p,np, n for which there exist vv and MM such that the pnp^n vectors G(k)(0)G^{(k)}(0), k=1,2,,pnk=1,2,\dots,p^n are distinct.

A62012

Let f(x,y)f(x,y) be a continuous, real-valued function on R2\RR^2. Suppose that, for every rectangular region RR of area 11, the double integral of f(x,y)f(x,y) over RR equals 00. Must f(x,y)f(x,y) be identically 0?

B12012

Let SS be a class of functions from [0,)[0, \infty) to [0,)[0, \infty) that satisfies:

  • (i)
    The functions f1(x)=ex1f_1(x) = e^x - 1 and f2(x)=ln(x+1)f_2(x) = \ln(x+1) are in SS;
  • (ii)
    If f(x)f(x) and g(x)g(x) are in SS, the functions f(x)+g(x)f(x) + g(x) and f(g(x))f(g(x)) are in SS;
  • (iii)
    If f(x)f(x) and g(x)g(x) are in SS and f(x)g(x)f(x) \geq g(x) for all x0x \geq 0, then the function f(x)g(x)f(x) - g(x) is in SS.

Prove that if f(x)f(x) and g(x)g(x) are in SS, then the function f(x)g(x)f(x) g(x) is also in SS.

B22012

Let PP be a given (non-degenerate) polyhedron. Prove that there is a constant c(P)>0c(P) > 0 with the following property: If a collection of nn balls whose volumes sum to VV contains the entire surface of PP, then n>c(P)/V2n > c(P) / V^2.

B32012

A round-robin tournament of 2n2n teams lasted for 2n12n-1 days, as follows. On each day, every team played one game against another team, with one team winning and one team losing in each of the nn games. Over the course of the tournament, each team played every other team exactly once. Can one necessarily choose one winning team from each day without choosing any team more than once?

B42012

Suppose that a0=1a_0 = 1 and that an+1=an+eana_{n+1} = a_n + e^{-a_n} for n=0,1,2,n=0,1,2,\dots. Does anlogna_n - \log n have a finite limit as nn \to \infty? (Here logn=logen=lnn\log n = \log_e n = \ln n.)

B52012

Prove that, for any two bounded functions g1,g2:R[1,)g_1, g_2: \RR \to [1, \infty), there exist functions h1,h2:RRh_1, h_2: \RR \to \RR such that, for every xRx \in \RR, supsR(g1(s)xg2(s))=maxtR(xh1(t)+h2(t)).\sup_{s \in \RR} (g_1(s)^x g_2(s)) = \max_{t \in \RR} (x h_1(t) + h_2(t)).

B62012

Let pp be an odd prime number such that p2(mod3)p \equiv 2 \pmod{3}. Define a permutation π\pi of the residue classes modulo pp by π(x)x3(modp)\pi(x) \equiv x^3 \pmod{p}. Show that π\pi is an even permutation if and only if p3(mod4)p \equiv 3 \pmod{4}.

A12011

Define a growing spiral in the plane to be a sequence of points with integer coordinates P0=(0,0),P1,,PnP_0 = (0,0), P_1, \dots, P_n such that n2n \geq 2 and:

  • the directed line segments P0P1,P1P2,,Pn1PnP_0 P_1, P_1 P_2, \dots, P_{n-1} P_n are in the successive coordinate directions east (for P0P1P_0 P_1), north, west, south, east, etc.;
  • the lengths of these line segments are positive and strictly increasing.

[Picture omitted.] How many of the points (x,y)(x,y) with integer coordinates 0x2011,0y20110\leq x\leq 2011, 0\leq y\leq 2011 cannot be the last point, PnP_n of any growing spiral?

A22011

Let a1,a2,a_1,a_2,\dots and b1,b2,b_1,b_2,\dots be sequences of positive real numbers such that a1=b1=1a_1 = b_1 = 1 and bn=bn1an2b_n = b_{n-1} a_n - 2 for n=2,3,n=2,3,\dots. Assume that the sequence (bj)(b_j) is bounded. Prove that S=n=11a1...anS = \sum_{n=1}^\infty \frac{1}{a_1...a_n} converges, and evaluate SS.

A32011

Find a real number cc and a positive number LL for which limrrc0π/2xrsinxdx0π/2xrcosxdx=L.\lim_{r\to\infty} \frac{r^c \int_0^{\pi/2} x^r \sin x \,dx}{\int_0^{\pi/2} x^r \cos x \,dx} = L.

A42011

For which positive integers nn is there an n×nn \times n matrix with integer entries such that every dot product of a row with itself is even, while every dot product of two different rows is odd?

A52011

Let F:R2RF : \RR^2 \to \RR and g:RRg : \RR \to \RR be twice continuously differentiable functions with the following properties:

  • F(u,u)=0F(u,u) = 0 for every uRu \in \RR;
  • for every xRx \in \RR, g(x)>0g(x) > 0 and x2g(x)1x^2 g(x) \leq 1;
  • for every (u,v)R2(u,v) \in \RR^2, the vector F(u,v)\nabla F(u,v) is either 0\mathbf{0} or parallel to the vector g(u),g(v)\langle g(u), -g(v) \rangle.

Prove that there exists a constant CC such that for every n2n\geq 2 and any x1,,xn+1Rx_1,\dots,x_{n+1} \in \RR, we have minijF(xi,xj)Cn.\min_{i \neq j} |F(x_i,x_j)| \leq \frac{C}{n}.

A62011

Let GG be an abelian group with nn elements, and let {g1=e,g2,,gk}G\{g_1=e,g_2,\dots,g_k\} \subsetneqq G be a (not necessarily minimal) set of distinct generators of GG. A special die, which randomly selects one of the elements g1,g2,...,gkg_1,g_2,...,g_k with equal probability, is rolled mm times and the selected elements are multiplied to produce an element gGg \in G. Prove that there exists a real number b(0,1)b \in (0,1) such that

limm1b2mxG(Prob(g=x)1n)2\lim_{m\to\infty} \frac{1}{b^{2m}} \sum_{x\in G} \left(\mathrm{Prob}(g=x) - \frac{1}{n}\right)^2 is positive and finite.

B12011

Let hh and kk be positive integers. Prove that for every ϵ>0\epsilon > 0, there are positive integers mm and nn such that ϵ<hmkn<2ϵ.\epsilon < |h \sqrt{m} - k \sqrt{n}| < 2\epsilon.

B22011

Let SS be the set of all ordered triples (p,q,r)(p,q,r) of prime numbers for which at least one rational number xx satisfies px2+qx+r=0px^2 + qx + r =0. Which primes appear in seven or more elements of SS?

B32011

Let ff and gg be (real-valued) functions defined on an open interval containing 00, with gg nonzero and continuous at 00. If fgfg and f/gf/g are differentiable at 00, must ff be differentiable at 0?

B42011

In a tournament, 2011 players meet 2011 times to play a multiplayer game. Every game is played by all 2011 players together and ends with each of the players either winning or losing. The standings are kept in two 2011×20112011 \times 2011 matrices, T=(Thk)T = (T_{hk}) and W=(Whk)W = (W_{hk}). Initially, T=W=0T=W=0. After every game, for every (h,k)(h,k) (including for h=kh=k), if players hh and kk tied (that is, both won or both lost), the entry ThkT_{hk} is increased by 1, while if player hh won and player kk lost, the entry WhkW_{hk} is increased by 1 and WkhW_{kh} is decreased by 1.

Prove that at the end of the tournament, det(T+iW)\det(T+iW) is a non-negative integer divisible by 220102^{2010}.

B52011

Let a1,a2,a_1, a_2, \dots be real numbers. Suppose that there is a constant AA such that for all nn, (i=1n11+(xai)2)2dxAn.\int_{-\infty}^\infty \left( \sum_{i=1}^n \frac{1}{1 + (x-a_i)^2} \right)^2\,dx \leq An. Prove there is a constant B>0B>0 such that for all nn, i,j=1n(1+(aiaj)2)Bn3.\sum_{i,j=1}^n (1 + (a_i - a_j)^2) \geq Bn^3.

B62011

Let pp be an odd prime. Show that for at least (p+1)/2(p+1)/2 values of nn in {0,1,2,,p1}\{0,1,2,\dots,p-1\}, k=0p1k!nkis not divisible by p.\sum_{k=0}^{p-1} k! n^k \qquad \mbox{is not divisible by $p$.}

A12010

Given a positive integer nn, what is the largest kk such that the numbers 1,2,,n1,2,\dots,n can be put into kk boxes so that the sum of the numbers in each box is the same? [When n=8n=8, the example {1,2,3,6},{4,8},{5,7}\{1,2,3,6\}, \{4,8\}, \{5,7\} shows that the largest kk is at least 3.]

A22010

Find all differentiable functions f:RRf:\mathbb{R} \to \mathbb{R} such that f(x)=f(x+n)f(x)nf'(x) = \frac{f(x+n)-f(x)}{n} for all real numbers xx and all positive integers nn.

A32010

Suppose that the function h:R2Rh:\mathbb{R}^2\to \mathbb{R} has continuous partial derivatives and satisfies the equation h(x,y)=ahx(x,y)+bhy(x,y)h(x,y) = a \frac{\partial h}{\partial x}(x,y) + b \frac{\partial h}{\partial y}(x,y) for some constants a,ba,b. Prove that if there is a constant MM such that h(x,y)M|h(x,y)|\leq M for all (x,y)R2(x,y) \in \mathbb{R}^2, then hh is identically zero.

A42010

Prove that for each positive integer nn, the number 101010n+1010n+10n110^{10^{10^n}} + 10^{10^n} + 10^n - 1 is not prime.

A52010

Let GG be a group, with operation *. Suppose that

  1. (i)
    GG is a subset of R3\mathbb{R}^3 (but * need not be related to addition of vectors);
  2. (ii)
    For each a,bG\mathbf{a},\mathbf{b} \in G, either a×b=ab\mathbf{a}\times \mathbf{b} = \mathbf{a}*\mathbf{b} or a×b=0\mathbf{a}\times \mathbf{b} = 0 (or both), where ×\times is the usual cross product in R3\mathbb{R}^3.

Prove that a×b=0\mathbf{a} \times \mathbf{b} = 0 for all a,bG\mathbf{a}, \mathbf{b} \in G.

A62010

Let f:[0,)Rf:[0,\infty)\to \mathbb{R} be a strictly decreasing continuous function such that limxf(x)=0\lim_{x\to\infty} f(x) = 0. Prove that 0f(x)f(x+1)f(x)dx\int_0^\infty \frac{f(x)-f(x+1)}{f(x)}\,dx diverges.

B12010

Is there an infinite sequence of real numbers a1,a2,a3,a_1, a_2, a_3, \dots such that a1m+a2m+a3m+=ma_1^m + a_2^m + a_3^m + \cdots = m for every positive integer mm?

B22010

Given that AA, BB, and CC are noncollinear points in the plane with integer coordinates such that the distances ABAB, ACAC, and BCBC are integers, what is the smallest possible value of ABAB?

B32010

There are 2010 boxes labeled B1,B2,,B2010B_1, B_2, \dots, B_{2010}, and 2010n2010n balls have been distributed among them, for some positive integer nn. You may redistribute the balls by a sequence of moves, each of which consists of choosing an ii and moving exactly ii balls from box BiB_i into any one other box. For which values of nn is it possible to reach the distribution with exactly nn balls in each box, regardless of the initial distribution of balls?

B42010

Find all pairs of polynomials p(x)p(x) and q(x)q(x) with real coefficients for which p(x)q(x+1)p(x+1)q(x)=1.p(x) q(x+1) - p(x+1) q(x) = 1.

B52010

Is there a strictly increasing function f:RRf: \mathbb{R} \to \mathbb{R} such that f(x)=f(f(x))f'(x) = f(f(x)) for all xx?

B62010

Let AA be an n×nn \times n matrix of real numbers for some n1n \geq 1. For each positive integer kk, let A[k]A^{[k]} be the matrix obtained by raising each entry to the kkth power. Show that if Ak=A[k]A^k = A^{[k]} for k=1,2,,n+1k=1,2,\dots,n+1, then Ak=A[k]A^k = A^{[k]} for all k1k \geq 1.

A12009

Let ff be a real-valued function on the plane such that for every square ABCDABCD in the plane, f(A)+f(B)+f(C)+f(D)=0f(A)+f(B)+f(C)+f(D)=0. Does it follow that f(P)=0f(P)=0 for all points PP in the plane?

A22009

Functions f,g,hf,g,h are differentiable on some open interval around 00 and satisfy the equations and initial conditions

f=2f2gh+1gh,f(0)=1,g=fg2h+4fh,g(0)=1,h=3fgh2+1fg,h(0)=1.\begin{gather*} f' = 2f^2gh+\frac{1}{gh},\quad f(0)=1, \\ g'=fg^2h+\frac{4}{fh}, \quad g(0)=1, \\ h'=3fgh^2+\frac{1}{fg}, \quad h(0)=1. \end{gather*}

Find an explicit formula for f(x)f(x), valid in some open interval around 00.

A32009

Let dnd_n be the determinant of the n×nn \times n matrix whose entries, from left to right and then from top to bottom, are cos1,cos2,,cosn2\cos 1, \cos 2, \dots, \cos n^2. (For example, d3=cos1cos2cos3cos4cos5cos6cos7cos8cos9.d_3 = \left| \begin{matrix} \cos 1 & \cos 2 & \cos 3 \\ \cos 4 & \cos 5 & \cos 6 \\ \cos 7 & \cos 8 & \cos 9 \end{matrix} \right|. The argument of cos\cos is always in radians, not degrees.) Evaluate limndn\lim_{n\to\infty} d_n.

A42009

Let SS be a set of rational numbers such that

  1. (a)
    0S0 \in S;
  2. (b)
    If xSx \in S then x+1Sx+1\in S and x1Sx-1\in S; and
  3. (c)
    If xSx\in S and x∉{0,1}x\not\in\{0,1\}, then 1x(x1)S\frac{1}{x(x-1)}\in S.

Must SS contain all rational numbers?

A62009

Let f:[0,1]2Rf:[0,1]^2 \to \mathbb{R} be a continuous function on the closed unit square such that fx\frac{\partial f}{\partial x} and fy\frac{\partial f}{\partial y} exist and are continuous on the interior (0,1)2(0,1)^2. Let a=01f(0,y)dya = \int_0^1 f(0,y)\,dy, b=01f(1,y)dyb = \int_0^1 f(1,y)\,dy, c=01f(x,0)dxc = \int_0^1 f(x,0)\,dx, d=01f(x,1)dxd = \int_0^1 f(x,1)\,dx. Prove or disprove: There must be a point (x0,y0)(x_0,y_0) in (0,1)2(0,1)^2 such that fx(x0,y0)=baandfy(x0,y0)=dc.\frac{\partial f}{\partial x} (x_0,y_0) = b - a \quad \mbox{and} \quad \frac{\partial f}{\partial y} (x_0,y_0) = d - c.

B12009

Show that every positive rational number can be written as a quotient of products of factorials of (not necessarily distinct) primes. For example, 109=2!5!3!3!3!.\frac{10}{9} = \frac{2!\cdot 5!}{3!\cdot 3! \cdot 3!}. \,

B22009

A game involves jumping to the right on the real number line. If aa and bb are real numbers and b>ab > a, the cost of jumping from aa to bb is b3ab2b^3-ab^2. For what real numbers cc can one travel from 00 to 11 in a finite number of jumps with total cost exactly cc?

B32009

Call a subset SS of {1,2,,n}\{1, 2, \dots, n\} mediocre if it has the following property: Whenever aa and bb are elements of SS whose average is an integer, that average is also an element of SS. Let A(n)A(n) be the number of mediocre subsets of {1,2,,n}\{1,2,\dots,n\}. [For instance, every subset of {1,2,3}\{1,2,3\} except {1,3}\{1,3\} is mediocre, so A(3)=7A(3) =7.] Find all positive integers nn such that A(n+2)2A(n+1)+A(n)=1A(n+2) - 2A(n+1) + A(n) = 1.

B42009

Say that a polynomial with real coefficients in two variables, x,yx,y, is balanced if the average value of the polynomial on each circle centered at the origin is 00. The balanced polynomials of degree at most 20092009 form a vector space VV over R\mathbb{R}. Find the dimension of VV.

B52009

Let f:(1,)Rf: (1, \infty) \to \mathbb{R} be a differentiable function such that f(x)=x2f(x)2x2(f(x)2+1)for all x>1.f'(x) = \frac{x^2 - f(x)^2}{x^2 (f(x)^2 + 1)} \qquad \mbox{for all $x>1$.} Prove that limxf(x)=\lim_{x \to \infty} f(x) = \infty.

B62009

Prove that for every positive integer nn, there is a sequence of integers a0,a1,,a2009a_0, a_1, \dots, a_{2009} with a0=0a_0 = 0 and a2009=na_{2009} = n such that each term after a0a_0 is either an earlier term plus 2k2^k for some nonnegative integer kk, or of the form bmodcb\,\mathrm{mod}\,c for some earlier positive terms bb and cc. [Here bmodcb\,\mathrm{mod}\,c denotes the remainder when bb is divided by cc, so 0(bmodc)<c0 \leq (b\,\mathrm{mod}\,c) < c.]

A12008

Let f:R2Rf: \mathbb{R}^2 \to \mathbb{R} be a function such that f(x,y)+f(y,z)+f(z,x)=0f(x,y) + f(y,z) + f(z,x) = 0 for all real numbers xx, yy, and zz. Prove that there exists a function g:RRg: \mathbb{R} \to \mathbb{R} such that f(x,y)=g(x)g(y)f(x,y) = g(x) - g(y) for all real numbers xx and yy.

A22008

Alan and Barbara play a game in which they take turns filling entries of an initially empty 2008×20082008 \times 2008 array. Alan plays first. At each turn, a player chooses a real number and places it in a vacant entry. The game ends when all the entries are filled. Alan wins if the determinant of the resulting matrix is nonzero; Barbara wins if it is zero. Which player has a winning strategy?

A32008

Start with a finite sequence a1,a2,,ana_1, a_2, \dots, a_n of positive integers. If possible, choose two indices j<kj < k such that aja_j does not divide aka_k, and replace aja_j and aka_k by gcd(aj,ak)\mathrm{gcd}(a_j, a_k) and lcm(aj,ak)\mathrm{lcm}(a_j, a_k), respectively. Prove that if this process is repeated, it must eventually stop and the final sequence does not depend on the choices made. (Note: gcd means greatest common divisor and lcm means least common multiple.)

A42008

Define f:RRf: \mathbb{R} \to \mathbb{R} by f(x)={xif xexf(lnx)if x>e.f(x) = \begin{cases} x & \mbox{if $x \leq e$} \\ x f(\ln x) & \mbox{if $x > e$.} \end{cases} Does n=11f(n)\sum_{n=1}^\infty \frac{1}{f(n)} converge?

A52008

Let n3n \geq 3 be an integer. Let f(x)f(x) and g(x)g(x) be polynomials with real coefficients such that the points (f(1),g(1)),(f(2),g(2)),,(f(n),g(n))(f(1), g(1)), (f(2), g(2)), \dots, (f(n), g(n)) in R2\mathbb{R}^2 are the vertices of a regular nn-gon in counterclockwise order. Prove that at least one of f(x)f(x) and g(x)g(x) has degree greater than or equal to n1n-1.

A62008

Prove that there exists a constant c>0c>0 such that in every nontrivial finite group GG there exists a sequence of length at most clogGc \log |G| with the property that each element of GG equals the product of some subsequence. (The elements of GG in the sequence are not required to be distinct. A subsequence of a sequence is obtained by selecting some of the terms, not necessarily consecutive, without reordering them; for example, 4,4,24, 4, 2 is a subsequence of 2,4,6,4,22, 4, 6, 4, 2, but 2,2,42, 2, 4 is not.)

B12008

What is the maximum number of rational points that can lie on a circle in R2\mathbb{R}^2 whose center is not a rational point? (A rational point is a point both of whose coordinates are rational numbers.)

B22008

Let F0(x)=lnxF_0(x) = \ln x. For n0n \geq 0 and x>0x > 0, let Fn+1(x)=0xFn(t)dtF_{n+1}(x) = \int_0^x F_n(t)\,dt. Evaluate limnn!Fn(1)lnn.\lim_{n \to \infty} \frac{n! F_n(1)}{\ln n}.

B32008

What is the largest possible radius of a circle contained in a 4-dimensional hypercube of side length 1?

B42008

Let pp be a prime number. Let h(x)h(x) be a polynomial with integer coefficients such that h(0),h(1),,h(p21)h(0), h(1), \dots, h(p^2-1) are distinct modulo p2p^2. Show that h(0),h(1),,h(p31)h(0), h(1), \dots, h(p^3-1) are distinct modulo p3p^3.

B52008

Find all continuously differentiable functions f:RRf: \mathbb{R} \to \mathbb{R} such that for every rational number qq, the number f(q)f(q) is rational and has the same denominator as qq. (The denominator of a rational number qq is the unique positive integer bb such that q=a/bq = a/b for some integer aa with gcd(a,b)=1\mathrm{gcd}(a,b) = 1.) (Note: gcd means greatest common divisor.)

B62008

Let nn and kk be positive integers. Say that a permutation σ\sigma of {1,2,,n}\{1,2,\dots,n\} is kk-limited if σ(i)ik|\sigma(i) - i| \leq k for all ii. Prove that the number of kk-limited permutations of {1,2,,n}\{1,2,\dots,n\} is odd if and only if n0n \equiv 0 or 11 (mod 2k+12k+1).

A12007

Find all values of α\alpha for which the curves y=αx2+αx+124y = \alpha x^2 + \alpha x + \frac{1}{24} and x=αy2+αy+124x = \alpha y^2 + \alpha y + \frac{1}{24} are tangent to each other.

A22007

Find the least possible area of a convex set in the plane that intersects both branches of the hyperbola xy=1xy = 1 and both branches of the hyperbola xy=1xy = -1. (A set SS in the plane is called convex if for any two points in SS the line segment connecting them is contained in SS.)

A32007

Let kk be a positive integer. Suppose that the integers 1,2,3,,3k+11, 2, 3, \dots, 3k+1 are written down in random order. What is the probability that at no time during this process, the sum of the integers that have been written up to that time is a positive integer divisible by 3? Your answer should be in closed form, but may include factorials.

A42007

A repunit is a positive integer whose digits in base 10 are all ones. Find all polynomials ff with real coefficients such that if nn is a repunit, then so is f(n)f(n).

A52007

Suppose that a finite group has exactly nn elements of order pp, where pp is a prime. Prove that either n=0n=0 or pp divides n+1n+1.

A62007

A triangulation T\mathcal{T} of a polygon PP is a finite collection of triangles whose union is PP, and such that the intersection of any two triangles is either empty, or a shared vertex, or a shared side. Moreover, each side is a side of exactly one triangle in T\mathcal{T}. Say that T\mathcal{T} is admissible if every internal vertex is shared by 6 or more triangles. For example, [figure omitted.] Prove that there is an integer MnM_n, depending only on nn, such that any admissible triangulation of a polygon PP with nn sides has at most MnM_n triangles.

B12007

Let ff be a polynomial with positive integer coefficients. Prove that if nn is a positive integer, then f(n)f(n) divides f(f(n)+1)f(f(n)+1) if and only if n=1n=1. [Editor's note: one must assume ff is nonconstant.]

B22007

Suppose that f:[0,1]Rf: [0,1] \to \mathbb{R} has a continuous derivative and that 01f(x)dx=0\int_0^1 f(x)\,dx = 0. Prove that for every α(0,1)\alpha \in (0,1), 0αf(x)dx18max0x1f(x).\left| \int_0^\alpha f(x)\,dx \right| \leq \frac{1}{8} \max_{0 \leq x \leq 1} |f'(x)|.

B32007

Let x0=1x_0 = 1 and for n0n \geq 0, let xn+1=3xn+xn5x_{n+1} = 3x_n + \lfloor x_n \sqrt{5} \rfloor. In particular, x1=5x_1 = 5, x2=26x_2 = 26, x3=136x_3 = 136, x4=712x_4 = 712. Find a closed-form expression for x2007x_{2007}. (a\lfloor a \rfloor means the largest integer a\leq a.)

B42007

Let nn be a positive integer. Find the number of pairs P,QP, Q of polynomials with real coefficients such that (P(X))2+(Q(X))2=X2n+1(P(X))^2 + (Q(X))^2 = X^{2n} + 1 and degP>degQ\deg P > \deg Q.

B52007

Let kk be a positive integer. Prove that there exist polynomials P0(n),P1(n),,Pk1(n)P_0(n), P_1(n), \dots, P_{k-1}(n) (which may depend on kk) such that for any integer nn, nkk=P0(n)+P1(n)nk++Pk1(n)nkk1.\left\lfloor \frac{n}{k} \right\rfloor^k = P_0(n) + P_1(n) \left\lfloor \frac{n}{k} \right\rfloor + \cdots + P_{k-1}(n) \left\lfloor \frac{n}{k} \right\rfloor^{k-1}. (a\lfloor a \rfloor means the largest integer a\leq a.)

B62007

For each positive integer nn, let f(n)f(n) be the number of ways to make n!n! cents using an unordered collection of coins, each worth k!k! cents for some kk, 1kn1 \leq k \leq n. Prove that for some constant CC, independent of nn, nn2/2Cnen2/4f(n)nn2/2+Cnen2/4.n^{n^2/2 - Cn} e^{-n^2/4} \leq f(n) \leq n^{n^2/2 + Cn}e^{-n^2/4}.

A12006

Find the volume of the region of points (x,y,z)(x,y,z) such that (x2+y2+z2+8)236(x2+y2).(x^2 + y^2 + z^2 + 8)^2 \leq 36(x^2 + y^2).

A22006

Alice and Bob play a game in which they take turns removing stones from a heap that initially has nn stones. The number of stones removed at each turn must be one less than a prime number. The winner is the player who takes the last stone. Alice plays first. Prove that there are infinitely many nn such that Bob has a winning strategy. (For example, if n=17n=17, then Alice might take 6 leaving 11; then Bob might take 1 leaving 10; then Alice can take the remaining stones to win.)

A32006

Let 1,2,3,,2005,2006,2007,2009,2012,2016,1, 2, 3, \dots, 2005, 2006, 2007, 2009, 2012, 2016, \dots be a sequence defined by xk=kx_k = k for k=1,2,,2006k=1, 2, \dots, 2006 and xk+1=xk+xk2005x_{k+1} = x_k + x_{k-2005} for k2006k \geq 2006. Show that the sequence has 2005 consecutive terms each divisible by 2006.

A42006

Let S={1,2,,n}S = \{1, 2, \dots, n\} for some integer n>1n > 1. Say a permutation π\pi of SS has a local maximum at kSk \in S if

  1. (i)
    π(k)>π(k+1)\pi(k) > \pi(k+1) for k=1k=1;
  2. (ii)
    π(k1)<π(k)\pi(k-1) < \pi(k) and π(k)>π(k+1)\pi(k) > \pi(k+1) for 1<k<n1 < k < n;
  3. (iii)
    π(k1)<π(k)\pi(k-1) < \pi(k) for k=nk=n.

(For example, if n=5n=5 and π\pi takes values at 1,2,3,4,51, 2, 3, 4, 5 of 2,1,4,5,32, 1, 4, 5, 3, then π\pi has a local maximum of 2 at k=1k=1, and a local maximum of 5 at k=4k=4.) What is the average number of local maxima of a permutation of SS, averaging over all permutations of SS?

A52006

Let nn be a positive odd integer and let θ\theta be a real number such that θ/π\theta/\pi is irrational. Set ak=tan(θ+kπ/n)a_k = \tan (\theta + k \pi/n), k=1,2,,nk=1,2,\dots,n. Prove that a1+a2++ana1a2an\frac{a_1 + a_2 + \cdots + a_n}{a_1 a_2 \cdots a_n} is an integer, and determine its value.

A62006

Four points are chosen uniformly and independently at random in the interior of a given circle. Find the probability that they are the vertices of a convex quadrilateral.

B12006

Show that the curve x3+3xy+y3=1x^3 + 3xy + y^3 = 1 contains only one set of three distinct points, AA, BB, and CC, which are vertices of an equilateral triangle, and find its area.

B22006

Prove that, for every set X={x1,x2,,xn}X = \{x_1, x_2, \dots, x_n\} of nn real numbers, there exists a non-empty subset SS of XX and an integer mm such that m+sSs1n+1.\left| m + \sum_{s \in S} s \right| \leq \frac{1}{n+1}.

B32006

Let SS be a finite set of points in the plane. A linear partition of SS is an unordered pair {A,B}\{A,B\} of subsets of SS such that AB=SA \cup B = S, AB=A \cap B = \emptyset, and AA and BB lie on opposite sides of some straight line disjoint from SS (AA or BB may be empty). Let LSL_S be the number of linear partitions of SS. For each positive integer nn, find the maximum of LSL_S over all sets SS of nn points.

B42006

Let ZZ denote the set of points in Rn\mathbb{R}^n whose coordinates are 0 or 1. (Thus ZZ has 2n2^n elements, which are the vertices of a unit hypercube in Rn\mathbb{R}^n.) Given a vector subspace VV of Rn\mathbb{R}^n, let Z(V)Z(V) denote the number of members of ZZ that lie in VV. Let kk be given, 0kn0 \leq k \leq n. Find the maximum, over all vector subspaces VRnV \subseteq \mathbb{R}^n of dimension kk, of the number of points in VZV \cap Z. [Editorial note: the proposers probably intended to write Z(V)Z(V) instead of “the number of points in VZV \cap Z”, but this changes nothing.]

B52006

For each continuous function f:[0,1]Rf: [0,1] \to \mathbb{R}, let I(f)=01x2f(x)dxI(f) = \int_0^1 x^2 f(x)\,dx and J(x)=01x(f(x))2dxJ(x) = \int_0^1 x \left(f(x)\right)^2\,dx. Find the maximum value of I(f)J(f)I(f) - J(f) over all such functions ff.

B62006

Let kk be an integer greater than 1. Suppose a0>0a_0 > 0, and define an+1=an+1anka_{n+1} = a_n + \frac{1}{\sqrt[k]{a_n}} for n>0n > 0. Evaluate limnank+1nk.\lim_{n \to \infty} \frac{a_n^{k+1}}{n^k}.

A12005

Show that every positive integer is a sum of one or more numbers of the form 2r3s2^r 3^s, where rr and ss are nonnegative integers and no summand divides another. (For example, 23 = 9 + 8 + 6.)

A22005

Let S={(a,b)a=1,2,,n,b=1,2,3}\mathbf{S} = \{(a,b) | a = 1, 2, \dots,n, b = 1,2,3\}. A rook tour of S\mathbf{S} is a polygonal path made up of line segments connecting points p1,p2,,p3np_1, p_2, \dots, p_{3n} in sequence such that

  1. (i)
    piSp_i \in \mathbf{S},
  2. (ii)
    pip_i and pi+1p_{i+1} are a unit distance apart, for 1i<3n1 \leq i <3n,
  3. (iii)
    for each pSp \in \mathbf{S} there is a unique ii such that pi=pp_i = p. How many rook tours are there that begin at (1,1)(1,1) and end at (n,1)(n,1)?

(An example of such a rook tour for n=5n=5 was depicted in the original.)

A32005

Let p(z)p(z) be a polynomial of degree nn all of whose zeros have absolute value 1 in the complex plane. Put g(z)=p(z)/zn/2g(z) = p(z)/z^{n/2}. Show that all zeros of g(z)=0g'(z) = 0 have absolute value 1.

A42005

Let HH be an n×nn \times n matrix all of whose entries are ±1\pm 1 and whose rows are mutually orthogonal. Suppose HH has an a×ba \times b submatrix whose entries are all 11. Show that abnab \leq n.

A52005

Evaluate 01ln(x+1)x2+1dx\int_0^1 \frac{\ln(x+1)}{x^2+1}\,dx.

A62005

Let nn be given, n4n \geq 4, and suppose that P1,P2,,PnP_1, P_2, \dots, P_n are nn randomly, independently and uniformly, chosen points on a circle. Consider the convex nn-gon whose vertices are the PiP_i. What is the probability that at least one of the vertex angles of this polygon is acute?

B12005

Find a nonzero polynomial P(x,y)P(x,y) such that P(a,2a)=0P(\lfloor a \rfloor, \lfloor 2a \rfloor) = 0 for all real numbers aa. (Note: ν\lfloor \nu \rfloor is the greatest integer less than or equal to ν\nu.)

B22005

Find all positive integers n,k1,,knn, k_1, \dots, k_n such that k1++kn=5n4k_1 + \cdots + k_n = 5n-4 and 1k1++1kn=1.\frac{1}{k_1} + \cdots + \frac{1}{k_n} = 1.

B32005

Find all differentiable functions f:(0,)(0,)f: (0, \infty) \to (0, \infty) for which there is a positive real number aa such that f(ax)=xf(x)f' \left( \frac{a}{x} \right) = \frac{x}{f(x)} for all x>0x > 0.

B42005

For positive integers mm and nn, let f(m,n)f(m,n) denote the number of nn-tuples (x1,x2,,xn)(x_1,x_2,\dots,x_n) of integers such that x1+x2++xnm|x_1| + |x_2| + \cdots + |x_n| \leq m. Show that f(m,n)=f(n,m)f(m,n) = f(n,m).

B52005

Let P(x1,,xn)P(x_1,\dots,x_n) denote a polynomial with real coefficients in the variables x1,,xnx_1, \dots, x_n, and suppose that (2x12++2xn2)P(x1,,xn)=0(identically)\left( \frac{\partial^2}{\partial x_1^2} + \cdots + \frac{\partial^2}{\partial x_n^2}\right) P(x_1, \dots,x_n) = 0 \quad \mbox{(identically)} % Equation labelled (a) (label to the left of the equation) in AMM version. and that x12++xn2 divides P(x1,,xn).x_1^2 + \cdots + x_n^2 \mbox{ divides } P(x_1, \dots, x_n). % Equation labelled (b) (label to the left of the equation) in AMM version. Show that P=0P=0 identically.

B62005

Let SnS_n denote the set of all permutations of the numbers 1,2,,n1,2,\dots,n. For πSn\pi \in S_n, let σ(π)=1\sigma(\pi) = 1 if π\pi is an even permutation and σ(π)=1\sigma(\pi) = -1 if π\pi is an odd permutation. Also, let ν(π)\nu(\pi) denote the number of fixed points of π\pi. Show that πSnσ(π)ν(π)+1=(1)n+1nn+1.\sum_{\pi \in S_n} \frac{\sigma(\pi)}{\nu(\pi) + 1} = (-1)^{n+1} \frac{n}{n+1}.

A12004

Basketball star Shanille O'Keal's team statistician keeps track of the number, S(N)S(N), of successful free throws she has made in her first NN attempts of the season. Early in the season, S(N)S(N) was less than 80% of NN, but by the end of the season, S(N)S(N) was more than 80% of NN. Was there necessarily a moment in between when S(N)S(N) was exactly 80% of NN?

A22004

For i=1,2i = 1,2 let TiT_i be a triangle with side lengths ai,bi,cia_i, b_i, c_i, and area AiA_i. Suppose that a1a2,b1b2,c1c2a_1 \le a_2, b_1 \le b_2, c_1 \le c_2, and that T2T_2 is an acute triangle. Does it follow that A1A2A_1 \le A_2?

A32004

Define a sequence {un}n=0\{ u_n \}_{n=0}^\infty by u0=u1=u2=1u_0 = u_1 = u_2 = 1, and thereafter by the condition that det(unun+1un+2un+3)=n!\det\begin{pmatrix} u_n & u_{n+1}\\ u_{n+2} & u_{n+3} \end{pmatrix} = n! for all n0n \ge 0. Show that unu_n is an integer for all nn. (By convention, 0!=10! = 1.)

A42004

Show that for any positive integer nn there is an integer NN such that the product x1x2xnx_1 x_2 \cdots x_n can be expressed identically in the form x1x2xn=i=1Nci(ai1x1+ai2x2++ainxn)nx_1 x_2 \cdots x_n = \sum_{i=1}^N c_i ( a_{i1} x_1 + a_{i2} x_2 + \cdots + a_{in} x_n )^n where the cic_i are rational numbers and each aija_{ij} is one of the numbers 1,0,1-1, 0, 1.

A52004

An m×nm \times n checkerboard is colored randomly: each square is independently assigned red or black with probability 1/21/2. We say that two squares, pp and qq, are in the same connected monochromatic region if there is a sequence of squares, all of the same color, starting at pp and ending at qq, in which successive squares in the sequence share a common side. Show that the expected number of connected monochromatic regions is greater than mn/8m n / 8.

A62004

Suppose that f(x,y)f(x,y) is a continuous real-valued function on the unit square 0x1,0y10 \le x \le 1, 0 \le y \le 1. Show that

01(01f(x,y)dx)2dy+01(01f(x,y)dy)2dx(0101f(x,y)dxdy)2+0101[f(x,y)]2dxdy.\begin{align*} & \int_0^1 \left( \int_0^1 f(x,y) dx \right)^2 dy + \int_0^1 \left( \int_0^1 f(x,y) dy \right)^2 dx \\ &\leq \left( \int_0^1 \int_0^1 f(x,y) dx\, dy \right)^2 + \int_0^1 \int_0^1 \left[ f(x,y) \right]^2 dx\,dy. \end{align*}
B12004

Let P(x)=cnxn+cn1xn1++c0P(x) = c_n x^n + c_{n-1} x^{n-1} + \cdots + c_0 be a polynomial with integer coefficients. Suppose that rr is a rational number such that P(r)=0P(r) = 0. Show that the nn numbers

cnr,cnr2+cn1r,cnr3+cn1r2+cn2r,,cnrn+cn1rn1++c1r\begin{gather*} c_n r, \, c_n r^2 + c_{n-1} r, \, c_n r^3 + c_{n-1} r^2 + c_{n-2} r, \\ \dots, \, c_n r^n + c_{n-1} r^{n-1} + \cdots + c_1 r \end{gather*}

are integers.

B22004

Let mm and nn be positive integers. Show that (m+n)!(m+n)m+n<m!mmn!nn.\frac{(m+n)!}{(m+n)^{m+n}} < \frac{m!}{m^m} \frac{n!}{n^n}.

B32004

Determine all real numbers a>0a > 0 for which there exists a nonnegative continuous function f(x)f(x) defined on [0,a][0,a] with the property that the region R={(x,y);0xa,0yf(x)}R = \{ (x,y) ; 0 \le x \le a, 0 \le y \le f(x) \} has perimeter kk units and area kk square units for some real number kk.

B42004

Let nn be a positive integer, n2n \ge 2, and put θ=2π/n\theta = 2 \pi / n. Define points Pk=(k,0)P_k = (k,0) in the xyxy-plane, for k=1,2,,nk = 1, 2 , \dots, n. Let RkR_k be the map that rotates the plane counterclockwise by the angle θ\theta about the point PkP_k. Let RR denote the map obtained by applying, in order, R1R_1, then R2,R_2, \dots, then RnR_n. For an arbitrary point (x,y)(x,y), find, and simplify, the coordinates of R(x,y)R(x,y).

B52004

Evaluate limx1n=0(1+xn+11+xn)xn.\lim_{x \to 1^-} \prod_{n=0}^\infty \left(\frac{1 + x^{n+1}}{1 + x^n}\right)^{x^n}.

B62004

Let A\mathcal{A} be a non-empty set of positive integers, and let N(x)N(x) denote the number of elements of A\mathcal{A} not exceeding xx. Let B\mathcal{B} denote the set of positive integers bb that can be written in the form b=aab = a - a' with aAa \in \mathcal{A} and aAa' \in \mathcal{A}. Let b1<b2<b_1 < b_2 < \cdots be the members of B\mathcal{B}, listed in increasing order. Show that if the sequence bi+1bib_{i+1} - b_i is unbounded, then limxN(x)/x=0.\lim_{x \to\infty} N(x)/x = 0.

A12003

Let nn be a fixed positive integer. How many ways are there to write nn as a sum of positive integers, n=a1+a2++ak,n = a_1 + a_2 + \cdots + a_k, with kk an arbitrary positive integer and a1a2aka1+1a_1 \le a_2 \le \cdots \le a_k \le a_1 + 1? For example, with n=4n=4 there are four ways: 4, 2+2, 1+1+2, 1+1+1+1.

A22003

Let a1,a2,,ana_1, a_2, \dots, a_n and b1,b2,,bnb_1, b_2, \dots, b_n be nonnegative real numbers. Show that

(a1a2an)1/n+(b1b2bn)1/n[(a1+b1)(a2+b2)(an+bn)]1/n.\begin{align*} & (a_1 a_2 \cdots a_n)^{1/n} + (b_1 b_2 \cdots b_n)^{1/n} \\ &\leq [(a_1+b_1) (a_2+b_2) \cdots (a_n + b_n) ]^{1/n}. \end{align*}
A32003

Find the minimum value of sinx+cosx+tanx+cotx+secx+cscx| \sin x + \cos x + \tan x + \cot x + \sec x + \csc x | for real numbers xx.

A42003

Suppose that a,b,c,A,B,Ca,b,c,A,B,C are real numbers, a0a\ne 0 and A0A \ne 0, such that ax2+bx+cAx2+Bx+C| a x^2 + b x + c | \leq | A x^2 + B x + C | for all real numbers xx. Show that b24acB24AC.| b^2 - 4 a c | \leq | B^2 - 4 A C |.

A52003

A Dyck nn-path is a lattice path of nn upsteps (1,1)(1,1) and nn downsteps (1,1)(1,-1) that starts at the origin OO and never dips below the xx-axis. A return is a maximal sequence of contiguous downsteps that terminates on the xx-axis. For example, the Dyck 5-path illustrated has two returns, of length 3 and 1 respectively.

[ Figure omitted — see the original source for the diagram. ]

Show that there is a one-to-one correspondence between the Dyck nn-paths with no return of even length and the Dyck (n1)(n-1)-paths.

A62003

For a set SS of nonnegative integers, let rS(n)r_S(n) denote the number of ordered pairs (s1,s2)(s_1, s_2) such that s1Ss_1 \in S, s2Ss_2 \in S, s1s2s_1 \ne s_2, and s1+s2=ns_1 + s_2 = n. Is it possible to partition the nonnegative integers into two sets AA and BB in such a way that rA(n)=rB(n)r_A(n) = r_B(n) for all nn ?

B12003

Do there exist polynomials a(x),b(x),c(y),d(y)a(x), b(x), c(y), d(y) such that 1+xy+x2y2=a(x)c(y)+b(x)d(y)1 + x y + x^2 y^2 = a(x) c(y) + b(x) d(y) holds identically?

B22003

Let nn be a positive integer. Starting with the sequence 1,12,13,,1n1, \frac{1}{2}, \frac{1}{3}, \dots, \frac{1}{n}, form a new sequence of n1n-1 entries 34,512,,2n12n(n1)\frac{3}{4}, \frac{5}{12}, \dots, \frac{2n-1}{2n(n-1)} by taking the averages of two consecutive entries in the first sequence. Repeat the averaging of neighbors on the second sequence to obtain a third sequence of n2n-2 entries, and continue until the final sequence produced consists of a single number xnx_n. Show that xn<2/nx_n < 2/n.

B32003

Show that for each positive integer n, n!=i=1nlcm{1,2,,n/i}.n! = \prod_{i=1}^n \mathrm{lcm}\{1, 2, \dots, \lfloor n/i\rfloor\} . (Here lcm\mathrm{lcm} denotes the least common multiple, and x\lfloor x \rfloor denotes the greatest integer x\leq x.)

B42003

Let f(z)=az4+bz3+cz2+dz+e=a(zr1)(zr2)(zr3)(zr4)f(z) = a z^4 + b z^3 + c z^2 + d z + e = a(z-r_1)(z-r_2)(z-r_3)(z-r_4) where a,b,c,d,ea,b,c,d,e are integers, a0a \ne 0. Show that if r1+r2r_1 + r_2 is a rational number and r1+r2r3+r4r_1 + r_2 \ne r_3 + r_4, then r1r2r_1 r_2 is a rational number.

B52003

Let A,BA,B, and CC be equidistant points on the circumference of a circle of unit radius centered at OO, and let PP be any point in the circle's interior. Let a,b,ca, b, c be the distance from PP to A,B,CA, B, C, respectively. Show that there is a triangle with side lengths a,b,ca, b, c, and that the area of this triangle depends only on the distance from PP to OO.

B62003

Let f(x)f(x) be a continuous real-valued function defined on the interval [0,1][0,1]. Show that 0101f(x)+f(y)dxdy01f(x)dx.\int_0^1 \int_0^1 | f(x) + f(y) |\,dx\,dy \geq \int_0^1 |f(x)|\,dx.

A12002

Let kk be a fixed positive integer. The nn-th derivative of 1xk1\frac{1}{x^k - 1} has the form Pn(x)(xk1)n+1\frac{P_n(x)}{(x^k - 1)^{n+1}} where Pn(x)P_n(x) is a polynomial. Find Pn(1)P_n(1).

A22002

Given any five points on a sphere, show that some four of them must lie on a closed hemisphere.

A32002

Let n2n \geq 2 be an integer and TnT_n be the number of non-empty subsets SS of {1,2,3,,n}\{1, 2, 3, \dots, n\} with the property that the average of the elements of SS is an integer. Prove that TnnT_n - n is always even.

A42002

In Determinant Tic-Tac-Toe, Player 1 enters a 1 in an empty 3×33 \times 3 matrix. Player 0 counters with a 0 in a vacant position, and play continues in turn until the 3×33 \times 3 matrix is completed with five 1's and four 0's. Player 0 wins if the determinant is 0 and player 1 wins otherwise. Assuming both players pursue optimal strategies, who will win and how?

A52002

Define a sequence by a0=1a_0=1, together with the rules a2n+1=ana_{2n+1} = a_n and a2n+2=an+an+1a_{2n+2} = a_n + a_{n+1} for each integer n0n \geq 0. Prove that every positive rational number appears in the set {an1an:n1}={11,12,21,13,32,}.\left\{ \frac{a_{n-1}}{a_n}: n \geq 1 \right\} = \left\{ \frac{1}{1}, \frac{1}{2}, \frac{2}{1}, \frac{1}{3}, \frac{3}{2}, \dots \right\}.

A62002

Fix an integer b2b \geq 2. Let f(1)=1f(1) = 1, f(2)=2f(2) = 2, and for each n3n \geq 3, define f(n)=nf(d)f(n) = n f(d), where dd is the number of base-bb digits of nn. For which values of bb does n=11f(n)\sum_{n=1}^\infty \frac{1}{f(n)} converge?

B12002

Shanille O'Keal shoots free throws on a basketball court. She hits the first and misses the second, and thereafter the probability that she hits the next shot is equal to the proportion of shots she has hit so far. What is the probability she hits exactly 50 of her first 100 shots?

B22002

Consider a polyhedron with at least five faces such that exactly three edges emerge from each of its vertices. Two players play the following game:

Each player, in turn, signs his or her name on a previously unsigned face. The winner is the player who first succeeds in signing three faces that share a common vertex.

Show that the player who signs first will always win by playing as well as possible.

B32002

Show that, for all integers n>1n > 1, 12ne<1e(11n)n<1ne.\frac{1}{2ne} < \frac{1}{e} - \left( 1 - \frac{1}{n} \right)^n < \frac{1}{ne}.

B42002

An integer nn, unknown to you, has been randomly chosen in the interval [1,2002][1, 2002] with uniform probability. Your objective is to select nn in an odd number of guesses. After each incorrect guess, you are informed whether nn is higher or lower, and you must guess an integer on your next turn among the numbers that are still feasibly correct. Show that you have a strategy so that the chance of winning is greater than 2/32/3.

B52002

A palindrome in base bb is a positive integer whose base-bb digits read the same backwards and forwards; for example, 20022002 is a 4-digit palindrome in base 10. Note that 200 is not a palindrome in base 10, but it is the 3-digit palindrome 242 in base 9, and 404 in base 7. Prove that there is an integer which is a 3-digit palindrome in base bb for at least 2002 different values of bb.

B62002

Let pp be a prime number. Prove that the determinant of the matrix (xyzxpypzpxp2yp2zp2)\begin{pmatrix} x & y & z \\ x^p & y^p & z^p \\ x^{p^2} & y^{p^2} & z^{p^2} \end{pmatrix} is congruent modulo pp to a product of polynomials of the form ax+by+czax+by+cz, where a,b,ca,b,c are integers. (We say two integer polynomials are congruent modulo pp if corresponding coefficients are congruent modulo pp.)

A12001

Consider a set SS and a binary operation *, i.e., for each a,bSa,b\in S, abSa*b\in S. Assume (ab)a=b(a*b)*a=b for all a,bSa,b\in S. Prove that a(ba)=ba*(b*a)=b for all a,bSa,b\in S.

A22001

You have coins C1,C2,,CnC_1,C_2,\ldots,C_n. For each kk, CkC_k is biased so that, when tossed, it has probability 1/(2k+1)1/(2k+1) of falling heads. If the nn coins are tossed, what is the probability that the number of heads is odd? Express the answer as a rational function of nn.

A32001

For each integer mm, consider the polynomial Pm(x)=x4(2m+4)x2+(m2)2.P_m(x)=x^4-(2m+4)x^2+(m-2)^2. For what values of mm is Pm(x)P_m(x) the product of two non-constant polynomials with integer coefficients?

A42001

Triangle ABCABC has an area 1. Points E,F,GE,F,G lie, respectively, on sides BCBC, CACA, ABAB such that AEAE bisects BFBF at point RR, BFBF bisects CGCG at point SS, and CGCG bisects AEAE at point TT. Find the area of the triangle RSTRST.

A52001

Prove that there are unique positive integers aa, nn such that an+1(a+1)n=2001a^{n+1}-(a+1)^n=2001.

A62001

Can an arc of a parabola inside a circle of radius 1 have a length greater than 4?

B12001

Let nn be an even positive integer. Write the numbers 1,2,,n21,2,\ldots,n^2 in the squares of an n×nn\times n grid so that the kk-th row, from left to right, is (k1)n+1,(k1)n+2,,(k1)n+n.(k-1)n+1,(k-1)n+2,\ldots, (k-1)n+n. Color the squares of the grid so that half of the squares in each row and in each column are red and the other half are black (a checkerboard coloring is one possibility). Prove that for each coloring, the sum of the numbers on the red squares is equal to the sum of the numbers on the black squares.

B22001

Find all pairs of real numbers (x,y)(x,y) satisfying the system of equations

1x+12y=(x2+3y2)(3x2+y2)1x12y=2(y4x4).\begin{align*} \frac{1}{x} + \frac{1}{2y} &= (x^2+3y^2)(3x^2+y^2) \\ \frac{1}{x} - \frac{1}{2y} &= 2(y^4-x^4). \end{align*}
B32001

For any positive integer nn, let n\langle n\rangle denote the closest integer to n\sqrt{n}. Evaluate n=12n+2n2n.\sum_{n=1}^\infty \frac{2^{\langle n\rangle}+2^{-\langle n\rangle}} {2^n}.

B42001

Let SS denote the set of rational numbers different from {1,0,1}\{-1,0,1\}. Define f:SSf:S\rightarrow S by f(x)=x1/xf(x)=x-1/x. Prove or disprove that n=1f(n)(S)=,\bigcap_{n=1}^\infty f^{(n)}(S) = \emptyset, where f(n)f^{(n)} denotes ff composed with itself nn times.

B52001

Let aa and bb be real numbers in the interval (0,1/2)(0,1/2), and let gg be a continuous real-valued function such that g(g(x))=ag(x)+bxg(g(x))= ag(x)+bx for all real xx. Prove that g(x)=cxg(x)=cx for some constant cc.

B62001

Assume that (an)n1(a_n)_{n\geq 1} is an increasing sequence of positive real numbers such that liman/n=0\lim a_n/n=0. Must there exist infinitely many positive integers nn such that ani+an+i<2ana_{n-i}+a_{n+i}<2a_n for i=1,2,,n1i=1,2,\ldots,n-1?

A12000

Let AA be a positive real number. What are the possible values of j=0xj2\sum_{j=0}^\infty x_j^2, given that x0,x1,x_0,x_1,\ldots are positive numbers for which j=0xj=A\sum_{j=0}^\infty x_j=A?

A22000

Prove that there exist infinitely many integers nn such that n,n+1,n+2n,n+1,n+2 are each the sum of the squares of two integers. [Example: 0=02+020=0^2+0^2, 1=02+121=0^2+1^2, 2=12+122=1^2+1^2.]

A32000

The octagon P1P2P3P4P5P6P7P8P_1P_2P_3P_4P_5P_6P_7P_8 is inscribed in a circle, with the vertices around the circumference in the given order. Given that the polygon P1P3P5P7P_1P_3P_5P_7 is a square of area 5, and the polygon P2P4P6P8P_2P_4P_6P_8 is a rectangle of area 4, find the maximum possible area of the octagon.

A42000

Show that the improper integral limB0Bsin(x)sin(x2)dx\lim_{B\to\infty}\int_{0}^B \sin(x) \sin(x^2)\,dx converges.

A52000

Three distinct points with integer coordinates lie in the plane on a circle of radius r>0r>0. Show that two of these points are separated by a distance of at least r1/3r^{1/3}.

A62000

Let f(x)f(x) be a polynomial with integer coefficients. Define a sequence a0,a1,a_0,a_1,\ldots of integers such that a0=0a_0=0 and an+1=f(an)a_{n+1}=f(a_n) for all n0n\geq 0. Prove that if there exists a positive integer mm for which am=0a_m=0 then either a1=0a_1=0 or a2=0a_2=0.

B12000

Let aj,bj,cja_j,b_j,c_j be integers for 1jN1\leq j\leq N. Assume for each jj, at least one of aj,bj,cja_j,b_j,c_j is odd. Show that there exist integers rr, ss, tt such that raj+sbj+tcjra_j+sb_j+tc_j is odd for at least 4N/74N/7 values of jj, 1jN1\leq j\leq N.

B22000

Prove that the expression gcd(m,n)n(nm)\frac{gcd(m,n)}{n}\binom{n}{m} is an integer for all pairs of integers nm1n\geq m\geq 1.

B32000

Let f(t)=j=1Najsin(2πjt)f(t)=\sum_{j=1}^N a_j \sin(2\pi jt), where each aja_j is real and aNa_N is not equal to 0. Let NkN_k denote the number of zeroes (including multiplicities) of dkfdtk\frac{d^k f}{dt^k}. Prove that N0N1N2 and limkNk=2N.N_0\leq N_1\leq N_2\leq \cdots \mbox{ and } \lim_{k\to\infty} N_k = 2N. [Editorial clarification: only zeroes in [0,1)[0, 1) should be counted.]

B42000

Let f(x)f(x) be a continuous function such that f(2x21)=2xf(x)f(2x^2-1)=2xf(x) for all xx. Show that f(x)=0f(x)=0 for 1x1-1\leq x\leq 1.

B52000

Let S0S_0 be a finite set of positive integers. We define finite sets S1,S2,S_1,S_2,\ldots of positive integers as follows: the integer aa is in Sn+1S_{n+1} if and only if exactly one of a1a-1 or aa is in SnS_n. Show that there exist infinitely many integers NN for which SN=S0{N+a:aS0}S_N=S_0\cup\{N+a: a\in S_0\}.

B62000

Let BB be a set of more than 2n+1/n2^{n+1}/n distinct points with coordinates of the form (±1,±1,,±1)(\pm 1,\pm 1,\ldots,\pm 1) in nn-dimensional space with n3n\geq 3. Show that there are three distinct points in BB which are the vertices of an equilateral triangle.

A11999

Find polynomials f(x)f(x),g(x)g(x), and h(x)h(x), if they exist, such that for all xx, f(x)g(x)+h(x)={1if x<13x+2if 1x02x+2if x>0.|f(x)|-|g(x)|+h(x) = \begin{cases} -1 & \mbox{if $x<-1$} \\ 3x+2 & \mbox{if $-1 \leq x \leq 0$} \\ -2x+2 & \mbox{if $x>0$.} \end{cases}

A21999

Let p(x)p(x) be a polynomial that is nonnegative for all real xx. Prove that for some kk, there are polynomials f1(x),,fk(xf_1(x),\dots,f_k(x) such that p(x)=j=1k(fj(x))2.p(x) = \sum_{j=1}^k (f_j(x))^2.

A31999

Consider the power series expansion 112xx2=n=0anxn.\frac{1}{1-2x-x^2} = \sum_{n=0}^\infty a_n x^n. Prove that, for each integer n0n\geq 0, there is an integer mm such that an2+an+12=am.a_n^2 + a_{n+1}^2 = a_m .

A41999

Sum the series m=1n=1m2n3m(n3m+m3n).\sum_{m=1}^\infty \sum_{n=1}^\infty \frac{m^2 n}{3^m(n3^m+m3^n)}.

A51999

Prove that there is a constant CC such that, if p(x)p(x) is a polynomial of degree 1999, then p(0)C11p(x)dx.|p(0)|\leq C \int_{-1}^1 |p(x)|\,dx.

A61999

The sequence (an)n1(a_n)_{n\geq 1} is defined by a1=1,a2=2,a3=24,a_1=1, a_2=2, a_3=24, and, for n4n\geq 4, an=6an12an38an1an22an2an3.a_n = \frac{6a_{n-1}^2a_{n-3} - 8a_{n-1}a_{n-2}^2}{a_{n-2}a_{n-3}}. Show that, for all n, ana_n is an integer multiple of nn.

B11999

Right triangle ABCABC has right angle at CC and BAC=θ\angle BAC =\theta; the point DD is chosen on ABAB so that AC=AD=1|AC|=|AD|=1; the point EE is chosen on BCBC so that CDE=θ\angle CDE = \theta. The perpendicular to BCBC at EE meets ABAB at FF. Evaluate limθ0EF\lim_{\theta\rightarrow 0} |EF|.

B21999

Let P(x)P(x) be a polynomial of degree nn such that P(x)=Q(x)P(x)P(x)=Q(x)P''(x), where Q(x)Q(x) is a quadratic polynomial and P(x)P''(x) is the second derivative of P(x)P(x). Show that if P(x)P(x) has at least two distinct roots then it must have nn distinct roots.

B31999

Let A={(x,y):0x,y<1}A=\{(x,y):0\leq x,y<1\}. For (x,y)A(x,y)\in A, let S(x,y)=12mn2xmyn,S(x,y) = \sum_{\frac{1}{2}\leq \frac{m}{n}\leq 2} x^m y^n, where the sum ranges over all pairs (m,n)(m,n) of positive integers satisfying the indicated inequalities. Evaluate lim(x,y)(1,1),(x,y)A(1xy2)(1x2y)S(x,y).\lim_{(x,y)\rightarrow (1,1), (x,y)\in A} (1-xy^2)(1-x^2y)S(x,y).

B41999

Let ff be a real function with a continuous third derivative such that f(x),f(x),f(x),f(x)f(x), f'(x), f''(x), f'''(x) are positive for all xx. Suppose that f(x)f(x)f'''(x)\leq f(x) for all xx. Show that f(x)<2f(x)f'(x)<2f(x) for all xx.

B51999

For an integer n3n\geq 3, let θ=2π/n\theta=2\pi/n. Evaluate the determinant of the n×nn\times n matrix I+AI+A, where II is the n×nn\times n identity matrix and A=(ajk)A=(a_{jk}) has entries ajk=cos(jθ+kθ)a_{jk}=\cos(j\theta+k\theta) for all j,kj,k.

B61999

Let SS be a finite set of integers, each greater than 1. Suppose that for each integer nn there is some sSs\in S such that gcd(s,n)=1\gcd(s,n)=1 or gcd(s,n)=s\gcd(s,n)=s. Show that there exist s,tSs,t\in S such that gcd(s,t)\gcd(s,t) is prime.

A11998

A right circular cone has base of radius 1 and height 3. A cube is inscribed in the cone so that one face of the cube is contained in the base of the cone. What is the side-length of the cube?

A21998

Let ss be any arc of the unit circle lying entirely in the first quadrant. Let AA be the area of the region lying below ss and above the xx-axis and let BB be the area of the region lying to the right of the yy-axis and to the left of ss. Prove that A+BA+B depends only on the arc length, and not on the position, of ss.

A31998

Let ff be a real function on the real line with continuous third derivative. Prove that there exists a point aa such that f(a)f(a)f(a)f(a)0.f(a)\cdot f'(a) \cdot f''(a) \cdot f'''(a)\geq 0 .

A41998

Let A1=0A_1=0 and A2=1A_2=1. For n>2n>2, the number AnA_n is defined by concatenating the decimal expansions of An1A_{n-1} and An2A_{n-2} from left to right. For example A3=A2A1=10A_3=A_2 A_1=10, A4=A3A2=101A_4=A_3 A_2 = 101, A5=A4A3=10110A_5=A_4 A_3 = 10110, and so forth. Determine all nn such that 1111 divides AnA_n.

A51998

Let F\mathcal F be a finite collection of open discs in R2\mathbb R^2 whose union contains a set ER2E\subseteq \mathbb R^2. Show that there is a pairwise disjoint subcollection D1,,DnD_1,\ldots, D_n in F\mathcal F such that Ej=1n3Dj.E\subseteq \cup_{j=1}^n 3D_j. Here, if DD is the disc of radius rr and center PP, then 3D3D is the disc of radius 3r3r and center PP.

A61998

Let A,B,CA, B, C denote distinct points with integer coordinates in R2\mathbb R^2. Prove that if (AB+BC)2<8[ABC]+1(|AB|+|BC|)^2<8\cdot [ABC]+1 then A,B,CA, B, C are three vertices of a square. Here XY|XY| is the length of segment XYXY and [ABC][ABC] is the area of triangle ABCABC.

B11998

Find the minimum value of (x+1/x)6(x6+1/x6)2(x+1/x)3+(x3+1/x3)\frac{(x+1/x)^6-(x^6+1/x^6)-2}{(x+1/x)^3+(x^3+1/x^3)} for x>0x>0.

B21998

Given a point (a,b)(a,b) with 0<b<a0<b<a, determine the minimum perimeter of a triangle with one vertex at (a,b)(a,b), one on the xx-axis, and one on the line y=xy=x. You may assume that a triangle of minimum perimeter exists.

B31998

let HH be the unit hemisphere {(x,y,z):x2+y2+z2=1,z0}\{(x,y,z):x^2+y^2+z^2=1,z\geq 0\}, CC the unit circle {(x,y,0):x2+y2=1}\{(x,y,0):x^2+y^2=1\}, and PP the regular pentagon inscribed in CC. Determine the surface area of that portion of HH lying over the planar region inside PP, and write your answer in the form Asinα+BcosβA \sin\alpha + B \cos\beta, where A,B,α,βA,B,\alpha,\beta are real numbers.

B41998

Find necessary and sufficient conditions on positive integers mm and nn so that i=0mn1(1)i/m+i/n=0.\sum_{i=0}^{mn-1} (-1)^{\lfloor i/m \rfloor +\lfloor i/n\rfloor}=0.

B51998

Let NN be the positive integer with 1998 decimal digits, all of them 1; that is, N=111111.N=1111\cdots 11. Find the thousandth digit after the decimal point of N\sqrt N.

B61998

Prove that, for any integers a,b,ca, b, c, there exists a positive integer nn such that n3+an2+bn+c\sqrt{n^3+an^2+bn+c} is not an integer.

A11997

A rectangle, HOMFHOMF, has sides HO=11HO=11 and OM=5OM=5. A triangle ABCABC has HH as the intersection of the altitudes, OO the center of the circumscribed circle, MM the midpoint of BCBC, and FF the foot of the altitude from AA. What is the length of BCBC?

A21997

Players 1,2,3,,n1,2,3,\ldots,n are seated around a table, and each has a single penny. Player 1 passes a penny to player 2, who then passes two pennies to player 3. Player 3 then passes one penny to Player 4, who passes two pennies to Player 5, and so on, players alternately passing one penny or two to the next player who still has some pennies. A player who runs out of pennies drops out of the game and leaves the table. Find an infinite set of numbers nn for which some player ends up with all nn pennies.

A31997

Evaluate

0(xx32+x524x7246+)(1+x222+x42242+x6224262+)dx.\begin{gather*} \int_0^\infty \left(x-\frac{x^3}{2}+\frac{x^5}{2\cdot 4}-\frac{x^7}{2\cdot 4\cdot 6}+\cdots\right) \\ \left(1+\frac{x^2}{2^2}+ \frac{x^4}{2^2\cdot 4^2}+\frac{x^6}{2^2\cdot 4^2 \cdot 6^2}+\cdots\right)\,dx. \end{gather*}
A41997

Let GG be a group with identity ee and ϕ:GG\phi:G\rightarrow G a function such that ϕ(g1)ϕ(g2)ϕ(g3)=ϕ(h1)ϕ(h2)ϕ(h3)\phi(g_1)\phi(g_2)\phi(g_3)=\phi(h_1)\phi(h_2)\phi(h_3) whenever g1g2g3=e=h1h2h3g_1g_2g_3=e=h_1h_2h_3. Prove that there exists an element aGa\in G such that ψ(x)=aϕ(x)\psi(x)=a\phi(x) is a homomorphism (i.e. ψ(xy)=ψ(x)ψ(y)\psi(xy)=\psi(x)\psi(y) for all x,yGx,y\in G).

A51997

Let NnN_n denote the number of ordered nn-tuples of positive integers (a1,a2,,an)(a_1,a_2,\ldots,a_n) such that 1/a1+1/a2++1/an=11/a_1 + 1/a_2 +\ldots + 1/a_n=1. Determine whether N10N_{10} is even or odd.

A61997

For a positive integer nn and any real number cc, define xkx_k recursively by x0=0x_0=0, x1=1x_1=1, and for k0k\geq 0, xk+2=cxk+1(nk)xkk+1.x_{k+2}=\frac{cx_{k+1}-(n-k)x_k}{k+1}. Fix nn and then take cc to be the largest value for which xn+1=0x_{n+1}=0. Find xkx_k in terms of nn and kk, 1kn1\leq k\leq n.

B11997

Let {x}\{x\} denote the distance between the real number xx and the nearest integer. For each positive integer nn, evaluate Fn=m=16n1min({m6n},{m3n}).F_n=\sum_{m=1}^{6n-1} \min(\{\frac{m}{6n}\},\{\frac{m}{3n}\}). (Here min(a,b)\min(a,b) denotes the minimum of aa and bb.)

B21997

Let ff be a twice-differentiable real-valued function satisfying f(x)+f(x)=xg(x)f(x),f(x)+f''(x)=-xg(x)f'(x), where g(x)0g(x)\geq 0 for all real xx. Prove that f(x)|f(x)| is bounded.

B31997

For each positive integer nn, write the sum m=1n1/m\sum_{m=1}^n 1/m in the form pn/qnp_n/q_n, where pnp_n and qnq_n are relatively prime positive integers. Determine all nn such that 5 does not divide qnq_n.

B41997

Let am,na_{m,n} denote the coefficient of xnx^n in the expansion of (1+x+x2)m(1+x+x^2)^m. Prove that for all [integers] k0k\geq 0, 0i=02k3(1)iaki,i1.0\leq \sum_{i=0}^{\lfloor \frac{2k}{3}\rfloor} (-1)^i a_{k-i,i}\leq 1.

B51997

Prove that for n2n\geq 2, 222n terms222n1 terms(modn).\overbrace{2^{2^{\cdots^{2}}}}^{\mbox{$n$ terms}} \equiv \overbrace{2^{2^{\cdots^{2}}}}^{\mbox{$n-1$ terms}} \quad \pmod{n}.

B61997

The dissection of the 3–4–5 triangle shown below (into four congruent right triangles similar to the original) has diameter 5/25/2. Find the least diameter of a dissection of this triangle into four parts. (The diameter of a dissection is the least upper bound of the distances between pairs of points belonging to the same part.)

A11996

Find the least number AA such that for any two squares of combined area 1, a rectangle of area AA exists such that the two squares can be packed in the rectangle (without interior overlap). You may assume that the sides of the squares are parallel to the sides of the rectangle.

A21996

Let C1C_1 and C2C_2 be circles whose centers are 10 units apart, and whose radii are 1 and 3. Find, with proof, the locus of all points MM for which there exists points XX on C1C_1 and YY on C2C_2 such that MM is the midpoint of the line segment XYXY.

A31996

Suppose that each of 20 students has made a choice of anywhere from 0 to 6 courses from a total of 6 courses offered. Prove or disprove: there are 5 students and 2 courses such that all 5 have chosen both courses or all 5 have chosen neither course.

A41996

Let SS be the set of ordered triples (a,b,c)(a, b, c) of distinct elements of a finite set AA. Suppose that

  1. (a,b,c)S(a,b,c) \in S if and only if (b,c,a)S(b,c,a) \in S;
  2. (a,b,c)S(a,b,c) \in S if and only if (c,b,a)S(c,b,a) \notin S;
  3. (a,b,c)(a,b,c) and (c,d,a)(c,d,a) are both in SS if and only if (b,c,d)(b,c,d) and (d,a,b)(d,a,b) are both in SS.

Prove that there exists a one-to-one function gg from AA to RR such that g(a)<g(b)<g(c)g(a) < g(b) < g(c) implies (a,b,c)S(a,b,c) \in S. Note: RR is the set of real numbers.

A51996

If pp is a prime number greater than 3 and k=2p/3k = \lfloor 2p/3 \rfloor, prove that the sum (p1)+(p2)++(pk)\binom p1 + \binom p2 + \cdots + \binom pk of binomial coefficients is divisible by p2p^2.

A61996

Let c>0c>0 be a constant. Give a complete description, with proof, of the set of all continuous functions f:RRf: R \to R such that f(x)=f(x2+c)f(x) = f(x^2+c) for all xRx \in R. Note that RR denotes the set of real numbers.

B11996

Define a selfish set to be a set which has its own cardinality (number of elements) as an element. Find, with proof, the number of subsets of {1,2,,n}\{1, 2, \ldots, n\} which are minimal selfish sets, that is, selfish sets none of whose proper subsets is selfish.

B21996

Show that for every positive integer nn, (2n1e)2n12<135(2n1)<(2n+1e)2n+12.\left( \frac{2n-1}{e} \right)^{\frac{2n-1}{2}} < 1 \cdot 3 \cdot 5 \cdots (2n-1) < \left( \frac{2n+1}{e} \right)^{\frac{2n+1}{2}}.

B31996

Given that {x1,x2,,xn}={1,2,,n}\{x_1, x_2, \ldots, x_n\} = \{1, 2, \ldots, n\}, find, with proof, the largest possible value, as a function of nn (with n2n \geq 2), of x1x2+x2x3++xn1xn+xnx1.x_1x_2 + x_2x_3 + \cdots + x_{n-1}x_n + x_nx_1.

B41996

For any square matrix AA, we can define sinA\sin A by the usual power series: sinA=n=0(1)n(2n+1)!A2n+1.\sin A = \sum_{n=0}^\infty \frac{(-1)^n}{(2n+1)!} A^{2n+1}. Prove or disprove: there exists a 2×22 \times 2 matrix AA with real entries such that sinA=(1199601).\sin A = \left( \begin{array}{cc} 1 & 1996 \\ 0 & 1 \end{array} \right).

B51996

Given a finite string SS of symbols XX and OO, we write Δ(S)\Delta(S) for the number of XX's in SS minus the number of OO's. For example, Δ(XOOXOOX)=1\Delta(XOOXOOX) = -1. We call a string SS balanced if every substring TT of (consecutive symbols of) SS has 2Δ(T)2-2 \leq \Delta(T) \leq 2. Thus, XOOXOOXXOOXOOX is not balanced, since it contains the substring OOXOOOOXOO. Find, with proof, the number of balanced strings of length nn.

B61996

Let (a1,b1),(a2,b2),,(an,bn)(a_1, b_1), (a_2, b_2), \ldots, (a_n, b_n) be the vertices of a convex polygon which contains the origin in its interior. Prove that there exist positive real numbers xx and yy such that

(a1,b1)xa1yb1+(a2,b2)xa2yb2++(an,bn)xanybn=(0,0).\begin{gather*} (a_1, b_1)x^{a_1} y^{b_1} + (a_2, b_2)x^{a_2}y^{b_2} + \cdots \\ + (a_n, b_n)x^{a_n}y^{b_n} = (0,0). \end{gather*}
A11995

Let SS be a set of real numbers which is closed under multiplication (that is, if aa and bb are in SS, then so is abab). Let TT and UU be disjoint subsets of SS whose union is SS. Given that the product of any {three} (not necessarily distinct) elements of TT is in TT and that the product of any three elements of UU is in UU, show that at least one of the two subsets T,UT,U is closed under multiplication.

A21995

For what pairs (a,b)(a,b) of positive real numbers does the improper integral b(x+axxxb)dx\int_{b}^{\infty} \left( \sqrt{\sqrt{x+a}-\sqrt{x}} - \sqrt{\sqrt{x}-\sqrt{x-b}} \right)\,dx converge?

A31995

The number d1d2d9d_{1}d_{2}\dots d_{9} has nine (not necessarily distinct) decimal digits. The number e1e2e9e_{1}e_{2}\dots e_{9} is such that each of the nine 9-digit numbers formed by replacing just one of the digits did_{i} is d1d2d9d_{1}d_{2}\dots d_{9} by the corresponding digit eie_{i} (1i91 \leq i \leq 9) is divisible by 7. The number f1f2f9f_{1}f_{2}\dots f_{9} is related to e1e2e9e_{1}e_{2}\dots e_{9} is the same way: that is, each of the nine numbers formed by replacing one of the eie_{i} by the corresponding fif_{i} is divisible by 7. Show that, for each ii, difid_{i}-f_{i} is divisible by 7. [For example, if d1d2d9=199501996d_{1}d_{2}\dots d_{9} = 199501996, then e6e_{6} may be 2 or 9, since 199502996199502996 and 199509996199509996 are multiples of 7.]

A41995

Suppose we have a necklace of nn beads. Each bead is labeled with an integer and the sum of all these labels is n1n-1. Prove that we can cut the necklace to form a string whose consecutive labels x1,x2,,xnx_{1},x_{2},\dots,x_{n} satisfy i=1kxik1fork=1,2,,n.\sum_{i=1}^{k} x_{i} \leq k-1 \qquad \mbox{for} \quad k=1,2,\dots,n.

A51995

Let x1,x2,,xnx_{1},x_{2},\dots,x_{n} be differentiable (real-valued) functions of a single variable tt which satisfy

dx1dt=a11x1+a12x2++a1nxndx2dt=a21x1+a22x2++a2nxndxndt=an1x1+an2x2++annxn\begin{align*} \frac{dx_{1}}{dt} &= a_{11}x_{1} + a_{12}x_{2} + \cdots + a_{1n}x_{n} \\ \frac{dx_{2}}{dt} &= a_{21}x_{1} + a_{22}x_{2} + \cdots + a_{2n}x_{n} \\ \vdots && \vdots \\ \frac{dx_{n}}{dt} &= a_{n1}x_{1} + a_{n2}x_{2} + \cdots + a_{nn}x_{n} \end{align*}

for some constants aij>0a_{ij}>0. Suppose that for all ii, xi(t)0x_{i}(t) \to 0 as tt \to \infty. Are the functions x1,x2,,xnx_{1},x_{2},\dots,x_{n} necessarily linearly dependent?

A61995

Suppose that each of nn people writes down the numbers 1,2,3 in random order in one column of a 3×n3 \times n matrix, with all orders equally likely and with the orders for different columns independent of each other. Let the row sums a,b,ca,b,c of the resulting matrix be rearranged (if necessary) so that abca \leq b \leq c. Show that for some n1995n \geq 1995, it is at least four times as likely that both b=a+1b=a+1 and c=a+2c=a+2 as that a=b=ca=b=c.

B11995

For a partition π\pi of {1,2,3,4,5,6,7,8,9}\{1, 2, 3, 4, 5, 6, 7, 8, 9\}, let π(x)\pi(x) be the number of elements in the part containing xx. Prove that for any two partitions π\pi and π\pi', there are two distinct numbers xx and yy in {1,2,3,4,5,6,7,8,9}\{1, 2, 3, 4, 5, 6, 7, 8, 9\} such that π(x)=π(y)\pi(x) = \pi(y) and π(x)=π(y)\pi'(x) = \pi'(y). [A { partition} of a set SS is a collection of disjoint subsets (parts) whose union is SS.]

B21995

An ellipse, whose semi-axes have lengths aa and bb, rolls without slipping on the curve y=csin(xa)y = c \sin \left( \frac{x}{a} \right). How are a,b,ca,b,c related, given that the ellipse completes one revolution when it traverses one period of the curve?

B31995

To each positive integer with n2n^{2} decimal digits, we associate the determinant of the matrix obtained by writing the digits in order across the rows. For example, for n=2n=2, to the integer 8617 we associate det(8617)=50\det \left( \begin{array}{cc} 8 & 6 \\ 1 & 7 \end{array} \right) = 50. Find, as a function of nn, the sum of all the determinants associated with n2n^{2}-digit integers. (Leading digits are assumed to be nonzero; for example, for n=2n=2, there are 9000 determinants.)

B41995

Evaluate 220712207122078.\sqrt[8]{2207 - \frac{1}{2207-\frac{1}{2207-\dots}}}. Express your answer in the form a+bcd\frac{a+b\sqrt{c}}{d}, where a,b,c,da,b,c,d are integers.

B51995

A game starts with four heaps of beans, containing 3,4,5 and 6 beans. The two players move alternately. A move consists of taking either

  • a)
    one bean from a heap, provided at least two beans are left behind in that heap, or
  • b)
    a complete heap of two or three beans.

The player who takes the last heap wins. To win the game, do you want to move first or second? Give a winning strategy.

B61995

For a positive real number α\alpha, define S(α)={nα:n=1,2,3,}.S(\alpha) = \{ \lfloor n\alpha \rfloor : n = 1,2,3,\dots \}. Prove that {1,2,3,}\{1,2,3,\dots\} cannot be expressed as the disjoint union of three sets S(α),S(β)S(\alpha), S(\beta) and S(γ)S(\gamma). [As usual, x\lfloor x \rfloor is the greatest integer x\leq x.]

A11994

Suppose that a sequence a1,a2,a3,a_1, a_2, a_3, \dots satisfies 0<ana2n+a2n+10 < a_n \leq a_{2n} + a_{2n+1} for all n1n \geq 1. Prove that the series n=1an\sum_{n=1}^{\infty} a_n diverges.

A21994

Let AA be the area of the region in the first quadrant bounded by the line y=12xy = \frac{1}{2} x, the xx-axis, and the ellipse 19x2+y2=1\frac{1}{9} x^2 + y^2 = 1. Find the positive number mm such that AA is equal to the area of the region in the first quadrant bounded by the line y=mxy = mx, the yy-axis, and the ellipse 19x2+y2=1\frac{1}{9} x^2 + y^2 = 1.

A31994

Show that if the points of an isosceles right triangle of side length 1 are each colored with one of four colors, then there must be two points of the same color whch are at least a distance 222 - \sqrt{2} apart.

A41994

Let AA and BB be 2×22 \times 2 matrices with integer entries such that A,A+B,A+2B,A+3BA, A+B, A+2B, A+3B, and A+4BA+4B are all invertible matrices whose inverses have integer entries. Show that A+5BA+5B is invertible and that its inverse has integer entries.

A51994

Let (rn)n0(r_n)_{n \geq 0} be a sequence of positive real numbers such that limnrn=0\lim_{n \to \infty} r_n = 0. Let SS be the set of numbers representable as a sum ri1+ri2++ri1994,r_{i_1} + r_{i_2} + \cdots + r_{i_{1994}}, with i1<i2<<i1994i_1 < i_2 < \cdots < i_{1994}. Show that every nonempty interval (a,b)(a,b) contains a nonempty subinterval (c,d)(c,d) that does not intersect SS.

A61994

Let f1,,f10f_1, \dots, f_{10} be bijections of the set of integers such that for each integer nn, there is some composition fi1fi2fimf_{i_1} \circ f_{i_2} \circ \cdots \circ f_{i_m} of these functions (allowing repetitions) which maps 0 to nn. Consider the set of 1024 functions F={f1e1f2e2f10e10},\mathcal{F} = \{f_1^{e_1} \circ f_2^{e_2} \circ \cdots \circ f_{10}^{e_{10}}\}, ei=0e_i = 0 or 1 for 1i101 \leq i \leq 10. (fi0f_i^0 is the identity function and fi1=fif_i^1 = f_i.) Show that if AA is any nonempty finite set of integers, then at most 512 of the functions in F\mathcal{F} map AA to itself.

B11994

Find all positive integers nn that are within 250 of exactly 15 perfect squares.

B21994

For which real numbers cc is there a straight line that intersects the curve x4+9x3+cx2+9x+4x^4 + 9x^3 + cx^2 + 9x + 4 in four distinct points?

B31994

Find the set of all real numbers kk with the following property: For any positive, differentiable function ff that satisfies f(x)>f(x)f'(x) > f(x) for all xx, there is some number NN such that f(x)>ekxf(x) > e^{kx} for all x>Nx > N.

B41994

For n1n \geq 1, let dnd_n be the greatest common divisor of the entries of AnIA^n - I, where A=(3243) and I=(1001).A = \begin{pmatrix} 3 & 2 \\ 4 & 3 \end{pmatrix} \quad \mbox{ and } \quad I = \begin{pmatrix} 1 & 0 \\ 0 & 1 \end{pmatrix}. Show that limndn=\lim_{n \to \infty} d_n = \infty.

B51994

For any real number α\alpha, define the function fα(x)=αxf_{\alpha}(x) = \lfloor \alpha x \rfloor. Let nn be a positive integer. Show that there exists an α\alpha such that for 1kn1 \leq k \leq n, fαk(n2)=n2k=fαk(n2).f_\alpha^k(n^2) = n^2 - k = f_{\alpha^k}(n^2).

B61994

For any integer nn, set na=101a1002a.n_a = 101a - 100\cdot 2^a. Show that for 0a,b,c,d990 \leq a,b,c,d \leq 99, na+nbnc+nd(mod10100)n_a + n_b \equiv n_c + n_d \pmod{10100} implies {a,b}={c,d}\{a,b\} = \{c,d\}.

A11993

The horizontal line y=cy=c intersects the curve y=2x3x3y = 2x - 3x^3 in the first quadrant as in the figure. Find cc so that the areas of the two shaded regions are equal. [Figure not included. The first region is bounded by the yy-axis, the line y=cy=c and the curve; the other lies under the curve and above the line y=cy=c between their two points of intersection.]

A21993

Let (xn)n0(x_n)_{n \geq 0} be a sequence of nonzero real numbers such that xn2xn1xn+1=1x_n^2 - x_{n-1}x_{n+1} = 1 for n=1,2,3,n=1,2,3,\dots. Prove there exists a real number aa such that xn+1=axnxn1x_{n+1} = ax_n - x_{n-1} for all n1n \geq 1.

A31993

Let Pn{\cal P}_n be the set of subsets of {1,2,,n}\{1, 2, \dots, n\}. Let c(n,m)c(n, m) be the number of functions f:Pn{1,2,,m}f: {\cal P}_n \to \{1, 2, \dots, m\} such that f(AB)=min{f(A),f(B)}f(A \cap B) = \min\{f(A), f(B)\}. Prove that c(n,m)=j=1mjn.c(n, m) = \sum_{j=1}^m j^n.

A41993

Let x1,x2,,x19x_1, x_2, \dots, x_{19} be positive integers each of which is less than or equal to 93. Let y1,y2,,y93y_1, y_2, \dots, y_{93} be positive integers each of which is less than or equal to 19. Prove that there exists a (nonempty) sum of some xix_i's equal to a sum of some yjy_j's.

A51993

Show that

10010(x2xx33x+1)2dx+1101111(x2xx33x+1)2dx+1011001110(x2xx33x+1)2dx\begin{gather*} \int_{-100}^{-10} \left( \frac{x^2 - x}{x^3 - 3x + 1} \right)^2\,dx + \\ \int_{\frac{1}{101}}^{\frac{1}{11}} \left( \frac{x^2 - x}{x^3 - 3x + 1} \right)^2\,dx + \\ \int_{\frac{101}{100}}^{\frac{11}{10}} \left( \frac{x^2 - x}{x^3 - 3x + 1} \right)^2\,dx \end{gather*}

is a rational number.

A61993

The infinite sequence of 2's and 3's

2,3,3,2,3,3,3,2,3,3,3,2,3,3,2,3,3,3,2,3,3,3,2,3,3,3,2,3,3,2,3,3,3,2,\begin{align*} &2,3,3,2,3,3,3,2,3,3,3,2,3,3,2,3,3, \\ &3,2,3,3,3,2,3,3,3,2,3,3,2,3,3,3,2,\dots \end{align*}

has the property that, if one forms a second sequence that records the number of 3's between successive 2's, the result is identical to the given sequence. Show that there exists a real number rr such that, for any nn, the nnth term of the sequence is 2 if and only if n=1+rmn = 1 + \lfloor rm \rfloor for some nonnegative integer mm. (Note: x\lfloor x \rfloor denotes the largest integer less than or equal to xx.)

B11993

Find the smallest positive integer nn such that for every integer mm with 0<m<19930 < m < 1993, there exists an integer kk for which m1993<kn<m+11994.\frac{m}{1993} < \frac{k}{n} < \frac{m+1}{1994}.

B21993

Consider the following game played with a deck of 2n2n cards numbered from 1 to 2n2n. The deck is randomly shuffled and nn cards are dealt to each of two players. Beginning with AA, the players take turns discarding one of their remaining cards and announcing its number. The game ends as soon as the sum of the numbers on the discarded cards is divisible by 2n+12n+1. The last person to discard wins the game. Assuming optimal strategy by both AA and BB, what is the probability that AA wins?

B31993

Two real numbers xx and yy are chosen at random in the interval (0,1) with respect to the uniform distribution. What is the probability that the closest integer to x/yx/y is even? Express the answer in the form r+sπr+s\pi, where rr and ss are rational numbers.

B41993

The function K(x,y)K(x,y) is positive and continuous for 0x1,0y10 \leq x \leq 1, 0 \leq y \leq 1, and the functions f(x)f(x) and g(x)g(x) are positive and continuous for 0x10 \leq x \leq 1. Suppose that for all xx, 0x10 \leq x \leq 1, 01f(y)K(x,y)dy=g(x)\int_0^1 f(y)K(x,y)\,dy = g(x) and 01g(y)K(x,y)dy=f(x).\int_0^1 g(y)K(x,y)\,dy = f(x). Show that f(x)=g(x)f(x) = g(x) for 0x10 \leq x \leq 1.

B51993

Show there do not exist four points in the Euclidean plane such that the pairwise distances between the points are all odd integers.

B61993

Let SS be a set of three, not necessarily distinct, positive integers. Show that one can transform SS into a set containing 0 by a finite number of applications of the following rule: Select two of the three integers, say xx and yy, where xyx \leq y and replace them with 2x2x and yxy-x.

A11992

Prove that f(n)=1nf(n) = 1-n is the only integer-valued function defined on the integers that satisfies the following conditions.

  • (i)
    f(f(n))=nf(f(n)) = n, for all integers nn;
  • (ii)
    f(f(n+2)+2)=nf(f(n+2)+2) = n for all integers nn;
  • (iii)
    f(0)=1f(0) = 1.
A21992

Define C(α)C(\alpha) to be the coefficient of x1992x^{1992} in the power series about x=0x=0 of (1+x)α(1 + x)^\alpha. Evaluate 01(C(y1)k=119921y+k)dy.\int_0^1 \left( C(-y-1) \sum_{k=1}^{1992} \frac{1}{y+k} \right)\,dy.

A31992

For a given positive integer mm, find all triples (n,x,y)(n, x, y) of positive integers, with nn relatively prime to mm, which satisfy (x2+y2)m=(xy)n.(x^2 + y^2)^m = (xy)^n.

A41992

Let ff be an infinitely differentiable real-valued function defined on the real numbers. If f(1n)=n2n2+1,n=1,2,3,,f\left( \frac{1}{n} \right) = \frac{n^2}{n^2 + 1}, \qquad n = 1, 2, 3, \dots, compute the values of the derivatives f(k)(0),k=1,2,3,f^{(k)}(0), k = 1, 2, 3, \dots.

A51992

For each positive integer nn, let an=0a_n = 0 (or 1) if the number of 1's in the binary representation of nn is even (or odd), respectively. Show that there do not exist positive integers kk and mm such that ak+j=ak+m+j=ak+2m+j,a_{k+j} = a_{k+m+j} = a_{k+2m+j}, for 0jm10 \leq j \leq m-1.

A61992

Four points are chosen at random on the surface of a sphere. What is the probability that the center of the sphere lies inside the tetrahedron whose vertices are at the four points? (It is understood that each point is independently chosen relative to a uniform distribution on the sphere.)

B11992

Let SS be a set of nn distinct real numbers. Let ASA_S be the set of numbers that occur as averages of two distinct elements of SS. For a given n2n \geq 2, what is the smallest possible number of elements in ASA_S?

B21992

For nonnegative integers nn and kk, define Q(n,k)Q(n, k) to be the coefficient of xkx^k in the expansion of (1+x+x2+x3)n(1 + x + x^2 + x^3)^n. Prove that Q(n,k)=j=0k(nj)(nk2j),Q(n, k) = \sum_{j=0}^k \binom{n}{j} \binom{n}{k-2j}, where (ab)\binom{a}{b} is the standard binomial coefficient. (Reminder: For integers aa and bb with a0a \geq 0, (ab)=a!b!(ab)!\binom{a}{b} = \frac{a!}{b!(a-b)!} for 0ba0 \leq b \leq a, with (ab)=0\binom{a}{b} = 0 otherwise.)

B31992

For any pair (x,y)(x, y) of real numbers, a sequence (an(x,y))n0(a_n(x,y))_{n\geq 0} is defined as follows:

a0(x,y)=x,an+1(x,y)=(an(x,y))2+y22,for n0.\begin{align*} a_0(x, y) &= x, \\ a_{n+1}(x, y) &= \frac{(a_n(x, y))^2 + y^2}{2}, \qquad \mbox{for $n \geq 0$}. \end{align*}

Find the area of the region {(x,y)(an(x,y))n0 converges}.\{ (x, y) | (a_n(x, y))_{n \geq 0}\ \mbox{converges}\}.

B41992

Let p(x)p(x) be a nonzero polynomial of degree less than 1992 having no nonconstant factor in common with x3xx^3 - x. Let d1992dx1992(p(x)x3x)=f(x)g(x)\frac{d^{1992}}{dx^{1992}} \left( \frac{p(x)}{x^3 - x} \right) = \frac{f(x)}{g(x)} for polynomials f(x)f(x) and g(x)g(x). Find the smallest possible degree of f(x)f(x).

B51992

Let DnD_n denote the value of the (n1)×(n1)(n-1) \times (n-1) determinant [311111411111511111611111n+1].\left[ \begin{array}{cccccc} 3 & 1 & 1 & 1 & \cdots & 1 \\ 1 & 4 & 1 & 1 & \cdots & 1 \\ 1 & 1 & 5 & 1 & \cdots & 1 \\ 1 & 1 & 1 & 6 & \cdots & 1 \\ \vdots & \vdots & \vdots & \vdots & \ddots & \vdots \\ 1 & 1 & 1 & 1 & \cdots & n+1 \end{array} \right]. Is the set {Dnn!}n2\left\{ \frac{D_n}{n!} \right\}_{n \geq 2} bounded?

B61992

Let M\MM be a set of real n×nn \times n matrices such that

  • (i)
    IMI \in \MM, where II is the n×nn \times n identity matrix;
  • (ii)
    if AMA \in \MM and BMB \in \MM, then either ABMAB \in \MM or ABM-AB \in \MM, but not both;
  • (iii)
    if AMA \in \MM and BMB \in \MM, then either AB=BAAB = BA or AB=BAAB = -BA;
  • (iv)
    if AMA \in \MM and AIA \neq I, there is at least one BMB \in \MM such that AB=BAAB = - BA.

Prove that M\MM contains at most n2n^2 matrices.

A11991

A 2×32 \times 3 rectangle has vertices as (0,0),(2,0),(0,3),(0, 0), (2,0), (0,3), and (2,3)(2, 3). It rotates 9090^\circ clockwise about the point (2,0)(2, 0). It then rotates 9090^\circ clockwise about the point (5,0)(5, 0), then 9090^\circ clockwise about the point (7,0)(7, 0), and finally, 9090^\circ clockwise about the point (10,0)(10, 0). (The side originally on the xx-axis is now back on the xx-axis.) Find the area of the region above the xx-axis and below the curve traced out by the point whose initial position is (1,1).

A21991

Let A\bA and B\bB be different n×nn \times n matrices with real entries. If A3=B3\bA^3 = \bB^3 and A2B=B2A\bA^2 \bB = \bB^2 \bA, can A2+B2\bA^2 + \bB^2 be invertible?

A31991

Find all real polynomials p(x)p(x) of degree n2n \geq 2 for which there exist real numbers r1<r2<<rnr_1 < r_2 < \cdots < r_n such that

  1. p(ri)=0,i=1,2,,n,p(r_i) = 0, \qquad i = 1, 2, \dots, n, and
  2. p(ri+ri+12)=0i=1,2,,n1,p' \left( \frac{r_i + r_{i+1}}{2} \right) = 0 \qquad i = 1, 2, \dots, n-1,

where p(x)p'(x) denotes the derivative of p(x)p(x).

A41991

Does there exist an infinite sequence of closed discs D1,D2,D3,D_1, D_2, D_3, \dots in the plane, with centers c1,c2,c3,c_1, c_2, c_3, \dots, respectively, such that

  1. the cic_i have no limit point in the finite plane,
  2. the sum of the areas of the DiD_i is finite, and
  3. every line in the plane intersects at least one of the DiD_i?
A51991

Find the maximum value of 0yx4+(yy2)2dx\int_0^y \sqrt{x^4 + (y-y^2)^2}\,dx for 0y10 \leq y \leq 1.

A61991

Let A(n)A(n) denote the number of sums of positive integers a1+a2++ara_1 + a_2 + \cdots + a_r which add up to nn with

a1>a2+a3,a2>a3+a4,,ar2>ar1+ar,ar1>ar.\begin{gather*} a_1 > a_2 + a_3, a_2 > a_3 + a_4, \ldots, \\ a_{r-2} > a_{r-1} + a_r, a_{r-1} > a_r. \end{gather*}

Let B(n)B(n) denote the number of b1+b2++bsb_1 + b_2 + \cdots + b_s which add up to nn, with

  1. b1b2bs,b_1 \geq b_2 \geq \dots \geq b_s,
  2. each bib_i is in the sequence 1,2,4,,gj,1, 2, 4, \dots, g_j, \dots defined by g1=1g_1 = 1, g2=2g_2 = 2, and gj=gj1+gj2+1,g_j = g_{j-1} + g_{j-2} + 1, and
  3. if b1=gkb_1 = g_k then every element in {1,2,4,,gk}\{1, 2, 4, \dots, g_k\} appears at least once as a bib_i.

Prove that A(n)=B(n)A(n) = B(n) for each n1n \geq 1.

(For example, A(7)=5A(7) = 5 because the relevant sums are 7,6+1,5+2,4+3,4+2+1,7, 6+1, 5+2, 4+3, 4+2+1, and B(7)=5B(7) = 5 because the relevant sums are 4+2+1,2+2+2+1,2+2+1+1+1,2+1+1+1+1+1,1+1+1+1+1+1+1.4+2+1, 2+2+2+1, 2+2+1+1+1, 2+1+1+1+1+1, 1+1+1+1+1+1+1.)

B11991

For each integer n0n \geq 0, let S(n)=nm2S(n) = n - m^2, where mm is the greatest integer with m2nm^2 \leq n. Define a sequence (ak)k=0(a_k)_{k=0}^\infty by a0=Aa_0 = A and ak+1=ak+S(ak)a_{k+1} = a_k + S(a_k) for k0k \geq 0. For what positive integers AA is this sequence eventually constant?

B21991

Suppose ff and gg are non-constant, differentiable, real-valued functions defined on (,)(-\infty, \infty). Furthermore, suppose that for each pair of real numbers xx and yy,

f(x+y)=f(x)f(y)g(x)g(y),g(x+y)=f(x)g(y)+g(x)f(y).\begin{align*} f(x+y) &= f(x)f(y) - g(x)g(y), \\ g(x+y) &= f(x)g(y) + g(x)f(y). \end{align*}

If f(0)=0f'(0) = 0, prove that (f(x))2+(g(x))2=1(f(x))^2 + (g(x))^2 = 1 for all xx.

B31991

Does there exist a real number LL such that, if mm and nn are integers greater than LL, then an m×nm \times n rectangle may be expressed as a union of 4×64 \times 6 and 5×75 \times 7 rectangles, any two of which intersect at most along their boundaries?

B41991

Suppose pp is an odd prime. Prove that j=0p(pj)(p+jj)2p+1(modp2).\sum_{j=0}^p \binom{p}{j} \binom{p+j}{j} \equiv 2^p + 1\pmod{p^2}.

B51991

Let pp be an odd prime and let Zp\Z_p denote (the field of) integers modulo pp. How many elements are in the set {x2:xZp}{y2+1:yZp}?\{x^2: x \in \Z_p\} \cap \{y^2 + 1 : y \in \Z_p\}?

B61991

Let aa and bb be positive numbers. Find the largest number cc, in terms of aa and bb, such that axb1xasinhuxsinhu+bsinhu(1x)sinhua^x b^{1-x} \leq a \frac{\sinh ux}{\sinh u} + b \frac{\sinh u(1-x)}{\sinh u} for all uu with 0<uc0 < |u| \leq c and for all xx, 0<x<10 < x < 1. (Note: sinhu=(eueu)/2\sinh u = (e^u - e^{-u})/2.)

A11990

Let T0=2,T1=3,T2=6,T_0 = 2, T_1 = 3, T_2 = 6, and for n3n \geq 3, Tn=(n+4)Tn14nTn2+(4n8)Tn3.T_n = (n+4)T_{n-1} - 4n T_{n-2} + (4n-8) T_{n-3}. The first few terms are 2,3,6,14,40,152,784,5168,40576.2, 3, 6, 14, 40, 152, 784, 5168, 40576. Find, with proof, a formula for TnT_n of the form Tn=An+BnT_n = A_n + B_n, where {An}\{A_n\} and {Bn}\{B_n\} are well-known sequences.

A21990

Is 2\sqrt{2} the limit of a sequence of numbers of the form n3m3\sqrt[3]{n} - \sqrt[3]{m} (n,m=0,1,2,n,m = 0, 1, 2, \dots)?

A31990

Prove that any convex pentagon whose vertices (no three of which are collinear) have integer coordinates must have area greater than or equal to 5/2.

A41990

Consider a paper punch that can be centered at any point of the plane and that, when operated, removes from the plane precisely those points whose distance from the center is irrational. How many punches are needed to remove every point?

A51990

If A\mathbf{A} and B\mathbf{B} are square matrices of the same size such that ABAB=0\mathbf{ABAB = 0}, does it follow that BABA=0\mathbf{BABA = 0}?

A61990

If XX is a finite set, let XX denote the number of elements in XX. Call an ordered pair (S,T)(S, T) of subsets of {1,2,,n}\{1, 2, \dots, n\} {admissible} if s>Ts > |T| for each sSs \in S, and t>St > |S| for each tTt \in T. How many admissible ordered pairs of subsets of {1,2,,10}\{1, 2, \dots, 10\} are there? Prove your answer.

B11990

Find all real-valued continuously differentiable functions ff on the real line such that for all xx, (f(x))2=0x[(f(t))2+(f(t))2]dt+1990.(f(x))^2 = \int_0^x [(f(t))^2 + (f'(t))^2]\,dt + 1990.

B21990

Prove that for x<1|x| < 1, z>1|z| > 1, 1+j=1(1+xj)Pj=0,1 + \sum_{j=1}^\infty (1 + x^j)P_j = 0, where PjP_j is (1z)(1zx)(1zx2)(1zxj1)(zx)(zx2)(zx3)(zxj).\frac{(1 - z)(1 - zx)(1 - zx^2) \cdots (1 - zx^{j-1})} {(z - x)(z - x^2)(z - x^3) \cdots (z - x^j)}.

B31990

Let SS be a set of 2×22 \times 2 integer matrices whose entries aija_{ij} (1) are all squares of integers and, (2) satisfy aij200a_{ij} \leq 200. Show that if SS has more than 50387 (=15415215+2= 15^4 - 15^2 - 15 + 2) elements, then it has two elements that commute.

B41990

Let GG be a finite group of order nn generated by aa and bb. Prove or disprove: there is a sequence g1,g2,g3,,g2ng_1, g_2, g_3, \dots, g_{2n} such that

  • (1)
    every element of GG occurs exactly twice, and
  • (2)
    gi+1g_{i+1} equals giag_i a or gibg_i b for i=1,2,,2ni = 1, 2, \dots, 2n. (Interpret g2n+1g_{2n+1} as g1g_1.)
B51990

Is there an infinite sequence a0,a1,a2,a_0, a_1, a_2, \dots of nonzero real numbers such that for n=1,2,3,n = 1, 2, 3, \dots the polynomial pn(x)=a0+a1x+a2x2++anxnp_n(x) = a_0 + a_1x + a_2x^2 + \cdots + a_nx^n has exactly nn distinct real roots?

B61990

Let SS be a nonempty closed bounded convex set in the plane. Let KK be a line and tt a positive number. Let L1L_1 and L2L_2 be support lines for SS parallel to K1K_1, and let L\overline{L} be the line parallel to KK and midway between L1L_1 and L2L_2. Let BS(K,t)B_S(K, t) be the band of points whose distance from L\overline{L} is at most (t/2)w(t/2)w, where ww is the distance between L1L_1 and L2L_2. What is the smallest tt such that SKBS(K,t)S \cap \bigcap_K B_S(K, t) \neq \emptyset for all SS? (KK runs over all lines in the plane.)

A11989

How many primes among the positive integers, written as usual in base 10, are alternating 1's and 0's, beginning and ending with 1?

A21989

Evaluate 0a0bemax{b2x2,a2y2}dydx\displaystyle{\int_0^a\int_0^b e^{{\rm max}\{b^2x^2, a^2y^2\}}\,dy\,dx} where aa and bb are positive.

A31989

Prove that if 11z10+10iz9+10iz11=0,11z^{10}+10iz^9+10iz-11=0, then z=1.|z|=1. (Here zz is a complex number and i2=1i^2=-1.)

A41989

If α\alpha is an irrational number, 0<α<10 < \alpha < 1, is there a finite game with an honest coin such that the probability of one player winning the game is α\alpha? (An honest coin is one for which the probability of heads and the probability of tails are both 12\frac12. A game is finite if with probability 1 it must end in a finite number of moves.)

A51989

Let mm be a positive integer and let G\mathcal{G} be a regular (2m+1)(2m+1)-gon inscribed in the unit circle. Show that there is a positive constant AA, independent of mm, with the following property. For any points pp inside G\cal G there are two distinct vertices v1v_1 and v2v_2 of G\cal G such that pv1pv2<1mAm3.\left|\,|p-v_1| - |p-v_2|\,\right| < \frac1{m} - \frac{A}{m^3}. Here st|s-t| denotes the distance between the points ss and tt.

A61989

Let α=1+a1x+a2x2+\alpha=1+a_1x+a_2x^2+\cdots be a formal power series with coefficients in the field of two elements. Let an={1if every block of zeros in the binary expansion of n has an even number of zeros in the block0otherwise.a_n = \begin{cases} 1 & \text{if every block of zeros in the binary expansion of $n$ has an even number of zeros in the block} \\[.3in] 0 & \text{otherwise.} \end{cases} (For example, a36=1a_{36}=1 because 36=100100236=100100_2 and a20=0a_{20}=0 because 20=101002.20=10100_2.) Prove that α3+xα+1=0.\alpha^3+x\alpha+1=0.

B11989

A dart, thrown at random, hits a square target. Assuming that any two parts of the target of equal area are equally likely to be hit, find the probability that the point hit is nearer to the center than to any edge. Express your answer in the form ab+cd\displaystyle{\frac{a\sqrt{b} + c}{d}}, where a,b,c,da,\,b,\,c,\,d are integers.

B21989

Let SS be a non-empty set with an associative operation that is left and right cancellative (xy=xzxy=xz implies y=zy=z, and yx=zxyx=zx implies y=zy=z). Assume that for every aa in SS the set {an:n=1,2,3,}\{a^n:\,n=1, 2, 3, \ldots\} is finite. Must SS be a group?

B31989

Let ff be a function on [0,)[0,\infty), differentiable and satisfying f(x)=3f(x)+6f(2x)f'(x)=-3f(x)+6f(2x) for x>0x>0. Assume that f(x)ex|f(x)|\le e^{-\sqrt{x}} for x0x\ge 0 (so that f(x)f(x) tends rapidly to 00 as xx increases). For nn a non-negative integer, define μn=0xnf(x)dx\mu_n=\int_0^\infty x^n f(x)\,dx (sometimes called the nnth moment of ff).

  1. a)
    Express μn\mu_n in terms of μ0\mu_0.
  2. b)
    Prove that the sequence {μn3nn!}\{\mu_n \frac{3^n}{n!}\} always converges, and that the limit is 00 only if μ0=0\mu_0=0.
B41989

Can a countably infinite set have an uncountable collection of non-empty subsets such that the intersection of any two of them is finite?

B51989

Label the vertices of a trapezoid TT (quadrilateral with two parallel sides) inscribed in the unit circle as A,B,C,DA,\,B,\,C,\,D so that ABAB is parallel to CDCD and A,B,C,DA,\,B,\,C,\,D are in counterclockwise order. Let s1,s2s_1,\,s_2, and dd denote the lengths of the line segments AB,CDAB,\, CD, and OEOE, where E is the point of intersection of the diagonals of TT, and OO is the center of the circle. Determine the least upper bound of s1s2d\frac{s_1-s_2}{d} over all such TT for which d0d\ne 0, and describe all cases, if any, in which it is attained.

B61989

Let (x1,x2,xn)(x_1,\,x_2,\,\ldots\,x_n) be a point chosen at random from the nn-dimensional region defined by 0<x1<x2<<xn<1.0<x_1<x_2<\cdots < x_n<1. Let ff be a continuous function on [0,1][0,1] with f(1)=0f(1)=0. Set x0=0x_0=0 and xn+1=1x_{n+1}=1. Show that the expected value of the Riemann sum i=0n(xi+1xi)f(xi+1)\sum_{i=0}^n (x_{i+1}-x_i) f(x_{i+1}) is 01f(t)P(t)dt\int_0^1 f(t)P(t)\, dt, where PP is a polynomial of degree nn, independent of ff, with 0P(t)10\le P(t)\le 1 for 0t10\le t \le 1.

A11988

Let RR be the region consisting of the points (x,y)(x,y) of the cartesian plane satisfying both xy1|x|-|y| \leq 1 and y1|y| \leq 1. Sketch the region RR and find its area.

A21988

A not uncommon calculus mistake is to believe that the product rule for derivatives says that (fg)=fg(fg)' = f'g'. If f(x)=ex2f(x)=e^{x^2}, determine, with proof, whether there exists an open interval (a,b)(a,b) and a nonzero function gg defined on (a,b)(a,b) such that this wrong product rule is true for xx in (a,b)(a,b).

A31988

Determine, with proof, the set of real numbers xx for which n=1(1ncsc1n1)x\sum_{n=1}^\infty \left( \frac{1}{n} \csc \frac{1}{n} - 1 \right)^x converges.

A41988
  1. (a)
    If every point of the plane is painted one of three colors, do there necessarily exist two points of the same color exactly one inch apart?
  2. (b)
    What if “three” is replaced by “nine”?
A51988

Prove that there exists a unique function ff from the set R+\mathrm{R}^+ of positive real numbers to R+\mathrm{R}^+ such that f(f(x))=6xf(x)f(f(x)) = 6x-f(x) and f(x)>0f(x)>0 for all x>0x>0.

A61988

If a linear transformation AA on an nn-dimensional vector space has n+1n+1 eigenvectors such that any nn of them are linearly independent, does it follow that AA is a scalar multiple of the identity? Prove your answer.

B11988

A composite (positive integer) is a product abab with aa and bb not necessarily distinct integers in {2,3,4,}\{2,3,4,\dots\}. Show that every composite is expressible as xy+xz+yz+1xy+xz+yz+1, with x,y,zx,y,z positive integers.

B21988

Prove or disprove: If xx and yy are real numbers with y0y\geq0 and y(y+1)(x+1)2y(y+1) \leq (x+1)^2, then y(y1)x2y(y-1)\leq x^2.

B31988

For every nn in the set N={1,2,}\mathrm{N} = \{1,2,\dots \} of positive integers, let rnr_n be the minimum value of cd3|c-d\sqrt{3}| for all nonnegative integers cc and dd with c+d=nc+d=n. Find, with proof, the smallest positive real number gg with rngr_n \leq g for all nNn \in \mathrm{N}.

B41988

Prove that if n=1an\sum_{n=1}^\infty a_n is a convergent series of positive real numbers, then so is n=1(an)n/(n+1)\sum_{n=1}^\infty (a_n)^{n/(n+1)}.

B51988

For positive integers nn, let MnM_n be the 2n+12n+1 by 2n+12n+1 skew-symmetric matrix for which each entry in the first nn subdiagonals below the main diagonal is 1 and each of the remaining entries below the main diagonal is -1. Find, with proof, the rank of MnM_n. (According to one definition, the rank of a matrix is the largest kk such that there is a k×kk \times k submatrix with nonzero determinant.)

One may note that

M1=(011101110)M2=(0111110111110111110111110).\begin{align*} M_1 &= \left( \begin{array}{ccc} 0 & -1 & 1 \\ 1 & 0 & -1 \\ -1 & 1 & 0 \end{array}\right) \\ M_2 &= \left( \begin{array}{ccccc} 0 & -1 & -1 & 1 & 1 \\ 1 & 0 & -1 & -1 & 1 \\ 1 & 1 & 0 & -1 & -1 \\ -1 & 1 & 1 & 0 & -1 \\ -1 & -1 & 1 & 1 & 0 \end{array} \right). \end{align*}
B61988

Prove that there exist an infinite number of ordered pairs (a,b)(a,b) of integers such that for every positive integer tt, the number at+bat+b is a triangular number if and only if tt is a triangular number. (The triangular numbers are the tn=n(n+1)/2t_n = n(n+1)/2 with nn in {0,1,2,}\{0,1,2,\dots\}.)

A11987

Curves A,B,CA,B,C and DD are defined in the plane as follows:

A={(x,y):x2y2=xx2+y2},B={(x,y):2xy+yx2+y2=3},C={(x,y):x33xy2+3y=1},D={(x,y):3x2y3xy3=0}.\begin{align*} A &= \left\{ (x,y): x^2-y^2 = \frac{x}{x^2+y^2} \right\}, \\ B &= \left\{ (x,y): 2xy + \frac{y}{x^2+y^2} = 3 \right\}, \\ C &= \left\{ (x,y): x^3-3xy^2+3y=1 \right\}, \\ D &= \left\{ (x,y): 3x^2 y - 3x - y^3 = 0\right\}. \end{align*}

Prove that AB=CDA \cap B = C \cap D.

A21987

The sequence of digits 1234567891011121314151617181920211 2 3 4 5 6 7 8 9 1 0 1 1 1 2 1 3 1 4 1 5 1 6 1 7 1 8 1 9 2 0 2 1 \dots is obtained by writing the positive integers in order. If the 10n10^n-th digit in this sequence occurs in the part of the sequence in which the mm-digit numbers are placed, define f(n)f(n) to be mm. For example, f(2)=2f(2)=2 because the 100th digit enters the sequence in the placement of the two-digit integer 55. Find, with proof, f(1987)f(1987).

A31987

For all real xx, the real-valued function y=f(x)y=f(x) satisfies y2y+y=2ex.y''-2y'+y=2e^x.

  1. (a)
    If f(x)>0f(x)>0 for all real xx, must f(x)>0f'(x) > 0 for all real xx? Explain.
  2. (b)
    If f(x)>0f'(x)>0 for all real xx, must f(x)>0f(x) > 0 for all real xx? Explain.
A41987

Let PP be a polynomial, with real coefficients, in three variables and FF be a function of two variables such that P(ux,uy,uz)=u2F(yx,zx)for all real x,y,z,u,P(ux, uy, uz) = u^2 F(y-x,z-x) \quad \mbox{for all real $x,y,z,u$}, and such that P(1,0,0)=4P(1,0,0)=4, P(0,1,0)=5P(0,1,0)=5, and P(0,0,1)=6P(0,0,1)=6. Also let A,B,CA,B,C be complex numbers with P(A,B,C)=0P(A,B,C)=0 and BA=10|B-A|=10. Find CA|C-A|.

A51987

Let G(x,y)=(yx2+4y2,xx2+4y2,0).\vec{G}(x,y) = \left( \frac{-y}{x^2+4y^2}, \frac{x}{x^2+4y^2},0 \right). Prove or disprove that there is a vector-valued function F(x,y,z)=(M(x,y,z),N(x,y,z),P(x,y,z))\vec{F}(x,y,z) = (M(x,y,z), N(x,y,z), P(x,y,z)) with the following properties:

  1. (i)
    M,N,PM,N,P have continuous partial derivatives for all (x,y,z)(0,0,0)(x,y,z) \neq (0,0,0);
  2. (ii)
    CurlF=0\mathrm{Curl}\,\vec{F} = \vec{0} for all (x,y,z)(0,0,0)(x,y,z) \neq (0,0,0);
  3. (iii)
    F(x,y,0)=G(x,y)\vec{F}(x,y,0) = \vec{G}(x,y).
A61987

For each positive integer nn, let a(n)a(n) be the number of zeroes in the base 3 representation of nn. For which positive real numbers xx does the series n=1xa(n)n3\sum_{n=1}^\infty \frac{x^{a(n)}}{n^3} converge?

B11987

Evaluate 24ln(9x)dxln(9x)+ln(x+3).\int_2^4 \frac{\sqrt{\ln(9-x)}\,dx}{\sqrt{\ln(9-x)}+\sqrt{\ln(x+3)}}.

B21987

Let r,sr,s and tt be integers with 0r0 \leq r, 0s0 \leq s and r+str+s \leq t. Prove that (s0)(tr)+(s1)(tr+1)++(ss)(tr+s)=t+1(t+1s)(tsr).\frac{\binom s0}{\binom tr} + \frac{\binom s1}{\binom{t}{r+1}} + \cdots + \frac{\binom ss}{\binom{t}{r+s}} = \frac{t+1}{(t+1-s)\binom{t-s}{r}}.

B31987

Let FF be a field in which 1+101+1 \neq 0. Show that the set of solutions to the equation x2+y2=1x^2+y^2=1 with xx and yy in FF is given by (x,y)=(1,0)(x,y)=(1,0) and (x,y)=(r21r2+1,2rr2+1)(x,y) = \left( \frac{r^2-1}{r^2+1}, \frac{2r}{r^2+1} \right) where rr runs through the elements of FF such that r21r^2\neq -1.

B41987

Let (x1,y1)=(0.8,0.6)(x_1,y_1) = (0.8, 0.6) and let xn+1=xncosynynsinynx_{n+1} = x_n \cos y_n - y_n \sin y_n and yn+1=xnsinyn+yncosyny_{n+1}= x_n \sin y_n + y_n \cos y_n for n=1,2,3,n=1,2,3,\dots. For each of limnxn\lim_{n\to \infty} x_n and limnyn\lim_{n \to \infty} y_n, prove that the limit exists and find it or prove that the limit does not exist.

B51987

Let OnO_n be the nn-dimensional vector (0,0,,0)(0,0,\cdots, 0). Let MM be a 2n×n2n \times n matrix of complex numbers such that whenever (z1,z2,,z2n)M=On(z_1, z_2, \dots, z_{2n})M = O_n, with complex ziz_i, not all zero, then at least one of the ziz_i is not real. Prove that for arbitrary real numbers r1,r2,,r2nr_1, r_2, \dots, r_{2n}, there are complex numbers w1,w2,,wnw_1, w_2, \dots, w_n such that re[M(w1wn)]=(r1rn).\mathrm{re}\left[ M \left( \begin{array}{c} w_1 \\ \vdots \\ w_n \end{array} \right) \right] = \left( \begin{array}{c} r_1 \\ \vdots \\ r_n \end{array} \right). (Note: if CC is a matrix of complex numbers, re(C)\mathrm{re}(C) is the matrix whose entries are the real parts of the entries of CC.)

B61987

Let FF be the field of p2p^2 elements, where pp is an odd prime. Suppose SS is a set of (p21)/2(p^2-1)/2 distinct nonzero elements of FF with the property that for each a0a\neq 0 in FF, exactly one of aa and a-a is in SS. Let NN be the number of elements in the intersection S{2a:aS}S \cap \{2a: a \in S\}. Prove that NN is even.

A11986

Find, with explanation, the maximum value of f(x)=x33xf(x)=x^3-3x on the set of all real numbers xx satisfying x4+3613x2x^4+36\leq 13x^2.

A21986

What is the units (i.e., rightmost) digit of 102000010100+3?\left\lfloor \frac{10^{20000}}{10^{100}+3}\right\rfloor ? %Here x\lfloor x \rfloor is the greatest integer less than or equal to %xx.

A31986

Evaluate n=0Arccot(n2+n+1)\sum_{n=0}^\infty \mathrm{Arccot}(n^2+n+1), where Arccott\mathrm{Arccot}\,t for t0t \geq 0 denotes the number θ\theta in the interval 0<θπ/20 < \theta \leq \pi/2 with cotθ=t\cot \theta = t.

A41986

A transversal of an n×nn\times n matrix AA consists of nn entries of AA, no two in the same row or column. Let f(n)f(n) be the number of n×nn \times n matrices AA satisfying the following two conditions:

  1. (a)
    Each entry αi,j\alpha_{i,j} of AA is in the set {1,0,1}\{-1,0,1\}.
  2. (b)
    The sum of the nn entries of a transversal is the same for all transversals of AA.

An example of such a matrix AA is A=(101010010).A = \left( \begin{array}{ccc} -1 & 0 & -1 \\ 0 & 1 & 0 \\ 0 & 1 & 0 \end{array} \right). Determine with proof a formula for f(n)f(n) of the form f(n)=a1b1n+a2b2n+a3b3n+a4,f(n) = a_1 b_1^n + a_2 b_2^n + a_3 b_3^n + a_4, where the aia_i's and bib_i's are rational numbers.

A51986

Suppose f1(x),f2(x),,fn(x)f_1(x), f_2(x), \dots, f_n(x) are functions of nn real variables x=(x1,,xn)x = (x_1, \dots, x_n) with continuous second-order partial derivatives everywhere on Rn\mathbb{R}^n. Suppose further that there are constants cijc_{ij} such that fixjfjxi=cij\frac{\partial f_i}{\partial x_j} - \frac{\partial f_j}{\partial x_i} = c_{ij} for all ii and jj, 1in1\leq i \leq n, 1jn1 \leq j \leq n. Prove that there is a function g(x)g(x) on Rn\mathbb{R}^n such that fi+g/xif_i + \partial g/\partial x_i is linear for all ii, 1in1 \leq i \leq n. (A linear function is one of the form a0+a1x1+a2x2++anxn.)a_0 + a_1 x_1 + a_2 x_2 + \cdots + a_n x_n.)

A61986

Let a1,a2,,ana_1, a_2, \dots, a_n be real numbers, and let b1,b2,,bnb_1, b_2, \dots, b_n be distinct positive integers. Suppose that there is a polynomial f(x)f(x) satisfying the identity (1x)nf(x)=1+i=1naixbi.(1-x)^n f(x) = 1 + \sum_{i=1}^n a_i x^{b_i}. Find a simple expression (not involving any sums) for f(1)f(1) in terms of b1,b2,,bnb_1, b_2, \dots, b_n and nn (but independent of a1,a2,,ana_1, a_2, \dots, a_n).

B11986

Inscribe a rectangle of base bb and height hh in a circle of radius one, and inscribe an isosceles triangle in the region of the circle cut off by one base of the rectangle (with that side as the base of the triangle). For what value of hh do the rectangle and triangle have the same area?

B21986

Prove that there are only a finite number of possibilities for the ordered triple T=(xy,yz,zx)T=(x-y,y-z,z-x), where x,y,zx,y,z are complex numbers satisfying the simultaneous equations x(x1)+2yz=y(y1)+2zx=z(z1)+2xy,x(x-1)+2yz = y(y-1)+2zx = z(z-1)+2xy, and list all such triples TT.

B31986

Let Γ\Gamma consist of all polynomials in xx with integer coefficients. For ff and gg in Γ\Gamma and mm a positive integer, let fg(modm)f \equiv g \pmod{m} mean that every coefficient of fgf-g is an integral multiple of mm. Let nn and pp be positive integers with pp prime. Given that f,g,h,rf,g,h,r and ss are in Γ\Gamma with rf+sg1(modp)rf+sg\equiv 1 \pmod{p} and fgh(modp)fg \equiv h \pmod{p}, prove that there exist FF and GG in Γ\Gamma with Ff(modp)F \equiv f \pmod{p}, Gg(modp)G \equiv g \pmod{p}, and FGh(modpn)FG \equiv h \pmod{p^n}.

B41986

For a positive real number rr, let G(r)G(r) be the minimum value of rm2+2n2|r - \sqrt{m^2+2n^2}| for all integers mm and nn. Prove or disprove the assertion that limrG(r)\lim_{r\to \infty}G(r) exists and equals 0.

B51986

Let f(x,y,z)=x2+y2+z2+xyzf(x,y,z) = x^2+y^2+z^2+xyz. Let p(x,y,z),q(x,y,z)p(x,y,z), q(x,y,z), r(x,y,z)r(x,y,z) be polynomials with real coefficients satisfying f(p(x,y,z),q(x,y,z),r(x,y,z))=f(x,y,z).f(p(x,y,z), q(x,y,z), r(x,y,z)) = f(x,y,z). Prove or disprove the assertion that the sequence p,q,rp,q,r consists of some permutation of ±x,±y,±z\pm x, \pm y, \pm z, where the number of minus signs is 0 or 2.

B61986

Suppose A,B,C,DA,B,C,D are n×nn \times n matrices with entries in a field FF, satisfying the conditions that ABTAB^T and CDTCD^T are symmetric and ADTBCT=IAD^T - BC^T = I. Here II is the n×nn \times n identity matrix, and if MM is an n×nn \times n matrix, MTM^T is its transpose. Prove that ATDCTB=IA^T D - C^T B = I.

A11985

Determine, with proof, the number of ordered triples (A1,A2,A3)(A_1, A_2, A_3) of sets which have the property that

  1. (i)
    A1A2A3={1,2,3,4,5,6,7,8,9,10}A_1 \cup A_2 \cup A_3 = \{1,2,3,4,5,6,7,8,9,10\}, and
  2. (ii)
    A1A2A3=A_1 \cap A_2 \cap A_3 = \emptyset.

Express your answer in the form 2a3b5c7d2^a 3^b 5^c 7^d, where a,b,c,da,b,c,d are nonnegative integers.

A21985

Let TT be an acute triangle. Inscribe a rectangle RR in TT with one side along a side of TT. Then inscribe a rectangle SS in the triangle formed by the side of RR opposite the side on the boundary of TT, and the other two sides of TT, with one side along the side of RR. For any polygon XX, let A(X)A(X) denote the area of XX. Find the maximum value, or show that no maximum exists, of A(R)+A(S)A(T)\frac{A(R)+A(S)}{A(T)}, where TT ranges over all triangles and R,SR,S over all rectangles as above.

A31985

Let dd be a real number. For each integer m0m \geq 0, define a sequence {am(j)}\{a_m(j)\}, j=0,1,2,j=0,1,2,\dots by the condition

am(0)=d/2m,am(j+1)=(am(j))2+2am(j),j0.\begin{align*} a_m(0) &= d/2^m, \\ a_m(j+1) &= (a_m(j))^2 + 2a_m(j), \qquad j \geq 0. \end{align*}

Evaluate limnan(n)\lim_{n \to \infty} a_n(n).

A41985

Define a sequence {ai}\{a_i\} by a1=3a_1=3 and ai+1=3aia_{i+1}=3^{a_i} for i1i\geq 1. Which integers between 00 and 99 inclusive occur as the last two digits in the decimal expansion of infinitely many aia_i?

A51985

Let Im=02πcos(x)cos(2x)cos(mx)dxI_m = \int_0^{2\pi} \cos(x)\cos(2x)\cdots \cos(mx)\,dx. For which integers mm, 1m101 \leq m \leq 10 is Im0I_m \neq 0?

A61985

If p(x)=a0+a1x++amxmp(x)= a_0 + a_1 x + \cdots + a_m x^m is a polynomial with real coefficients aia_i, then set Γ(p(x))=a02+a12++am2.\Gamma(p(x)) = a_0^2 + a_1^2 + \cdots + a_m^2. Let F(x)=3x2+7x+2F(x) = 3x^2+7x+2. Find, with proof, a polynomial g(x)g(x) with real coefficients such that

  1. (i)
    g(0)=1g(0)=1, and
  2. (ii)
    Γ(f(x)n)=Γ(g(x)n)\Gamma(f(x)^n) = \Gamma(g(x)^n)

for every integer n1n \geq 1.

B11985

Let kk be the smallest positive integer for which there exist distinct integers m1,m2,m3,m4,m5m_1, m_2, m_3, m_4, m_5 such that the polynomial p(x)=(xm1)(xm2)(xm3)(xm4)(xm5)p(x) = (x-m_1)(x-m_2)(x-m_3)(x-m_4)(x-m_5) has exactly kk nonzero coefficients. Find, with proof, a set of integers m1,m2,m3,m4,m5m_1, m_2, m_3, m_4, m_5 for which this minimum kk is achieved.

B21985

Define polynomials fn(x)f_n(x) for n0n \geq 0 by f0(x)=1f_0(x)=1, fn(0)=0f_n(0)=0 for n1n \geq 1, and ddxfn+1(x)=(n+1)fn(x+1)\frac{d}{dx} f_{n+1}(x) = (n+1)f_n(x+1) for n0n \geq 0. Find, with proof, the explicit factorization of f100(1)f_{100}(1) into powers of distinct primes.

B31985

Let a1,1a1,2a1,3a2,1a2,2a2,3a3,1a3,2a3,3\begin{array}{cccc} a_{1,1} & a_{1,2} & a_{1,3} & \dots \\ a_{2,1} & a_{2,2} & a_{2,3} & \dots \\ a_{3,1} & a_{3,2} & a_{3,3} & \dots \\ \vdots & \vdots & \vdots & \ddots \end{array} be a doubly infinite array of positive integers, and suppose each positive integer appears exactly eight times in the array. Prove that am,n>mna_{m,n} > mn for some pair of positive integers (m,n)(m,n).

B41985

Let CC be the unit circle x2+y2=1x^2+y^2=1. A point pp is chosen randomly on the circumference CC and another point qq is chosen randomly from the interior of CC (these points are chosen independently and uniformly over their domains). Let RR be the rectangle with sides parallel to the xx and yy-axes with diagonal pqpq. What is the probability that no point of RR lies outside of CC?

B51985

Evaluate 0t1/2e1985(t+t1)dt\int_0^\infty t^{-1/2}e^{-1985(t+t^{-1})}\,dt. You may assume that ex2dx=π\int_{-\infty}^\infty e^{-x^2}\,dx = \sqrt{\pi}.

B61985

Let GG be a finite set of real n×nn\times n matrices {Mi}\{M_i\}, 1ir1 \leq i \leq r, which form a group under matrix multiplication. Suppose that i=1rtr(Mi)=0\sum_{i=1}^r \mathrm{tr}(M_i)=0, where tr(A)\mathrm{tr}(A) denotes the trace of the matrix AA. Prove that i=1rMi\sum_{i=1}^r M_i is the n×nn \times n zero matrix.