Putnam Archive — Combinatorics

Combinatorics132 problemsmean difficulty 6.140 years

132 problemsNewest first
A32025

Alice and Bob play a game with a string of nn digits, each of which is restricted to be 00, 11, or 22. Initially all the digits are 00. A legal move is to add or subtract 11 from one digit to create a new string that has not appeared before. A player with no legal move loses, and the other player wins. Alice goes first, and the players alternate moves. For each n1n \geq 1, determine which player has a strategy that guarantees winning.

A42025

Find the minimal value of kk such that there exist kk-by-kk real matrices A1,,A2025A_1, \dots, A_{2025} with the property that AiAj=AjAiA_i A_j = A_j A_i if and only if ij{0,1,2024}|i-j| \in \{0,1,2024\}.

A52025

Let nn be an integer with n2n \geq 2. For a sequence s=(s1,,sn1)s = (s_1,\dots,s_{n-1}) where each si=±1s_i = \pm 1, let f(s)f(s) be the number of permutations (a1,,an)(a_1,\dots,a_n) of {1,2,,n}\{1,2,\dots,n\} such that si(ai+1ai)>0s_i(a_{i+1}-a_i) > 0 for all ii. For each nn, determine the sequences ss for which f(s)f(s) is maximal.

B12025

Suppose that each point in the plane is colored either red or green, subject to the following condition: For every three noncollinear points A,B,CA,B,C of the same color, the center of the circle passing through A,BA,B and CC is also this color. Prove that all points of the plane are the same color.

B42025

For n2n \geq 2, let A=[ai,j]i,j=1nA = [a_{i,j}]_{i,j=1}^n be an nn-by-nn matrix of nonnegative integers such that

  1. (a)
    ai,j=0a_{i,j} = 0 when i+jni+j\leq n;
  2. (b)
    ai+1,j{ai,j,ai,j+1}a_{i+1,j} \in \{a_{i,j}, a_{i,j}+1\} when 1in11 \leq i \leq n-1 and 1jn1 \leq j \leq n; and
  3. (c)
    ai,j+1{ai,j,ai,j+1}a_{i,j+1} \in \{a_{i,j}, a_{i,j}+1\} when 1in1 \leq i \leq n and 1jn11 \leq j \leq n-1.

Let SS be the sum of the entries of AA, and let NN be the number of nonzero entries of AA. Prove that S(n+2)N3.S \leq \frac{(n+2)N}{3}.

B62025

Let N={1,2,3,}\mathbb{N} = \{1,2,3,\dots\}. Find the largest real constant rr such that there exists a function g ⁣:NNg\colon \mathbb{N} \to \mathbb{N} such that g(n+1)g(n)(g(g(n)))rg(n+1)-g(n) \geq (g(g(n)))^r for all nNn \in \mathbb{N}.

A32024

Let SS be the set of bijections T ⁣:{1,2,3}×{1,2,,2024}{1,2,,6072}T \colon \{1,2,3\} \times \{1,2,\dots,2024\} \to \{1,2,\dots,6072\} such that T(1,j)<T(2,j)<T(3,j)T(1,j) < T(2,j) < T(3,j) for all j{1,2,,2024}j \in \{1,2,\dots,2024\} and T(i,j)<T(i,j+1)T(i,j) < T(i,j+1) for all i{1,2,3}i \in \{1,2,3\} and j{1,2,,2023}j \in \{1,2,\dots,2023\}. Do there exist aa and cc in {1,2,3}\{1,2,3\} and bb and dd in {1,2,,2024}\{1,2,\dots,2024\} such that the fraction of elements TT in SS for which T(a,b)<T(c,d)T(a,b) < T(c,d) is at least 1/31/3 and at most 2/32/3?

B12024

Let nn and kk be positive integers. The square in the iith row and jjth column of an nn-by-nn grid contains the number i+jki+j-k. For which nn and kk is it possible to select nn squares from the grid, no two in the same row or column, such that the numbers contained in the selected squares are exactly 1,2,,n1,2,\dots,n?

B22024

Two convex quadrilaterals are called partners if they have three vertices in common and they can be labeled ABCDABCD and ABCEABCE so that EE is the reflection of DD across the perpendicular bisector of the diagonal AC\overline{AC}. Is there an infinite sequence of convex quadrilaterals such that each quadrilateral is a partner of its successor and no two elements of the sequence are congruent? [A diagram has been omitted.]

B52024

Let kk and mm be positive integers. For a positive integer nn, let f(n)f(n) be the number of integer sequences x1,,xk,y1,,ym,zx_1,\dots,x_k,y_1,\dots,y_m,z satisfying 1x1xkzn1 \leq x_1 \leq \cdots \leq x_k \leq z \leq n and 1y1ymzn1 \leq y_1 \leq \cdots \leq y_m \leq z \leq n. Show that f(n)f(n) can be expressed as a polynomial in nn with nonnegative coefficients.

A62023

Alice and Bob play a game in which they take turns choosing integers from 11 to nn. Before any integers are chosen, Bob selects a goal of “odd” or “even”. On the first turn, Alice chooses one of the nn integers. On the second turn, Bob chooses one of the remaining integers. They continue alternately choosing one of the integers that has not yet been chosen, until the nnth turn, which is forced and ends the game. Bob wins if the parity of {k ⁣:the number k was chosen on the kth turn}\{k\colon \mbox{the number $k$ was chosen on the $k$th turn}\} matches his goal. For which values of nn does Bob have a winning strategy?

B12023

Consider an mm-by-nn grid of unit squares, indexed by (i,j)(i,j) with 1im1 \leq i \leq m and 1jn1 \leq j \leq n. There are (m1)(n1)(m-1)(n-1) coins, which are initially placed in the squares (i,j)(i,j) with 1im11 \leq i \leq m-1 and 1jn11 \leq j \leq n-1. If a coin occupies the square (i,j)(i,j) with im1i \leq m-1 and jn1j \leq n-1 and the squares (i+1,j),(i,j+1)(i+1,j), (i,j+1), and (i+1,j+1)(i+1,j+1) are unoccupied, then a legal move is to slide the coin from (i,j)(i,j) to (i+1,j+1)(i+1,j+1). How many distinct configurations of coins can be reached starting from the initial configuration by a (possibly empty) sequence of legal moves?

B32023

A sequence y1,y2,,yky_1,y_2,\dots,y_k of real numbers is called zigzag if k=1k=1, or if y2y1,y3y2,,ykyk1y_2-y_1, y_3-y_2, \dots, y_k-y_{k-1} are nonzero and alternate in sign. Let X1,X2,,XnX_1,X_2,\dots,X_n be chosen independently from the uniform distribution on [0,1][0,1]. Let a(X1,X2,,Xn)a(X_1,X_2,\dots,X_n) be the largest value of kk for which there exists an increasing sequence of integers i1,i2,,iki_1,i_2,\dots,i_k such that Xi1,Xi2,,XikX_{i_1},X_{i_2},\dots,X_{i_k} is zigzag. Find the expected value of a(X1,X2,,Xn)a(X_1,X_2,\dots,X_n) for n2n \geq 2.

A22022

Let nn be an integer with n2n \geq 2. Over all real polynomials p(x)p(x) of degree nn, what is the largest possible number of negative coefficients of p(x)2p(x)^2?

A52022

Alice and Bob play a game on a board consisting of one row of 2022 consecutive squares. They take turns placing tiles that cover two adjacent squares, with Alice going first. By rule, a tile must not cover a square that is already covered by another tile. The game ends when no tile can be placed according to this rule. Alice's goal is to maximize the number of uncovered squares when the game ends; Bob's goal is to minimize it. What is the greatest number of uncovered squares that Alice can ensure at the end of the game, no matter how Bob plays?

A62022

Let nn be a positive integer. Determine, in terms of nn, the largest integer mm with the following property: There exist real numbers x1,,x2nx_1,\dots,x_{2n} with 1<x1<x2<<x2n<1-1 < x_1 < x_2 < \cdots < x_{2n} < 1 such that the sum of the lengths of the nn intervals [x12k1,x22k1],[x32k1,x42k1],,[x2n12k1,x2n2k1][x_1^{2k-1}, x_2^{2k-1}], [x_3^{2k-1},x_4^{2k-1}], \dots, [x_{2n-1}^{2k-1}, x_{2n}^{2k-1}] is equal to 1 for all integers kk with 1km1 \leq k \leq m.

B22022

Let ×\times represent the cross product in R3\mathbb{R}^3. For what positive integers nn does there exist a set SR3S \subset \mathbb{R}^3 with exactly nn elements such that S={v×w:v,wS}?S = \{v \times w: v, w \in S\}?

B32022

Assign to each positive real number a color, either red or blue. Let DD be the set of all distances d>0d > 0 such that there are two points of the same color at distance dd apart. Recolor the positive reals so that the numbers in DD are red and the numbers not in DD are blue. If we iterate this recoloring process, will we always end up with all the numbers red after a finite number of steps?

B42022

Find all integers nn with n4n \geq 4 for which there exists a sequence of distinct real numbers x1,,xnx_1,\dots,x_n such that each of the sets

{x1,x2,x3},{x2,x3,x4},,{xn2,xn1,xn},{xn1,xn,x1}, and {xn,x1,x2}\begin{gather*} \{x_1,x_2,x_3\}, \{x_2,x_3,x_4\}, \dots, \\ \{x_{n-2},x_{n-1},x_n\}, \{x_{n-1},x_n, x_1\}, \mbox{ and } \{x_n, x_1, x_2\} \end{gather*}

forms a 3-term arithmetic progression when arranged in increasing order.

A12020

How many positive integers NN satisfy all of the following three conditions?

  1. (i)
    NN is divisible by 2020.
  2. (ii)
    NN has at most 2020 decimal digits.
  3. (iii)
    The decimal digits of NN are a string of consecutive ones followed by a string of consecutive zeros.
A22020

Let kk be a nonnegative integer. Evaluate j=0k2kj(k+jj).\sum_{j=0}^k 2^{k-j} \binom{k+j}{j}.

A52020

Let ana_n be the number of sets SS of positive integers for which kSFk=n,\sum_{k \in S} F_k = n, where the Fibonacci sequence (Fk)k1(F_k)_{k \geq 1} satisfies Fk+2=Fk+1+FkF_{k+2} = F_{k+1} + F_k and begins F1=1,F2=1,F3=2,F4=3F_1 = 1, F_2 = 1, F_3 = 2, F_4 = 3. Find the largest integer nn such that an=2020a_n = 2020.

B22020

Let kk and nn be integers with 1k<n1 \leq k < n. Alice and Bob play a game with kk pegs in a line of nn holes. At the beginning of the game, the pegs occupy the kk leftmost holes. A legal move consists of moving a single peg to any vacant hole that is further to the right. The players alternate moves, with Alice playing first. The game ends when the pegs are in the kk rightmost holes, so whoever is next to play cannot move and therefore loses. For what values of nn and kk does Alice have a winning strategy?

B42020

Let nn be a positive integer, and let VnV_n be the set of integer (2n+1)(2n+1)-tuples v=(s0,s1,,s2n1,s2n)\mathbf{v} = (s_0, s_1, \cdots, s_{2n-1}, s_{2n}) for which s0=s2n=0s_0 = s_{2n} = 0 and sjsj1=1|s_j - s_{j-1}| = 1 for j=1,2,,2nj=1,2,\cdots,2n. Define q(v)=1+j=12n13sj,q(\mathbf{v}) = 1 + \sum_{j=1}^{2n-1} 3^{s_j}, and let M(n)M(n) be the average of 1q(v)\frac{1}{q(\mathbf{v})} over all vVn\mathbf{v} \in V_n. Evaluate M(2020)M(2020).

B12019

Denote by Z2\mathbb{Z}^2 the set of all points (x,y)(x,y) in the plane with integer coordinates. For each integer n0n \geq 0, let PnP_n be the subset of Z2\mathbb{Z}^2 consisting of the point (0,0)(0,0) together with all points (x,y)(x,y) such that x2+y2=2kx^2 + y^2 = 2^k for some integer knk \leq n. Determine, as a function of nn, the number of four-point subsets of PnP_n whose elements are the vertices of a square.

B52019

Let FmF_m be the mmth Fibonacci number, defined by F1=F2=1F_1 = F_2 = 1 and Fm=Fm1+Fm2F_m = F_{m-1} + F_{m-2} for all m3m \geq 3. Let p(x)p(x) be the polynomial of degree 10081008 such that p(2n+1)=F2n+1p(2n+1) = F_{2n+1} for n=0,1,2,,1008n=0,1,2,\dots,1008. Find integers jj and kk such that p(2019)=FjFkp(2019) = F_j - F_k.

B62019

Let Zn\mathbb{Z}^n be the integer lattice in Rn\mathbb{R}^n. Two points in Zn\mathbb{Z}^n are called neighbors if they differ by exactly 11 in one coordinate and are equal in all other coordinates. For which integers n1n \geq 1 does there exist a set of points SZnS \subset \mathbb{Z}^n satisfying the following two conditions?

  1. (1)
    If pp is in SS, then none of the neighbors of pp is in SS.
  2. (2)
    If pZnp \in \mathbb{Z}^n is not in SS, then exactly one of the neighbors of pp is in SS.
A22018

Let S1,S2,,S2n1S_1, S_2, \dots, S_{2^n-1} be the nonempty subsets of {1,2,,n}\{1,2,\dots,n\} in some order, and let MM be the (2n1)×(2n1)(2^n-1) \times (2^n-1) matrix whose (i,j)(i,j) entry is mij={0if SiSj=;1otherwise.m_{ij} = \begin{cases} 0 & \mbox{if }S_i \cap S_j = \emptyset; \\ 1 & \mbox{otherwise.} \end{cases} Calculate the determinant of MM.

B12018

Let P\mathcal{P} be the set of vectors defined by P={(ab)0a2,0b100, and a,bZ}.\mathcal{P} = \left\{ \left. \begin{pmatrix} a \\ b \end{pmatrix} \right| 0 \leq a \leq 2, 0 \leq b \leq 100, \mbox{ and } a,b \in \mathbb{Z} \right\}. Find all vP\mathbf{v} \in \mathcal{P} such that the set P{v}\mathcal{P} \setminus \{ \mathbf{v} \} obtained by omitting vector v\mathbf{v} from P\mathcal{P} can be partitioned into two sets of equal size and equal sum.

B62018

Let SS be the set of sequences of length 20182018 whose terms are in the set {1,2,3,4,5,6,10}\{1,2,3,4,5,6,10\} and sum to 38603860. Prove that the cardinality of SS is at most 23860(20182048)2018.2^{3860} \cdot \left( \frac{2018}{2048} \right)^{2018}.

A42017

A class with 2N2N students took a quiz, on which the possible scores were 0,1,,100,1,\dots,10. Each of these scores occurred at least once, and the average score was exactly 7.47.4. Show that the class can be divided into two groups of NN students in such a way that the average score for each group was exactly 7.47.4.

A52017

Each of the integers from 11 to nn is written on a separate card, and then the cards are combined into a deck and shuffled. Three players, AA, BB, and CC, take turns in the order A,B,C,A,A,B,C,A,\dots choosing one card at random from the deck. (Each card in the deck is equally likely to be chosen.) After a card is chosen, that card and all higher-numbered cards are removed from the deck, and the remaining cards are reshuffled before the next turn. Play continues until one of the three players wins the game by drawing the card numbered 11.

Show that for each of the three players, there are arbitrarily large values of nn for which that player has the highest probability among the three players of winning the game.

A62017

The 30 edges of a regular icosahedron are distinguished by labeling them 1,2,,301,2,\dots,30. How many different ways are there to paint each edge red, white, or blue such that each of the 20 triangular faces of the icosahedron has two edges of the same color and a third edge of a different color? [Note: the top matter on each exam paper included the logo of the Mathematical Association of America, which is itself an icosahedron.]

B62017

Find the number of ordered 6464-tuples (x0,x1,,x63)(x_0,x_1,\dots,x_{63}) such that x0,x1,,x63x_0,x_1,\dots,x_{63} are distinct elements of {1,2,,2017}\{1,2,\dots,2017\} and x0+x1+2x2+3x3++63x63x_0 + x_1 + 2x_2 + 3x_3 + \cdots + 63 x_{63} is divisible by 2017.

A22016

Given a positive integer nn, let M(n)M(n) be the largest integer mm such that (mn1)>(m1n).\binom{m}{n-1} > \binom{m-1}{n}. Evaluate limnM(n)n.\lim_{n \to \infty} \frac{M(n)}{n}.

A42016

Consider a (2m1)×(2n1)(2m-1) \times (2n-1) rectangular region, where mm and nn are integers such that m,n4m, n \geq 4. This region is to be tiled using tiles of the two types shown:

[ Figure omitted — see the original source for the diagram. ]

(The dotted lines divide the tiles into 1×11 \times 1 squares.) The tiles may be rotated and reflected, as long as their sides are parallel to the sides of the rectangular region. They must all fit within the region, and they must cover it completely without overlapping.

What is the minimum number of tiles required to tile the region?

B32016

Suppose that SS is a finite set of points in the plane such that the area of triangle ABC\triangle ABC is at most 1 whenever AA, BB, and CC are in SS. Show that there exists a triangle of area 4 that (together with its interior) covers the set SS.

B22015

Given a list of the positive integers 1,2,3,4,1,2,3,4,\dots, take the first three numbers 1,2,31,2,3 and their sum 66 and cross all four numbers off the list. Repeat with the three smallest remaining numbers 4,5,74,5,7 and their sum 1616. Continue in this way, crossing off the three smallest remaining numbers and their sum, and consider the sequence of sums produced: 6,16,27,36,6, 16, 27, 36, \dots. Prove or disprove that there is some number in the sequence whose base 10 representation ends with 20152015.

\,

B42015

Let TT be the set of all triples (a,b,c)(a,b,c) of positive integers for which there exist triangles with side lengths a,b,ca,b,c. Express (a,b,c)T2a3b5c\sum_{(a,b,c) \in T} \frac{2^a}{3^b 5^c} as a rational number in lowest terms.

B52015

Let PnP_n be the number of permutations π\pi of {1,2,,n}\{1,2,\dots,n\} such that ij=1 implies π(i)π(j)2|i-j| = 1 \mbox{ implies } |\pi(i) -\pi(j)| \leq 2 for all i,ji,j in {1,2,,n}\{1,2,\dots,n\}. Show that for n2n \geq 2, the quantity Pn+5Pn+4Pn+3+PnP_{n+5} - P_{n+4} - P_{n+3} + P_n does not depend on nn, and find its value.

B12014

A base 1010 over-expansion of a positive integer NN is an expression of the form N=dk10k+dk110k1++d0100N = d_k 10^k + d_{k-1} 10^{k-1} + \cdots + d_0 10^0 with dk0d_k \neq 0 and di{0,1,2,,10}d_i \in \{0,1,2,\dots,10\} for all ii. For instance, the integer N=10N = 10 has two base 10 over-expansions: 10=1010010 = 10 \cdot 10^0 and the usual base 10 expansion 10=1101+010010 = 1 \cdot 10^1 + 0 \cdot 10^0. Which positive integers have a unique base 10 over-expansion?

B52014

In the 75th annual Putnam Games, participants compete at mathematical games. Patniss and Keeta play a game in which they take turns choosing an element from the group of invertible n×nn \times n matrices with entries in the field Z/pZ\mathbb{Z}/p \mathbb{Z} of integers modulo pp, where nn is a fixed positive integer and pp is a fixed prime number. The rules of the game are:

  1. (1)
    A player cannot choose an element that has been chosen by either player on any previous turn.
  2. (2)
    A player can only choose an element that commutes with all previously chosen elements.
  3. (3)
    A player who cannot choose an element on his/her turn loses the game.

Patniss takes the first turn. Which player has a winning strategy? (Your answer may depend on nn and pp.)

A12013

Recall that a regular icosahedron is a convex polyhedron having 12 vertices and 20 faces; the faces are congruent equilateral triangles. On each face of a regular icosahedron is written a nonnegative integer such that the sum of all 20 integers is 39. Show that there are two faces that share a vertex and have the same integer written on them.

A42013

A finite collection of digits 00 and 11 is written around a circle. An arc of length L0L \geq 0 consists of LL consecutive digits around the circle. For each arc ww, let Z(w)Z(w) and N(w)N(w) denote the number of 00's in ww and the number of 11's in ww, respectively. Assume that Z(w)Z(w)1\left| Z(w) - Z(w') \right| \leq 1 for any two arcs w,ww, w' of the same length. Suppose that some arcs w1,,wkw_1,\dots,w_k have the property that Z=1kj=1kZ(wj) and N=1kj=1kN(wj)Z = \frac{1}{k} \sum_{j=1}^k Z(w_j) \mbox{ and } N = \frac{1}{k} \sum_{j=1}^k N(w_j) are both integers. Prove that there exists an arc ww with Z(w)=ZZ(w) = Z and N(w)=NN(w) = N.

A62013

Define a function w:Z×ZZw: \mathbb{Z} \times \mathbb{Z} \to \mathbb{Z} as follows. For a,b2\left| a \right|, \left| b \right| \leq 2, let w(a,b)w(a,b) be as in the table shown; otherwise, let w(a,b)=0w(a,b) = 0.

w(a,b)w(a,b)bb
-2-1012
-2-1-22-2-1
-1-24-44-2
aa02-412-42
1-24-44-2
2-1-22-2-1

For every finite subset SS of Z×Z\mathbb{Z} \times \mathbb{Z}, define A(S)=(s,s)S×Sw(ss).A(S) = \sum_{(\mathbf{s}, \mathbf{s}') \in S \times S} w(\mathbf{s} - \mathbf{s}'). Prove that if SS is any finite nonempty subset of Z×Z\mathbb{Z} \times \mathbb{Z}, then A(S)>0A(S) > 0. (For example, if S={(0,1),(0,2),(2,0),(3,1)}S = \{(0,1), (0,2), (2,0), (3,1)\}, then the terms in A(S)A(S) are 12,12,12,12,4,4,0,0,0,0,1,1,2,2,4,412, 12, 12, 12, 4, 4, 0, 0, 0,0,-1,-1,-2,-2,-4,-4.)

B12013

For positive integers nn, let the numbers c(n)c(n) be determined by the rules c(1)=1c(1) = 1, c(2n)=c(n)c(2n) = c(n), and c(2n+1)=(1)nc(n)c(2n+1) = (-1)^n c(n). Find the value of n=12013c(n)c(n+2).\sum_{n=1}^{2013} c(n) c(n+2).

B32013

Let P\mathcal{P} be a nonempty collection of subsets of {1,,n}\{1,\dots, n\} such that:

  1. (i)
    if S,SPS, S' \in \mathcal{P}, then SSPS \cup S' \in \mathcal{P} and SSPS \cap S' \in \mathcal{P}, and
  2. (ii)
    if SPS \in \mathcal{P} and SS \neq \emptyset, then there is a subset TST \subset S such that TPT \in \mathcal{P} and TT contains exactly one fewer element than SS.

Suppose that f:PRf: \mathcal{P} \to \mathbb{R} is a function such that f()=0f(\emptyset) = 0 and f(SS)=f(S)+f(S)f(SS) for all S,SP.f(S \cup S') = f(S) + f(S') - f(S \cap S') \mbox{ for all $S,S' \in \mathcal{P}$.} Must there exist real numbers f1,,fnf_1,\dots,f_n such that f(S)=iSfif(S) = \sum_{i \in S} f_i for every SPS \in \mathcal{P}?

B52013

Let X={1,2,,n}X = \{1, 2, \dots, n\}, and let kXk \in X. Show that there are exactly knn1k \cdot n^{n-1} functions f:XXf: X \to X such that for every xXx \in X there is a j0j \geq 0 such that f(j)(x)kf^{(j)}(x) \leq k. [Here f(j)f^{(j)} denotes the jjth iterate of ff, so that f(0)(x)=xf^{(0)}(x) = x and f(j+1)(x)=f(f(j)(x))f^{(j+1)}(x) = f(f^{(j)}(x)).]

B62013

Let n1n \geq 1 be an odd integer. Alice and Bob play the following game, taking alternating turns, with Alice playing first. The playing area consists of nn spaces, arranged in a line. Initially all spaces are empty. At each turn, a player either

  • places a stone in an empty space, or
  • removes a stone from a nonempty space ss, places a stone in the nearest empty space to the left of ss (if such a space exists), and places a stone in the nearest empty space to the right of ss (if such a space exists).

Furthermore, a move is permitted only if the resulting position has not occurred previously in the game. A player loses if he or she is unable to move. Assuming that both players play optimally throughout the game, what moves may Alice make on her first turn?

A12012

Let d1,d2,,d12d_1, d_2, \dots, d_{12} be real numbers in the open interval (1,12)(1, 12). Show that there exist distinct indices i,j,ki, j, k such that di,dj,dkd_i, d_j, d_k are the side lengths of an acute triangle.

B12012

Let SS be a class of functions from [0,)[0, \infty) to [0,)[0, \infty) that satisfies:

  • (i)
    The functions f1(x)=ex1f_1(x) = e^x - 1 and f2(x)=ln(x+1)f_2(x) = \ln(x+1) are in SS;
  • (ii)
    If f(x)f(x) and g(x)g(x) are in SS, the functions f(x)+g(x)f(x) + g(x) and f(g(x))f(g(x)) are in SS;
  • (iii)
    If f(x)f(x) and g(x)g(x) are in SS and f(x)g(x)f(x) \geq g(x) for all x0x \geq 0, then the function f(x)g(x)f(x) - g(x) is in SS.

Prove that if f(x)f(x) and g(x)g(x) are in SS, then the function f(x)g(x)f(x) g(x) is also in SS.

B32012

A round-robin tournament of 2n2n teams lasted for 2n12n-1 days, as follows. On each day, every team played one game against another team, with one team winning and one team losing in each of the nn games. Over the course of the tournament, each team played every other team exactly once. Can one necessarily choose one winning team from each day without choosing any team more than once?

A12011

Define a growing spiral in the plane to be a sequence of points with integer coordinates P0=(0,0),P1,,PnP_0 = (0,0), P_1, \dots, P_n such that n2n \geq 2 and:

  • the directed line segments P0P1,P1P2,,Pn1PnP_0 P_1, P_1 P_2, \dots, P_{n-1} P_n are in the successive coordinate directions east (for P0P1P_0 P_1), north, west, south, east, etc.;
  • the lengths of these line segments are positive and strictly increasing.

[Picture omitted.] How many of the points (x,y)(x,y) with integer coordinates 0x2011,0y20110\leq x\leq 2011, 0\leq y\leq 2011 cannot be the last point, PnP_n of any growing spiral?

B42011

In a tournament, 2011 players meet 2011 times to play a multiplayer game. Every game is played by all 2011 players together and ends with each of the players either winning or losing. The standings are kept in two 2011×20112011 \times 2011 matrices, T=(Thk)T = (T_{hk}) and W=(Whk)W = (W_{hk}). Initially, T=W=0T=W=0. After every game, for every (h,k)(h,k) (including for h=kh=k), if players hh and kk tied (that is, both won or both lost), the entry ThkT_{hk} is increased by 1, while if player hh won and player kk lost, the entry WhkW_{hk} is increased by 1 and WkhW_{kh} is decreased by 1.

Prove that at the end of the tournament, det(T+iW)\det(T+iW) is a non-negative integer divisible by 220102^{2010}.

A12010

Given a positive integer nn, what is the largest kk such that the numbers 1,2,,n1,2,\dots,n can be put into kk boxes so that the sum of the numbers in each box is the same? [When n=8n=8, the example {1,2,3,6},{4,8},{5,7}\{1,2,3,6\}, \{4,8\}, \{5,7\} shows that the largest kk is at least 3.]

B32010

There are 2010 boxes labeled B1,B2,,B2010B_1, B_2, \dots, B_{2010}, and 2010n2010n balls have been distributed among them, for some positive integer nn. You may redistribute the balls by a sequence of moves, each of which consists of choosing an ii and moving exactly ii balls from box BiB_i into any one other box. For which values of nn is it possible to reach the distribution with exactly nn balls in each box, regardless of the initial distribution of balls?

B32009

Call a subset SS of {1,2,,n}\{1, 2, \dots, n\} mediocre if it has the following property: Whenever aa and bb are elements of SS whose average is an integer, that average is also an element of SS. Let A(n)A(n) be the number of mediocre subsets of {1,2,,n}\{1,2,\dots,n\}. [For instance, every subset of {1,2,3}\{1,2,3\} except {1,3}\{1,3\} is mediocre, so A(3)=7A(3) =7.] Find all positive integers nn such that A(n+2)2A(n+1)+A(n)=1A(n+2) - 2A(n+1) + A(n) = 1.

B62009

Prove that for every positive integer nn, there is a sequence of integers a0,a1,,a2009a_0, a_1, \dots, a_{2009} with a0=0a_0 = 0 and a2009=na_{2009} = n such that each term after a0a_0 is either an earlier term plus 2k2^k for some nonnegative integer kk, or of the form bmodcb\,\mathrm{mod}\,c for some earlier positive terms bb and cc. [Here bmodcb\,\mathrm{mod}\,c denotes the remainder when bb is divided by cc, so 0(bmodc)<c0 \leq (b\,\mathrm{mod}\,c) < c.]

A22008

Alan and Barbara play a game in which they take turns filling entries of an initially empty 2008×20082008 \times 2008 array. Alan plays first. At each turn, a player chooses a real number and places it in a vacant entry. The game ends when all the entries are filled. Alan wins if the determinant of the resulting matrix is nonzero; Barbara wins if it is zero. Which player has a winning strategy?

A32008

Start with a finite sequence a1,a2,,ana_1, a_2, \dots, a_n of positive integers. If possible, choose two indices j<kj < k such that aja_j does not divide aka_k, and replace aja_j and aka_k by gcd(aj,ak)\mathrm{gcd}(a_j, a_k) and lcm(aj,ak)\mathrm{lcm}(a_j, a_k), respectively. Prove that if this process is repeated, it must eventually stop and the final sequence does not depend on the choices made. (Note: gcd means greatest common divisor and lcm means least common multiple.)

A62008

Prove that there exists a constant c>0c>0 such that in every nontrivial finite group GG there exists a sequence of length at most clogGc \log |G| with the property that each element of GG equals the product of some subsequence. (The elements of GG in the sequence are not required to be distinct. A subsequence of a sequence is obtained by selecting some of the terms, not necessarily consecutive, without reordering them; for example, 4,4,24, 4, 2 is a subsequence of 2,4,6,4,22, 4, 6, 4, 2, but 2,2,42, 2, 4 is not.)

B62008

Let nn and kk be positive integers. Say that a permutation σ\sigma of {1,2,,n}\{1,2,\dots,n\} is kk-limited if σ(i)ik|\sigma(i) - i| \leq k for all ii. Prove that the number of kk-limited permutations of {1,2,,n}\{1,2,\dots,n\} is odd if and only if n0n \equiv 0 or 11 (mod 2k+12k+1).

A62007

A triangulation T\mathcal{T} of a polygon PP is a finite collection of triangles whose union is PP, and such that the intersection of any two triangles is either empty, or a shared vertex, or a shared side. Moreover, each side is a side of exactly one triangle in T\mathcal{T}. Say that T\mathcal{T} is admissible if every internal vertex is shared by 6 or more triangles. For example, [figure omitted.] Prove that there is an integer MnM_n, depending only on nn, such that any admissible triangulation of a polygon PP with nn sides has at most MnM_n triangles.

B62007

For each positive integer nn, let f(n)f(n) be the number of ways to make n!n! cents using an unordered collection of coins, each worth k!k! cents for some kk, 1kn1 \leq k \leq n. Prove that for some constant CC, independent of nn, nn2/2Cnen2/4f(n)nn2/2+Cnen2/4.n^{n^2/2 - Cn} e^{-n^2/4} \leq f(n) \leq n^{n^2/2 + Cn}e^{-n^2/4}.

A22006

Alice and Bob play a game in which they take turns removing stones from a heap that initially has nn stones. The number of stones removed at each turn must be one less than a prime number. The winner is the player who takes the last stone. Alice plays first. Prove that there are infinitely many nn such that Bob has a winning strategy. (For example, if n=17n=17, then Alice might take 6 leaving 11; then Bob might take 1 leaving 10; then Alice can take the remaining stones to win.)

A42006

Let S={1,2,,n}S = \{1, 2, \dots, n\} for some integer n>1n > 1. Say a permutation π\pi of SS has a local maximum at kSk \in S if

  1. (i)
    π(k)>π(k+1)\pi(k) > \pi(k+1) for k=1k=1;
  2. (ii)
    π(k1)<π(k)\pi(k-1) < \pi(k) and π(k)>π(k+1)\pi(k) > \pi(k+1) for 1<k<n1 < k < n;
  3. (iii)
    π(k1)<π(k)\pi(k-1) < \pi(k) for k=nk=n.

(For example, if n=5n=5 and π\pi takes values at 1,2,3,4,51, 2, 3, 4, 5 of 2,1,4,5,32, 1, 4, 5, 3, then π\pi has a local maximum of 2 at k=1k=1, and a local maximum of 5 at k=4k=4.) What is the average number of local maxima of a permutation of SS, averaging over all permutations of SS?

B22006

Prove that, for every set X={x1,x2,,xn}X = \{x_1, x_2, \dots, x_n\} of nn real numbers, there exists a non-empty subset SS of XX and an integer mm such that m+sSs1n+1.\left| m + \sum_{s \in S} s \right| \leq \frac{1}{n+1}.

B32006

Let SS be a finite set of points in the plane. A linear partition of SS is an unordered pair {A,B}\{A,B\} of subsets of SS such that AB=SA \cup B = S, AB=A \cap B = \emptyset, and AA and BB lie on opposite sides of some straight line disjoint from SS (AA or BB may be empty). Let LSL_S be the number of linear partitions of SS. For each positive integer nn, find the maximum of LSL_S over all sets SS of nn points.

B42006

Let ZZ denote the set of points in Rn\mathbb{R}^n whose coordinates are 0 or 1. (Thus ZZ has 2n2^n elements, which are the vertices of a unit hypercube in Rn\mathbb{R}^n.) Given a vector subspace VV of Rn\mathbb{R}^n, let Z(V)Z(V) denote the number of members of ZZ that lie in VV. Let kk be given, 0kn0 \leq k \leq n. Find the maximum, over all vector subspaces VRnV \subseteq \mathbb{R}^n of dimension kk, of the number of points in VZV \cap Z. [Editorial note: the proposers probably intended to write Z(V)Z(V) instead of “the number of points in VZV \cap Z”, but this changes nothing.]

A22005

Let S={(a,b)a=1,2,,n,b=1,2,3}\mathbf{S} = \{(a,b) | a = 1, 2, \dots,n, b = 1,2,3\}. A rook tour of S\mathbf{S} is a polygonal path made up of line segments connecting points p1,p2,,p3np_1, p_2, \dots, p_{3n} in sequence such that

  1. (i)
    piSp_i \in \mathbf{S},
  2. (ii)
    pip_i and pi+1p_{i+1} are a unit distance apart, for 1i<3n1 \leq i <3n,
  3. (iii)
    for each pSp \in \mathbf{S} there is a unique ii such that pi=pp_i = p. How many rook tours are there that begin at (1,1)(1,1) and end at (n,1)(n,1)?

(An example of such a rook tour for n=5n=5 was depicted in the original.)

A42005

Let HH be an n×nn \times n matrix all of whose entries are ±1\pm 1 and whose rows are mutually orthogonal. Suppose HH has an a×ba \times b submatrix whose entries are all 11. Show that abnab \leq n.

B22005

Find all positive integers n,k1,,knn, k_1, \dots, k_n such that k1++kn=5n4k_1 + \cdots + k_n = 5n-4 and 1k1++1kn=1.\frac{1}{k_1} + \cdots + \frac{1}{k_n} = 1.

B42005

For positive integers mm and nn, let f(m,n)f(m,n) denote the number of nn-tuples (x1,x2,,xn)(x_1,x_2,\dots,x_n) of integers such that x1+x2++xnm|x_1| + |x_2| + \cdots + |x_n| \leq m. Show that f(m,n)=f(n,m)f(m,n) = f(n,m).

B62005

Let SnS_n denote the set of all permutations of the numbers 1,2,,n1,2,\dots,n. For πSn\pi \in S_n, let σ(π)=1\sigma(\pi) = 1 if π\pi is an even permutation and σ(π)=1\sigma(\pi) = -1 if π\pi is an odd permutation. Also, let ν(π)\nu(\pi) denote the number of fixed points of π\pi. Show that πSnσ(π)ν(π)+1=(1)n+1nn+1.\sum_{\pi \in S_n} \frac{\sigma(\pi)}{\nu(\pi) + 1} = (-1)^{n+1} \frac{n}{n+1}.

A12004

Basketball star Shanille O'Keal's team statistician keeps track of the number, S(N)S(N), of successful free throws she has made in her first NN attempts of the season. Early in the season, S(N)S(N) was less than 80% of NN, but by the end of the season, S(N)S(N) was more than 80% of NN. Was there necessarily a moment in between when S(N)S(N) was exactly 80% of NN?

A42004

Show that for any positive integer nn there is an integer NN such that the product x1x2xnx_1 x_2 \cdots x_n can be expressed identically in the form x1x2xn=i=1Nci(ai1x1+ai2x2++ainxn)nx_1 x_2 \cdots x_n = \sum_{i=1}^N c_i ( a_{i1} x_1 + a_{i2} x_2 + \cdots + a_{in} x_n )^n where the cic_i are rational numbers and each aija_{ij} is one of the numbers 1,0,1-1, 0, 1.

A52004

An m×nm \times n checkerboard is colored randomly: each square is independently assigned red or black with probability 1/21/2. We say that two squares, pp and qq, are in the same connected monochromatic region if there is a sequence of squares, all of the same color, starting at pp and ending at qq, in which successive squares in the sequence share a common side. Show that the expected number of connected monochromatic regions is greater than mn/8m n / 8.

A12003

Let nn be a fixed positive integer. How many ways are there to write nn as a sum of positive integers, n=a1+a2++ak,n = a_1 + a_2 + \cdots + a_k, with kk an arbitrary positive integer and a1a2aka1+1a_1 \le a_2 \le \cdots \le a_k \le a_1 + 1? For example, with n=4n=4 there are four ways: 4, 2+2, 1+1+2, 1+1+1+1.

A52003

A Dyck nn-path is a lattice path of nn upsteps (1,1)(1,1) and nn downsteps (1,1)(1,-1) that starts at the origin OO and never dips below the xx-axis. A return is a maximal sequence of contiguous downsteps that terminates on the xx-axis. For example, the Dyck 5-path illustrated has two returns, of length 3 and 1 respectively.

[ Figure omitted — see the original source for the diagram. ]

Show that there is a one-to-one correspondence between the Dyck nn-paths with no return of even length and the Dyck (n1)(n-1)-paths.

A62003

For a set SS of nonnegative integers, let rS(n)r_S(n) denote the number of ordered pairs (s1,s2)(s_1, s_2) such that s1Ss_1 \in S, s2Ss_2 \in S, s1s2s_1 \ne s_2, and s1+s2=ns_1 + s_2 = n. Is it possible to partition the nonnegative integers into two sets AA and BB in such a way that rA(n)=rB(n)r_A(n) = r_B(n) for all nn ?

B22003

Let nn be a positive integer. Starting with the sequence 1,12,13,,1n1, \frac{1}{2}, \frac{1}{3}, \dots, \frac{1}{n}, form a new sequence of n1n-1 entries 34,512,,2n12n(n1)\frac{3}{4}, \frac{5}{12}, \dots, \frac{2n-1}{2n(n-1)} by taking the averages of two consecutive entries in the first sequence. Repeat the averaging of neighbors on the second sequence to obtain a third sequence of n2n-2 entries, and continue until the final sequence produced consists of a single number xnx_n. Show that xn<2/nx_n < 2/n.

A32002

Let n2n \geq 2 be an integer and TnT_n be the number of non-empty subsets SS of {1,2,3,,n}\{1, 2, 3, \dots, n\} with the property that the average of the elements of SS is an integer. Prove that TnnT_n - n is always even.

A42002

In Determinant Tic-Tac-Toe, Player 1 enters a 1 in an empty 3×33 \times 3 matrix. Player 0 counters with a 0 in a vacant position, and play continues in turn until the 3×33 \times 3 matrix is completed with five 1's and four 0's. Player 0 wins if the determinant is 0 and player 1 wins otherwise. Assuming both players pursue optimal strategies, who will win and how?

A52002

Define a sequence by a0=1a_0=1, together with the rules a2n+1=ana_{2n+1} = a_n and a2n+2=an+an+1a_{2n+2} = a_n + a_{n+1} for each integer n0n \geq 0. Prove that every positive rational number appears in the set {an1an:n1}={11,12,21,13,32,}.\left\{ \frac{a_{n-1}}{a_n}: n \geq 1 \right\} = \left\{ \frac{1}{1}, \frac{1}{2}, \frac{2}{1}, \frac{1}{3}, \frac{3}{2}, \dots \right\}.

B22002

Consider a polyhedron with at least five faces such that exactly three edges emerge from each of its vertices. Two players play the following game:

Each player, in turn, signs his or her name on a previously unsigned face. The winner is the player who first succeeds in signing three faces that share a common vertex.

Show that the player who signs first will always win by playing as well as possible.

B42002

An integer nn, unknown to you, has been randomly chosen in the interval [1,2002][1, 2002] with uniform probability. Your objective is to select nn in an odd number of guesses. After each incorrect guess, you are informed whether nn is higher or lower, and you must guess an integer on your next turn among the numbers that are still feasibly correct. Show that you have a strategy so that the chance of winning is greater than 2/32/3.

B12001

Let nn be an even positive integer. Write the numbers 1,2,,n21,2,\ldots,n^2 in the squares of an n×nn\times n grid so that the kk-th row, from left to right, is (k1)n+1,(k1)n+2,,(k1)n+n.(k-1)n+1,(k-1)n+2,\ldots, (k-1)n+n. Color the squares of the grid so that half of the squares in each row and in each column are red and the other half are black (a checkerboard coloring is one possibility). Prove that for each coloring, the sum of the numbers on the red squares is equal to the sum of the numbers on the black squares.

B12000

Let aj,bj,cja_j,b_j,c_j be integers for 1jN1\leq j\leq N. Assume for each jj, at least one of aj,bj,cja_j,b_j,c_j is odd. Show that there exist integers rr, ss, tt such that raj+sbj+tcjra_j+sb_j+tc_j is odd for at least 4N/74N/7 values of jj, 1jN1\leq j\leq N.

B52000

Let S0S_0 be a finite set of positive integers. We define finite sets S1,S2,S_1,S_2,\ldots of positive integers as follows: the integer aa is in Sn+1S_{n+1} if and only if exactly one of a1a-1 or aa is in SnS_n. Show that there exist infinitely many integers NN for which SN=S0{N+a:aS0}S_N=S_0\cup\{N+a: a\in S_0\}.

B62000

Let BB be a set of more than 2n+1/n2^{n+1}/n distinct points with coordinates of the form (±1,±1,,±1)(\pm 1,\pm 1,\ldots,\pm 1) in nn-dimensional space with n3n\geq 3. Show that there are three distinct points in BB which are the vertices of an equilateral triangle.

B31999

Let A={(x,y):0x,y<1}A=\{(x,y):0\leq x,y<1\}. For (x,y)A(x,y)\in A, let S(x,y)=12mn2xmyn,S(x,y) = \sum_{\frac{1}{2}\leq \frac{m}{n}\leq 2} x^m y^n, where the sum ranges over all pairs (m,n)(m,n) of positive integers satisfying the indicated inequalities. Evaluate lim(x,y)(1,1),(x,y)A(1xy2)(1x2y)S(x,y).\lim_{(x,y)\rightarrow (1,1), (x,y)\in A} (1-xy^2)(1-x^2y)S(x,y).

A51998

Let F\mathcal F be a finite collection of open discs in R2\mathbb R^2 whose union contains a set ER2E\subseteq \mathbb R^2. Show that there is a pairwise disjoint subcollection D1,,DnD_1,\ldots, D_n in F\mathcal F such that Ej=1n3Dj.E\subseteq \cup_{j=1}^n 3D_j. Here, if DD is the disc of radius rr and center PP, then 3D3D is the disc of radius 3r3r and center PP.

B41998

Find necessary and sufficient conditions on positive integers mm and nn so that i=0mn1(1)i/m+i/n=0.\sum_{i=0}^{mn-1} (-1)^{\lfloor i/m \rfloor +\lfloor i/n\rfloor}=0.

A21997

Players 1,2,3,,n1,2,3,\ldots,n are seated around a table, and each has a single penny. Player 1 passes a penny to player 2, who then passes two pennies to player 3. Player 3 then passes one penny to Player 4, who passes two pennies to Player 5, and so on, players alternately passing one penny or two to the next player who still has some pennies. A player who runs out of pennies drops out of the game and leaves the table. Find an infinite set of numbers nn for which some player ends up with all nn pennies.

A51997

Let NnN_n denote the number of ordered nn-tuples of positive integers (a1,a2,,an)(a_1,a_2,\ldots,a_n) such that 1/a1+1/a2++1/an=11/a_1 + 1/a_2 +\ldots + 1/a_n=1. Determine whether N10N_{10} is even or odd.

B41997

Let am,na_{m,n} denote the coefficient of xnx^n in the expansion of (1+x+x2)m(1+x+x^2)^m. Prove that for all [integers] k0k\geq 0, 0i=02k3(1)iaki,i1.0\leq \sum_{i=0}^{\lfloor \frac{2k}{3}\rfloor} (-1)^i a_{k-i,i}\leq 1.

A31996

Suppose that each of 20 students has made a choice of anywhere from 0 to 6 courses from a total of 6 courses offered. Prove or disprove: there are 5 students and 2 courses such that all 5 have chosen both courses or all 5 have chosen neither course.

A41996

Let SS be the set of ordered triples (a,b,c)(a, b, c) of distinct elements of a finite set AA. Suppose that

  1. (a,b,c)S(a,b,c) \in S if and only if (b,c,a)S(b,c,a) \in S;
  2. (a,b,c)S(a,b,c) \in S if and only if (c,b,a)S(c,b,a) \notin S;
  3. (a,b,c)(a,b,c) and (c,d,a)(c,d,a) are both in SS if and only if (b,c,d)(b,c,d) and (d,a,b)(d,a,b) are both in SS.

Prove that there exists a one-to-one function gg from AA to RR such that g(a)<g(b)<g(c)g(a) < g(b) < g(c) implies (a,b,c)S(a,b,c) \in S. Note: RR is the set of real numbers.

B11996

Define a selfish set to be a set which has its own cardinality (number of elements) as an element. Find, with proof, the number of subsets of {1,2,,n}\{1, 2, \ldots, n\} which are minimal selfish sets, that is, selfish sets none of whose proper subsets is selfish.

B31996

Given that {x1,x2,,xn}={1,2,,n}\{x_1, x_2, \ldots, x_n\} = \{1, 2, \ldots, n\}, find, with proof, the largest possible value, as a function of nn (with n2n \geq 2), of x1x2+x2x3++xn1xn+xnx1.x_1x_2 + x_2x_3 + \cdots + x_{n-1}x_n + x_nx_1.

B51996

Given a finite string SS of symbols XX and OO, we write Δ(S)\Delta(S) for the number of XX's in SS minus the number of OO's. For example, Δ(XOOXOOX)=1\Delta(XOOXOOX) = -1. We call a string SS balanced if every substring TT of (consecutive symbols of) SS has 2Δ(T)2-2 \leq \Delta(T) \leq 2. Thus, XOOXOOXXOOXOOX is not balanced, since it contains the substring OOXOOOOXOO. Find, with proof, the number of balanced strings of length nn.

A11995

Let SS be a set of real numbers which is closed under multiplication (that is, if aa and bb are in SS, then so is abab). Let TT and UU be disjoint subsets of SS whose union is SS. Given that the product of any {three} (not necessarily distinct) elements of TT is in TT and that the product of any three elements of UU is in UU, show that at least one of the two subsets T,UT,U is closed under multiplication.

A41995

Suppose we have a necklace of nn beads. Each bead is labeled with an integer and the sum of all these labels is n1n-1. Prove that we can cut the necklace to form a string whose consecutive labels x1,x2,,xnx_{1},x_{2},\dots,x_{n} satisfy i=1kxik1fork=1,2,,n.\sum_{i=1}^{k} x_{i} \leq k-1 \qquad \mbox{for} \quad k=1,2,\dots,n.

A61995

Suppose that each of nn people writes down the numbers 1,2,3 in random order in one column of a 3×n3 \times n matrix, with all orders equally likely and with the orders for different columns independent of each other. Let the row sums a,b,ca,b,c of the resulting matrix be rearranged (if necessary) so that abca \leq b \leq c. Show that for some n1995n \geq 1995, it is at least four times as likely that both b=a+1b=a+1 and c=a+2c=a+2 as that a=b=ca=b=c.

B11995

For a partition π\pi of {1,2,3,4,5,6,7,8,9}\{1, 2, 3, 4, 5, 6, 7, 8, 9\}, let π(x)\pi(x) be the number of elements in the part containing xx. Prove that for any two partitions π\pi and π\pi', there are two distinct numbers xx and yy in {1,2,3,4,5,6,7,8,9}\{1, 2, 3, 4, 5, 6, 7, 8, 9\} such that π(x)=π(y)\pi(x) = \pi(y) and π(x)=π(y)\pi'(x) = \pi'(y). [A { partition} of a set SS is a collection of disjoint subsets (parts) whose union is SS.]

B31995

To each positive integer with n2n^{2} decimal digits, we associate the determinant of the matrix obtained by writing the digits in order across the rows. For example, for n=2n=2, to the integer 8617 we associate det(8617)=50\det \left( \begin{array}{cc} 8 & 6 \\ 1 & 7 \end{array} \right) = 50. Find, as a function of nn, the sum of all the determinants associated with n2n^{2}-digit integers. (Leading digits are assumed to be nonzero; for example, for n=2n=2, there are 9000 determinants.)

B51995

A game starts with four heaps of beans, containing 3,4,5 and 6 beans. The two players move alternately. A move consists of taking either

  • a)
    one bean from a heap, provided at least two beans are left behind in that heap, or
  • b)
    a complete heap of two or three beans.

The player who takes the last heap wins. To win the game, do you want to move first or second? Give a winning strategy.

A31994

Show that if the points of an isosceles right triangle of side length 1 are each colored with one of four colors, then there must be two points of the same color whch are at least a distance 222 - \sqrt{2} apart.

A61994

Let f1,,f10f_1, \dots, f_{10} be bijections of the set of integers such that for each integer nn, there is some composition fi1fi2fimf_{i_1} \circ f_{i_2} \circ \cdots \circ f_{i_m} of these functions (allowing repetitions) which maps 0 to nn. Consider the set of 1024 functions F={f1e1f2e2f10e10},\mathcal{F} = \{f_1^{e_1} \circ f_2^{e_2} \circ \cdots \circ f_{10}^{e_{10}}\}, ei=0e_i = 0 or 1 for 1i101 \leq i \leq 10. (fi0f_i^0 is the identity function and fi1=fif_i^1 = f_i.) Show that if AA is any nonempty finite set of integers, then at most 512 of the functions in F\mathcal{F} map AA to itself.

A31993

Let Pn{\cal P}_n be the set of subsets of {1,2,,n}\{1, 2, \dots, n\}. Let c(n,m)c(n, m) be the number of functions f:Pn{1,2,,m}f: {\cal P}_n \to \{1, 2, \dots, m\} such that f(AB)=min{f(A),f(B)}f(A \cap B) = \min\{f(A), f(B)\}. Prove that c(n,m)=j=1mjn.c(n, m) = \sum_{j=1}^m j^n.

A41993

Let x1,x2,,x19x_1, x_2, \dots, x_{19} be positive integers each of which is less than or equal to 93. Let y1,y2,,y93y_1, y_2, \dots, y_{93} be positive integers each of which is less than or equal to 19. Prove that there exists a (nonempty) sum of some xix_i's equal to a sum of some yjy_j's.

A61993

The infinite sequence of 2's and 3's

2,3,3,2,3,3,3,2,3,3,3,2,3,3,2,3,3,3,2,3,3,3,2,3,3,3,2,3,3,2,3,3,3,2,\begin{align*} &2,3,3,2,3,3,3,2,3,3,3,2,3,3,2,3,3, \\ &3,2,3,3,3,2,3,3,3,2,3,3,2,3,3,3,2,\dots \end{align*}

has the property that, if one forms a second sequence that records the number of 3's between successive 2's, the result is identical to the given sequence. Show that there exists a real number rr such that, for any nn, the nnth term of the sequence is 2 if and only if n=1+rmn = 1 + \lfloor rm \rfloor for some nonnegative integer mm. (Note: x\lfloor x \rfloor denotes the largest integer less than or equal to xx.)

B21993

Consider the following game played with a deck of 2n2n cards numbered from 1 to 2n2n. The deck is randomly shuffled and nn cards are dealt to each of two players. Beginning with AA, the players take turns discarding one of their remaining cards and announcing its number. The game ends as soon as the sum of the numbers on the discarded cards is divisible by 2n+12n+1. The last person to discard wins the game. Assuming optimal strategy by both AA and BB, what is the probability that AA wins?

B61993

Let SS be a set of three, not necessarily distinct, positive integers. Show that one can transform SS into a set containing 0 by a finite number of applications of the following rule: Select two of the three integers, say xx and yy, where xyx \leq y and replace them with 2x2x and yxy-x.

B11992

Let SS be a set of nn distinct real numbers. Let ASA_S be the set of numbers that occur as averages of two distinct elements of SS. For a given n2n \geq 2, what is the smallest possible number of elements in ASA_S?

B21992

For nonnegative integers nn and kk, define Q(n,k)Q(n, k) to be the coefficient of xkx^k in the expansion of (1+x+x2+x3)n(1 + x + x^2 + x^3)^n. Prove that Q(n,k)=j=0k(nj)(nk2j),Q(n, k) = \sum_{j=0}^k \binom{n}{j} \binom{n}{k-2j}, where (ab)\binom{a}{b} is the standard binomial coefficient. (Reminder: For integers aa and bb with a0a \geq 0, (ab)=a!b!(ab)!\binom{a}{b} = \frac{a!}{b!(a-b)!} for 0ba0 \leq b \leq a, with (ab)=0\binom{a}{b} = 0 otherwise.)

A61991

Let A(n)A(n) denote the number of sums of positive integers a1+a2++ara_1 + a_2 + \cdots + a_r which add up to nn with

a1>a2+a3,a2>a3+a4,,ar2>ar1+ar,ar1>ar.\begin{gather*} a_1 > a_2 + a_3, a_2 > a_3 + a_4, \ldots, \\ a_{r-2} > a_{r-1} + a_r, a_{r-1} > a_r. \end{gather*}

Let B(n)B(n) denote the number of b1+b2++bsb_1 + b_2 + \cdots + b_s which add up to nn, with

  1. b1b2bs,b_1 \geq b_2 \geq \dots \geq b_s,
  2. each bib_i is in the sequence 1,2,4,,gj,1, 2, 4, \dots, g_j, \dots defined by g1=1g_1 = 1, g2=2g_2 = 2, and gj=gj1+gj2+1,g_j = g_{j-1} + g_{j-2} + 1, and
  3. if b1=gkb_1 = g_k then every element in {1,2,4,,gk}\{1, 2, 4, \dots, g_k\} appears at least once as a bib_i.

Prove that A(n)=B(n)A(n) = B(n) for each n1n \geq 1.

(For example, A(7)=5A(7) = 5 because the relevant sums are 7,6+1,5+2,4+3,4+2+1,7, 6+1, 5+2, 4+3, 4+2+1, and B(7)=5B(7) = 5 because the relevant sums are 4+2+1,2+2+2+1,2+2+1+1+1,2+1+1+1+1+1,1+1+1+1+1+1+1.4+2+1, 2+2+2+1, 2+2+1+1+1, 2+1+1+1+1+1, 1+1+1+1+1+1+1.)

B31991

Does there exist a real number LL such that, if mm and nn are integers greater than LL, then an m×nm \times n rectangle may be expressed as a union of 4×64 \times 6 and 5×75 \times 7 rectangles, any two of which intersect at most along their boundaries?

B41991

Suppose pp is an odd prime. Prove that j=0p(pj)(p+jj)2p+1(modp2).\sum_{j=0}^p \binom{p}{j} \binom{p+j}{j} \equiv 2^p + 1\pmod{p^2}.

A11990

Let T0=2,T1=3,T2=6,T_0 = 2, T_1 = 3, T_2 = 6, and for n3n \geq 3, Tn=(n+4)Tn14nTn2+(4n8)Tn3.T_n = (n+4)T_{n-1} - 4n T_{n-2} + (4n-8) T_{n-3}. The first few terms are 2,3,6,14,40,152,784,5168,40576.2, 3, 6, 14, 40, 152, 784, 5168, 40576. Find, with proof, a formula for TnT_n of the form Tn=An+BnT_n = A_n + B_n, where {An}\{A_n\} and {Bn}\{B_n\} are well-known sequences.

A41990

Consider a paper punch that can be centered at any point of the plane and that, when operated, removes from the plane precisely those points whose distance from the center is irrational. How many punches are needed to remove every point?

A61990

If XX is a finite set, let XX denote the number of elements in XX. Call an ordered pair (S,T)(S, T) of subsets of {1,2,,n}\{1, 2, \dots, n\} {admissible} if s>Ts > |T| for each sSs \in S, and t>St > |S| for each tTt \in T. How many admissible ordered pairs of subsets of {1,2,,10}\{1, 2, \dots, 10\} are there? Prove your answer.

B31990

Let SS be a set of 2×22 \times 2 integer matrices whose entries aija_{ij} (1) are all squares of integers and, (2) satisfy aij200a_{ij} \leq 200. Show that if SS has more than 50387 (=15415215+2= 15^4 - 15^2 - 15 + 2) elements, then it has two elements that commute.

B41989

Can a countably infinite set have an uncountable collection of non-empty subsets such that the intersection of any two of them is finite?

A41988
  1. (a)
    If every point of the plane is painted one of three colors, do there necessarily exist two points of the same color exactly one inch apart?
  2. (b)
    What if “three” is replaced by “nine”?
A21987

The sequence of digits 1234567891011121314151617181920211 2 3 4 5 6 7 8 9 1 0 1 1 1 2 1 3 1 4 1 5 1 6 1 7 1 8 1 9 2 0 2 1 \dots is obtained by writing the positive integers in order. If the 10n10^n-th digit in this sequence occurs in the part of the sequence in which the mm-digit numbers are placed, define f(n)f(n) to be mm. For example, f(2)=2f(2)=2 because the 100th digit enters the sequence in the placement of the two-digit integer 55. Find, with proof, f(1987)f(1987).

B21987

Let r,sr,s and tt be integers with 0r0 \leq r, 0s0 \leq s and r+str+s \leq t. Prove that (s0)(tr)+(s1)(tr+1)++(ss)(tr+s)=t+1(t+1s)(tsr).\frac{\binom s0}{\binom tr} + \frac{\binom s1}{\binom{t}{r+1}} + \cdots + \frac{\binom ss}{\binom{t}{r+s}} = \frac{t+1}{(t+1-s)\binom{t-s}{r}}.

A41986

A transversal of an n×nn\times n matrix AA consists of nn entries of AA, no two in the same row or column. Let f(n)f(n) be the number of n×nn \times n matrices AA satisfying the following two conditions:

  1. (a)
    Each entry αi,j\alpha_{i,j} of AA is in the set {1,0,1}\{-1,0,1\}.
  2. (b)
    The sum of the nn entries of a transversal is the same for all transversals of AA.

An example of such a matrix AA is A=(101010010).A = \left( \begin{array}{ccc} -1 & 0 & -1 \\ 0 & 1 & 0 \\ 0 & 1 & 0 \end{array} \right). Determine with proof a formula for f(n)f(n) of the form f(n)=a1b1n+a2b2n+a3b3n+a4,f(n) = a_1 b_1^n + a_2 b_2^n + a_3 b_3^n + a_4, where the aia_i's and bib_i's are rational numbers.

A61986

Let a1,a2,,ana_1, a_2, \dots, a_n be real numbers, and let b1,b2,,bnb_1, b_2, \dots, b_n be distinct positive integers. Suppose that there is a polynomial f(x)f(x) satisfying the identity (1x)nf(x)=1+i=1naixbi.(1-x)^n f(x) = 1 + \sum_{i=1}^n a_i x^{b_i}. Find a simple expression (not involving any sums) for f(1)f(1) in terms of b1,b2,,bnb_1, b_2, \dots, b_n and nn (but independent of a1,a2,,ana_1, a_2, \dots, a_n).

A11985

Determine, with proof, the number of ordered triples (A1,A2,A3)(A_1, A_2, A_3) of sets which have the property that

  1. (i)
    A1A2A3={1,2,3,4,5,6,7,8,9,10}A_1 \cup A_2 \cup A_3 = \{1,2,3,4,5,6,7,8,9,10\}, and
  2. (ii)
    A1A2A3=A_1 \cap A_2 \cap A_3 = \emptyset.

Express your answer in the form 2a3b5c7d2^a 3^b 5^c 7^d, where a,b,c,da,b,c,d are nonnegative integers.

B11985

Let kk be the smallest positive integer for which there exist distinct integers m1,m2,m3,m4,m5m_1, m_2, m_3, m_4, m_5 such that the polynomial p(x)=(xm1)(xm2)(xm3)(xm4)(xm5)p(x) = (x-m_1)(x-m_2)(x-m_3)(x-m_4)(x-m_5) has exactly kk nonzero coefficients. Find, with proof, a set of integers m1,m2,m3,m4,m5m_1, m_2, m_3, m_4, m_5 for which this minimum kk is achieved.

B31985

Let a1,1a1,2a1,3a2,1a2,2a2,3a3,1a3,2a3,3\begin{array}{cccc} a_{1,1} & a_{1,2} & a_{1,3} & \dots \\ a_{2,1} & a_{2,2} & a_{2,3} & \dots \\ a_{3,1} & a_{3,2} & a_{3,3} & \dots \\ \vdots & \vdots & \vdots & \ddots \end{array} be a doubly infinite array of positive integers, and suppose each positive integer appears exactly eight times in the array. Prove that am,n>mna_{m,n} > mn for some pair of positive integers (m,n)(m,n).