Putnam Archive — Number Theory

Number Theory147 problemsmean difficulty 5.941 years

147 problemsNewest first
A12025

Let m0m_0 and n0n_0 be distinct positive integers. For every positive integer kk, define mkm_k and nkn_k to be the relatively prime positive integers such that mknk=2mk1+12nk1+1.\frac{m_k}{n_k} = \frac{2m_{k-1} + 1}{2n_{k-1}+1}. Prove that 2mk+12m_k+1 and 2nk+12n_k+1 are relatively prime for all but finitely many positive integers kk.

A62025

Let b0=0b_0 = 0 and, for n0n \geq 0, define bn+1=2bn2+bn+1b_{n+1} = 2b_n^2 + b_n + 1. For each k1k \geq 1, show that b2k+12b2kb_{2^{k+1}} - 2b_{2^k} is divisible by 22k+22^{2k+2} but not by 22k+32^{2k+3}.

B32025

Suppose SS is a nonempty set of positive integers with the property that if nn is in SS, then every positive divisor of 2025n15n2025^n -15^n is in SS. Must SS contain all positive integers?

B52025

Let pp be a prime number greater than 33. For each k{1,,p1}k \in \{1,\dots,p-1\}, let I(k){1,2,,p1}I(k) \in \{1,2,\dots,p-1\} be such that kI(k)1(modp)k \cdot I(k) \equiv 1 \pmod{p}. Prove that the number of integers k{1,,p2}k \in \{1,\dots,p-2\} such that I(k+1)<I(k)I(k+1) < I(k) is greater than p/41p/4-1.

B62025

Let N={1,2,3,}\mathbb{N} = \{1,2,3,\dots\}. Find the largest real constant rr such that there exists a function g ⁣:NNg\colon \mathbb{N} \to \mathbb{N} such that g(n+1)g(n)(g(g(n)))rg(n+1)-g(n) \geq (g(g(n)))^r for all nNn \in \mathbb{N}.

A12024

Determine all positive integers nn for which there exist positive integers aa, bb, and cc satisfying 2an+3bn=4cn.2a^n + 3b^n = 4c^n.

A42024

Find all primes p>5p > 5 for which there exists an integer aa and an integer rr satisfying 1rp11 \leq r \leq p-1 with the following property: the sequence 1,a,a2,,ap51,a,a^2,\dots,a^{p-5} can be rearranged to form a sequence b0,b1,b2,,bp5b_0,b_1,b_2,\dots,b_{p-5} such that bnbn1rb_n-b_{n-1}-r is divisible by pp for 1np51 \leq n \leq p-5.

B12024

Let nn and kk be positive integers. The square in the iith row and jjth column of an nn-by-nn grid contains the number i+jki+j-k. For which nn and kk is it possible to select nn squares from the grid, no two in the same row or column, such that the numbers contained in the selected squares are exactly 1,2,,n1,2,\dots,n?

A52023

For a nonnegative integer kk, let f(k)f(k) be the number of ones in the base 3 representation of kk. Find all complex numbers zz such that k=0310101(2)f(k)(z+k)2023=0.\sum_{k=0}^{3^{1010}-1} (-2)^{f(k)} (z+k)^{2023} = 0.

B22023

For each positive integer nn, let k(n)k(n) be the number of ones in the binary representation of 2023n2023 \cdot n. What is the minimum value of k(n)k(n)?

B52023

Determine which positive integers nn have the following property: For all integers mm that are relatively prime to nn, there exists a permutation π ⁣:{1,2,,n}{1,2,,n}\pi\colon \{1,2,\dots,n\} \to \{1,2,\dots,n\} such that π(π(k))mk(modn)\pi(\pi(k)) \equiv mk \pmod{n} for all k{1,2,,n}k \in \{1,2,\dots,n\}.

B62023

Let nn be a positive integer. For ii and jj in {1,2,,n}\{1,2,\dots,n\}, let s(i,j)s(i,j) be the number of pairs (a,b)(a,b) of nonnegative integers satisfying ai+bj=nai +bj=n. Let SS be the nn-by-nn matrix whose (i,j)(i,j) entry is s(i,j)s(i,j). For example, when n=5n=5, we have S=[6322230101210012000121112]S = \begin{bmatrix} 6 & 3 & 2 & 2 & 2 \\ 3 & 0 & 1 & 0 & 1 \\ 2 & 1 & 0 & 0 & 1 \\ 2 & 0 & 0 & 0 & 1 \\ 2 & 1 & 1 & 1 & 2 \end{bmatrix}. Compute the determinant of SS.

A32022

Let pp be a prime number greater than 5. Let f(p)f(p) denote the number of infinite sequences a1,a2,a3,a_1, a_2, a_3, \dots such that an{1,2,,p1}a_n \in \{1, 2, \dots, p-1\} and anan+21+an+1(modp)a_n a_{n+2} \equiv 1 + a_{n+1} \pmod{p} for all n1n \geq 1. Prove that f(p)f(p) is congruent to 0 or 2 (mod5)\pmod{5}.

B12022

Suppose that P(x)=a1x+a2x2++anxnP(x) = a_1 x + a_2 x^2 + \cdots + a_n x^n is a polynomial with integer coefficients, with a1a_1 odd. Suppose that eP(x)=b0+b1x+b2x2+e^{P(x)} = b_0 + b_1 x + b_2 x^2 + \cdots for all xx. Prove that bkb_k is nonzero for all k0k \geq 0.

B32022

Assign to each positive real number a color, either red or blue. Let DD be the set of all distances d>0d > 0 such that there are two points of the same color at distance dd apart. Recolor the positive reals so that the numbers in DD are red and the numbers not in DD are blue. If we iterate this recoloring process, will we always end up with all the numbers red after a finite number of steps?

B52022

For 0p1/20 \leq p \leq 1/2, let X1,X2,X_1, X_2, \dots be independent random variables such that Xi={1with probability p,1with probability p,0with probability 12p,X_i = \begin{cases} 1 & \mbox{with probability $p$,} \\ -1 & \mbox{with probability $p$,} \\ 0 & \mbox{with probability $1-2p$,} \end{cases} for all i1i \geq 1. Given a positive integer nn and integers b,a1,,anb, a_1, \dots, a_n, let P(b,a1,,an)P(b, a_1, \dots, a_n) denote the probability that a1X1++anXn=ba_1 X_1 + \cdots + a_n X_n = b. For which values of pp is it the case that P(0,a1,,an)P(b,a1,,an)P(0, a_1, \dots, a_n) \geq P(b, a_1, \dots, a_n) for all positive integers nn and all integers b,a1,,anb, a_1, \dots, a_n?

A12021

A grasshopper starts at the origin in the coordinate plane and makes a sequence of hops. Each hop has length 55, and after each hop the grasshopper is at a point whose coordinates are both integers; thus, there are 1212 possible locations for the grasshopper after the first hop. What is the smallest number of hops needed for the grasshopper to reach the point (2021,2021)(2021, 2021)?

A32021

Determine all positive integers NN for which the sphere x2+y2+z2=Nx^2 + y^2 + z^2 = N has an inscribed regular tetrahedron whose vertices have integer coordinates.

A52021

Let AA be the set of all integers nn such that 1n20211 \leq n \leq 2021 and gcd(n,2021)=1\gcd(n, 2021) = 1. For every nonnegative integer jj, let S(j)=nAnj.S(j) = \sum_{n \in A} n^j. Determine all values of jj such that S(j)S(j) is a multiple of 2021.

A62021

Let P(x)P(x) be a polynomial whose coefficients are all either 00 or 11. Suppose that P(x)P(x) can be written as a product of two nonconstant polynomials with integer coefficients. Does it follow that P(2)P(2) is a composite integer?

B42021

Let F0,F1,F_0, F_1, \dots be the sequence of Fibonacci numbers, with F0=0F_0 = 0, F1=1F_1 = 1, and Fn=Fn1+Fn2F_n = F_{n-1} + F_{n-2} for n2n \geq 2. For m>2m > 2, let RmR_m be the remainder when the product k=1Fm1kk\prod_{k=1}^{F_m-1} k^k is divided by FmF_m. Prove that RmR_m is also a Fibonacci number.

B52021

Say that an nn-by-nn matrix A=(aij)1i,jnA = (a_{ij})_{1 \leq i,j \leq n} with integer entries is very odd if, for every nonempty subset SS of {1,2,,n}\{1,2,\dots,n\}, the S|S|-by-S|S| submatrix (aij)i,jS(a_{ij})_{i,j \in S} has odd determinant. Prove that if AA is very odd, then AkA^k is very odd for every k1k \geq 1.

A12020

How many positive integers NN satisfy all of the following three conditions?

  1. (i)
    NN is divisible by 2020.
  2. (ii)
    NN has at most 2020 decimal digits.
  3. (iii)
    The decimal digits of NN are a string of consecutive ones followed by a string of consecutive zeros.
A52020

Let ana_n be the number of sets SS of positive integers for which kSFk=n,\sum_{k \in S} F_k = n, where the Fibonacci sequence (Fk)k1(F_k)_{k \geq 1} satisfies Fk+2=Fk+1+FkF_{k+2} = F_{k+1} + F_k and begins F1=1,F2=1,F3=2,F4=3F_1 = 1, F_2 = 1, F_3 = 2, F_4 = 3. Find the largest integer nn such that an=2020a_n = 2020.

B12020

For a positive integer nn, define d(n)d(n) to be the sum of the digits of nn when written in binary (for example, d(13)=1+1+0+1=3)d(13) = 1+1+0+1=3). Let S=k=12020(1)d(k)k3.S = \sum_{k=1}^{2020} (-1)^{d(k)} k^3. Determine SS modulo 2020.

B62020

Let nn be a positive integer. Prove that k=1n(1)k(21)0.\sum_{k=1}^n (-1)^{\lfloor k(\sqrt{2}-1) \rfloor} \geq 0. (As usual, x\lfloor x \rfloor denotes the greatest integer less than or equal to xx.)

A12019

Determine all possible values of the expression A3+B3+C33ABCA^3+B^3+C^3-3ABC where A,BA, B, and CC are nonnegative integers.

A52019

Let pp be an odd prime number, and let Fp\mathbb{F}_p denote the field of integers modulo pp. Let Fp[x]\mathbb{F}_p[x] be the ring of polynomials over Fp\mathbb{F}_p, and let q(x)Fp[x]q(x) \in \mathbb{F}_p[x] be given by q(x)=k=1p1akxk,q(x) = \sum_{k=1}^{p-1} a_k x^k, where ak=k(p1)/2modp.a_k = k^{(p-1)/2} \mod{p}. Find the greatest nonnegative integer nn such that (x1)n(x-1)^n divides q(x)q(x) in Fp[x]\mathbb{F}_p[x].

B52019

Let FmF_m be the mmth Fibonacci number, defined by F1=F2=1F_1 = F_2 = 1 and Fm=Fm1+Fm2F_m = F_{m-1} + F_{m-2} for all m3m \geq 3. Let p(x)p(x) be the polynomial of degree 10081008 such that p(2n+1)=F2n+1p(2n+1) = F_{2n+1} for n=0,1,2,,1008n=0,1,2,\dots,1008. Find integers jj and kk such that p(2019)=FjFkp(2019) = F_j - F_k.

A12018

Find all ordered pairs (a,b)(a,b) of positive integers for which 1a+1b=32018.\frac{1}{a} + \frac{1}{b} = \frac{3}{2018}.

A42018

Let mm and nn be positive integers with gcd(m,n)=1\gcd(m,n) = 1, and let ak=mknm(k1)na_k = \left\lfloor \frac{mk}{n} \right\rfloor - \left\lfloor \frac{m(k-1)}{n} \right\rfloor for k=1,2,,nk=1,2,\dots,n. Suppose that gg and hh are elements in a group GG and that gha1gha2ghan=e,gh^{a_1} gh^{a_2} \cdots gh^{a_n} = e, where ee is the identity element. Show that gh=hggh= hg. (As usual, x\lfloor x \rfloor denotes the greatest integer less than or equal to xx.)

A62018

Suppose that A,B,C,A,B,C, and DD are distinct points, no three of which lie on a line, in the Euclidean plane. Show that if the squares of the lengths of the line segments ABAB, ACAC, ADAD, BCBC, BDBD, and CDCD are rational numbers, then the quotient area(ABC)area(ABD)\frac{\mathrm{area}(\triangle ABC)}{\mathrm{area}(\triangle ABD)} is a rational number.

B32018

Find all positive integers n<10100n < 10^{100} for which simultaneously nn divides 2n2^n, n1n-1 divides 2n12^n-1, and n2n-2 divides 2n22^n - 2.

B42018

Given a real number aa, we define a sequence by x0=1x_0 = 1, x1=x2=ax_1 = x_2 = a, and xn+1=2xnxn1xn2x_{n+1} = 2x_n x_{n-1} - x_{n-2} for n2n \geq 2. Prove that if xn=0x_n = 0 for some nn, then the sequence is periodic.

A12017

Let SS be the smallest set of positive integers such that

  1. (a)
    22 is in SS,
  2. (b)
    nn is in SS whenever n2n^2 is in SS, and
  3. (c)
    (n+5)2(n+5)^2 is in SS whenever nn is in SS.

Which positive integers are not in SS?

(The set SS is “smallest” in the sense that SS is contained in any other such set.)

B22017

Suppose that a positive integer NN can be expressed as the sum of kk consecutive positive integers N=a+(a+1)+(a+2)++(a+k1)N = a + (a+1) +(a+2) + \cdots + (a+k-1) for k=2017k=2017 but for no other values of k>1k>1. Considering all positive integers NN with this property, what is the smallest positive integer aa that occurs in any of these expressions?

B32017

Suppose that f(x)=i=0cixif(x) = \sum_{i=0}^\infty c_i x^i is a power series for which each coefficient cic_i is 00 or 11. Show that if f(2/3)=3/2f(2/3) = 3/2, then f(1/2)f(1/2) must be irrational.

B62017

Find the number of ordered 6464-tuples (x0,x1,,x63)(x_0,x_1,\dots,x_{63}) such that x0,x1,,x63x_0,x_1,\dots,x_{63} are distinct elements of {1,2,,2017}\{1,2,\dots,2017\} and x0+x1+2x2+3x3++63x63x_0 + x_1 + 2x_2 + 3x_3 + \cdots + 63 x_{63} is divisible by 2017.

A12016

Find the smallest positive integer jj such that for every polynomial p(x)p(x) with integer coefficients and for every integer kk, the integer p(j)(k)=djdxjp(x)x=kp^{(j)}(k) = \left. \frac{d^j}{dx^j} p(x) \right|_{x=k} (the jj-th derivative of p(x)p(x) at kk) is divisible by 2016.

B22016

Define a positive integer nn to be squarish if either nn is itself a perfect square or the distance from nn to the nearest perfect square is a perfect square. For example, 2016 is squarish, because the nearest perfect square to 2016 is 452=202545^2 = 2025 and 20252016=92025-2016=9 is a perfect square. (Of the positive integers between 1 and 10, only 6 and 7 are not squarish.)

For a positive integer NN, let S(N)S(N) be the number of squarish integers between 1 and NN, inclusive. Find positive constants α\alpha and β\beta such that limNS(N)Nα=β,\lim_{N \to \infty} \frac{S(N)}{N^\alpha} = \beta, or show that no such constants exist.

B62016

Evaluate k=1(1)k1kn=01k2n+1.\sum_{k=1}^\infty \frac{(-1)^{k-1}}{k} \sum_{n=0}^\infty \frac{1}{k2^n + 1}.

A22015

Let a0=1a_0=1, a1=2a_1=2, and an=4an1an2a_n=4a_{n-1}-a_{n-2} for n2n\geq 2. Find an odd prime factor of a2015a_{2015}.

A32015

Compute log2(a=12015b=12015(1+e2πiab/2015))\log_2 \left( \prod_{a=1}^{2015} \prod_{b=1}^{2015} (1+e^{2\pi i a b/2015}) \right) Here ii is the imaginary unit (that is, i2=1i^2=-1).

A42015

For each real number xx, let f(x)=nSx12n,f(x) = \sum_{n\in S_x} \frac{1}{2^n}, where SxS_x is the set of positive integers nn for which nx\lfloor nx \rfloor is even. What is the largest real number LL such that f(x)Lf(x) \geq L for all x[0,1)x \in [0,1)? (As usual, z\lfloor z \rfloor denotes the greatest integer less than or equal to zz.)

A52015

Let qq be an odd positive integer, and let NqN_q denote the number of integers aa such that 0<a<q/40 < a < q/4 and gcd(a,q)=1\gcd(a,q) = 1. Show that NqN_q is odd if and only if qq is of the form pkp^k with kk a positive integer and pp a prime congruent to 55 or 77 modulo 88.

B22015

Given a list of the positive integers 1,2,3,4,1,2,3,4,\dots, take the first three numbers 1,2,31,2,3 and their sum 66 and cross all four numbers off the list. Repeat with the three smallest remaining numbers 4,5,74,5,7 and their sum 1616. Continue in this way, crossing off the three smallest remaining numbers and their sum, and consider the sequence of sums produced: 6,16,27,36,6, 16, 27, 36, \dots. Prove or disprove that there is some number in the sequence whose base 10 representation ends with 20152015.

\,

B62015

For each positive integer kk, let A(k)A(k) be the number of odd divisors of kk in the interval [1,2k)[1, \sqrt{2k}). Evaluate k=1(1)k1A(k)k.\sum_{k=1}^\infty (-1)^{k-1} \frac{A(k)}{k}.

A12014

Prove that every nonzero coefficient of the Taylor series of (1x+x2)ex(1 - x + x^2)e^x about x=0x=0 is a rational number whose numerator (in lowest terms) is either 11 or a prime number.

B12014

A base 1010 over-expansion of a positive integer NN is an expression of the form N=dk10k+dk110k1++d0100N = d_k 10^k + d_{k-1} 10^{k-1} + \cdots + d_0 10^0 with dk0d_k \neq 0 and di{0,1,2,,10}d_i \in \{0,1,2,\dots,10\} for all ii. For instance, the integer N=10N = 10 has two base 10 over-expansions: 10=1010010 = 10 \cdot 10^0 and the usual base 10 expansion 10=1101+010010 = 1 \cdot 10^1 + 0 \cdot 10^0. Which positive integers have a unique base 10 over-expansion?

B32014

Let AA be an m×nm \times n matrix with rational entries. Suppose that there are at least m+nm+n distinct prime numbers among the absolute values of the entries of AA. Show that the rank of AA is at least 2.

A22013

Let SS be the set of all positive integers that are not perfect squares. For nn in SS, consider choices of integers a1,a2,,ara_1, a_2, \dots, a_r such that n<a1<a2<<arn < a_1< a_2 < \cdots < a_r and na1a2arn \cdot a_1 \cdot a_2 \cdots a_r is a perfect square, and let f(n)f(n) be the minumum of ara_r over all such choices. For example, 2362 \cdot 3 \cdot 6 is a perfect square, while 232 \cdot 3, 242 \cdot 4, 252 \cdot 5, 2342 \cdot 3 \cdot 4, 2352 \cdot 3 \cdot 5, 2452 \cdot 4 \cdot 5, and 23452 \cdot 3 \cdot 4 \cdot 5 are not, and so f(2)=6f(2) = 6. Show that the function ff from SS to the integers is one-to-one.

B12013

For positive integers nn, let the numbers c(n)c(n) be determined by the rules c(1)=1c(1) = 1, c(2n)=c(n)c(2n) = c(n), and c(2n+1)=(1)nc(n)c(2n+1) = (-1)^n c(n). Find the value of n=12013c(n)c(n+2).\sum_{n=1}^{2013} c(n) c(n+2).

A42012

Let qq and rr be integers with q>0q > 0, and let AA and BB be intervals on the real line. Let TT be the set of all b+mqb+mq where bb and mm are integers with bb in BB, and let SS be the set of all integers aa in AA such that rara is in TT. Show that if the product of the lengths of AA and BB is less than qq, then SS is the intersection of AA with some arithmetic progression.

A52012

Let Fp\FF_p denote the field of integers modulo a prime pp, and let nn be a positive integer. Let vv be a fixed vector in Fpn\FF_p^n, let MM be an n×nn \times n matrix with entries of Fp\FF_p, and define G:FpnFpnG: \FF_p^n \to \FF_p^n by G(x)=v+MxG(x) = v + Mx. Let G(k)G^{(k)} denote the kk-fold composition of GG with itself, that is, G(1)(x)=G(x)G^{(1)}(x) = G(x) and G(k+1)(x)=G(G(k)(x))G^{(k+1)}(x) = G(G^{(k)}(x)). Determine all pairs p,np, n for which there exist vv and MM such that the pnp^n vectors G(k)(0)G^{(k)}(0), k=1,2,,pnk=1,2,\dots,p^n are distinct.

B62012

Let pp be an odd prime number such that p2(mod3)p \equiv 2 \pmod{3}. Define a permutation π\pi of the residue classes modulo pp by π(x)x3(modp)\pi(x) \equiv x^3 \pmod{p}. Show that π\pi is an even permutation if and only if p3(mod4)p \equiv 3 \pmod{4}.

A42011

For which positive integers nn is there an n×nn \times n matrix with integer entries such that every dot product of a row with itself is even, while every dot product of two different rows is odd?

B12011

Let hh and kk be positive integers. Prove that for every ϵ>0\epsilon > 0, there are positive integers mm and nn such that ϵ<hmkn<2ϵ.\epsilon < |h \sqrt{m} - k \sqrt{n}| < 2\epsilon.

B22011

Let SS be the set of all ordered triples (p,q,r)(p,q,r) of prime numbers for which at least one rational number xx satisfies px2+qx+r=0px^2 + qx + r =0. Which primes appear in seven or more elements of SS?

B62011

Let pp be an odd prime. Show that for at least (p+1)/2(p+1)/2 values of nn in {0,1,2,,p1}\{0,1,2,\dots,p-1\}, k=0p1k!nkis not divisible by p.\sum_{k=0}^{p-1} k! n^k \qquad \mbox{is not divisible by $p$.}

A12010

Given a positive integer nn, what is the largest kk such that the numbers 1,2,,n1,2,\dots,n can be put into kk boxes so that the sum of the numbers in each box is the same? [When n=8n=8, the example {1,2,3,6},{4,8},{5,7}\{1,2,3,6\}, \{4,8\}, \{5,7\} shows that the largest kk is at least 3.]

A42010

Prove that for each positive integer nn, the number 101010n+1010n+10n110^{10^{10^n}} + 10^{10^n} + 10^n - 1 is not prime.

B22010

Given that AA, BB, and CC are noncollinear points in the plane with integer coordinates such that the distances ABAB, ACAC, and BCBC are integers, what is the smallest possible value of ABAB?

B32010

There are 2010 boxes labeled B1,B2,,B2010B_1, B_2, \dots, B_{2010}, and 2010n2010n balls have been distributed among them, for some positive integer nn. You may redistribute the balls by a sequence of moves, each of which consists of choosing an ii and moving exactly ii balls from box BiB_i into any one other box. For which values of nn is it possible to reach the distribution with exactly nn balls in each box, regardless of the initial distribution of balls?

A42009

Let SS be a set of rational numbers such that

  1. (a)
    0S0 \in S;
  2. (b)
    If xSx \in S then x+1Sx+1\in S and x1Sx-1\in S; and
  3. (c)
    If xSx\in S and x∉{0,1}x\not\in\{0,1\}, then 1x(x1)S\frac{1}{x(x-1)}\in S.

Must SS contain all rational numbers?

B12009

Show that every positive rational number can be written as a quotient of products of factorials of (not necessarily distinct) primes. For example, 109=2!5!3!3!3!.\frac{10}{9} = \frac{2!\cdot 5!}{3!\cdot 3! \cdot 3!}. \,

B62009

Prove that for every positive integer nn, there is a sequence of integers a0,a1,,a2009a_0, a_1, \dots, a_{2009} with a0=0a_0 = 0 and a2009=na_{2009} = n such that each term after a0a_0 is either an earlier term plus 2k2^k for some nonnegative integer kk, or of the form bmodcb\,\mathrm{mod}\,c for some earlier positive terms bb and cc. [Here bmodcb\,\mathrm{mod}\,c denotes the remainder when bb is divided by cc, so 0(bmodc)<c0 \leq (b\,\mathrm{mod}\,c) < c.]

A32008

Start with a finite sequence a1,a2,,ana_1, a_2, \dots, a_n of positive integers. If possible, choose two indices j<kj < k such that aja_j does not divide aka_k, and replace aja_j and aka_k by gcd(aj,ak)\mathrm{gcd}(a_j, a_k) and lcm(aj,ak)\mathrm{lcm}(a_j, a_k), respectively. Prove that if this process is repeated, it must eventually stop and the final sequence does not depend on the choices made. (Note: gcd means greatest common divisor and lcm means least common multiple.)

B12008

What is the maximum number of rational points that can lie on a circle in R2\mathbb{R}^2 whose center is not a rational point? (A rational point is a point both of whose coordinates are rational numbers.)

B42008

Let pp be a prime number. Let h(x)h(x) be a polynomial with integer coefficients such that h(0),h(1),,h(p21)h(0), h(1), \dots, h(p^2-1) are distinct modulo p2p^2. Show that h(0),h(1),,h(p31)h(0), h(1), \dots, h(p^3-1) are distinct modulo p3p^3.

B52008

Find all continuously differentiable functions f:RRf: \mathbb{R} \to \mathbb{R} such that for every rational number qq, the number f(q)f(q) is rational and has the same denominator as qq. (The denominator of a rational number qq is the unique positive integer bb such that q=a/bq = a/b for some integer aa with gcd(a,b)=1\mathrm{gcd}(a,b) = 1.) (Note: gcd means greatest common divisor.)

B62008

Let nn and kk be positive integers. Say that a permutation σ\sigma of {1,2,,n}\{1,2,\dots,n\} is kk-limited if σ(i)ik|\sigma(i) - i| \leq k for all ii. Prove that the number of kk-limited permutations of {1,2,,n}\{1,2,\dots,n\} is odd if and only if n0n \equiv 0 or 11 (mod 2k+12k+1).

A32007

Let kk be a positive integer. Suppose that the integers 1,2,3,,3k+11, 2, 3, \dots, 3k+1 are written down in random order. What is the probability that at no time during this process, the sum of the integers that have been written up to that time is a positive integer divisible by 3? Your answer should be in closed form, but may include factorials.

A42007

A repunit is a positive integer whose digits in base 10 are all ones. Find all polynomials ff with real coefficients such that if nn is a repunit, then so is f(n)f(n).

B12007

Let ff be a polynomial with positive integer coefficients. Prove that if nn is a positive integer, then f(n)f(n) divides f(f(n)+1)f(f(n)+1) if and only if n=1n=1. [Editor's note: one must assume ff is nonconstant.]

B32007

Let x0=1x_0 = 1 and for n0n \geq 0, let xn+1=3xn+xn5x_{n+1} = 3x_n + \lfloor x_n \sqrt{5} \rfloor. In particular, x1=5x_1 = 5, x2=26x_2 = 26, x3=136x_3 = 136, x4=712x_4 = 712. Find a closed-form expression for x2007x_{2007}. (a\lfloor a \rfloor means the largest integer a\leq a.)

B52007

Let kk be a positive integer. Prove that there exist polynomials P0(n),P1(n),,Pk1(n)P_0(n), P_1(n), \dots, P_{k-1}(n) (which may depend on kk) such that for any integer nn, nkk=P0(n)+P1(n)nk++Pk1(n)nkk1.\left\lfloor \frac{n}{k} \right\rfloor^k = P_0(n) + P_1(n) \left\lfloor \frac{n}{k} \right\rfloor + \cdots + P_{k-1}(n) \left\lfloor \frac{n}{k} \right\rfloor^{k-1}. (a\lfloor a \rfloor means the largest integer a\leq a.)

B62007

For each positive integer nn, let f(n)f(n) be the number of ways to make n!n! cents using an unordered collection of coins, each worth k!k! cents for some kk, 1kn1 \leq k \leq n. Prove that for some constant CC, independent of nn, nn2/2Cnen2/4f(n)nn2/2+Cnen2/4.n^{n^2/2 - Cn} e^{-n^2/4} \leq f(n) \leq n^{n^2/2 + Cn}e^{-n^2/4}.

A32006

Let 1,2,3,,2005,2006,2007,2009,2012,2016,1, 2, 3, \dots, 2005, 2006, 2007, 2009, 2012, 2016, \dots be a sequence defined by xk=kx_k = k for k=1,2,,2006k=1, 2, \dots, 2006 and xk+1=xk+xk2005x_{k+1} = x_k + x_{k-2005} for k2006k \geq 2006. Show that the sequence has 2005 consecutive terms each divisible by 2006.

B22006

Prove that, for every set X={x1,x2,,xn}X = \{x_1, x_2, \dots, x_n\} of nn real numbers, there exists a non-empty subset SS of XX and an integer mm such that m+sSs1n+1.\left| m + \sum_{s \in S} s \right| \leq \frac{1}{n+1}.

A12005

Show that every positive integer is a sum of one or more numbers of the form 2r3s2^r 3^s, where rr and ss are nonnegative integers and no summand divides another. (For example, 23 = 9 + 8 + 6.)

B12005

Find a nonzero polynomial P(x,y)P(x,y) such that P(a,2a)=0P(\lfloor a \rfloor, \lfloor 2a \rfloor) = 0 for all real numbers aa. (Note: ν\lfloor \nu \rfloor is the greatest integer less than or equal to ν\nu.)

B22005

Find all positive integers n,k1,,knn, k_1, \dots, k_n such that k1++kn=5n4k_1 + \cdots + k_n = 5n-4 and 1k1++1kn=1.\frac{1}{k_1} + \cdots + \frac{1}{k_n} = 1.

A32004

Define a sequence {un}n=0\{ u_n \}_{n=0}^\infty by u0=u1=u2=1u_0 = u_1 = u_2 = 1, and thereafter by the condition that det(unun+1un+2un+3)=n!\det\begin{pmatrix} u_n & u_{n+1}\\ u_{n+2} & u_{n+3} \end{pmatrix} = n! for all n0n \ge 0. Show that unu_n is an integer for all nn. (By convention, 0!=10! = 1.)

B12004

Let P(x)=cnxn+cn1xn1++c0P(x) = c_n x^n + c_{n-1} x^{n-1} + \cdots + c_0 be a polynomial with integer coefficients. Suppose that rr is a rational number such that P(r)=0P(r) = 0. Show that the nn numbers

cnr,cnr2+cn1r,cnr3+cn1r2+cn2r,,cnrn+cn1rn1++c1r\begin{gather*} c_n r, \, c_n r^2 + c_{n-1} r, \, c_n r^3 + c_{n-1} r^2 + c_{n-2} r, \\ \dots, \, c_n r^n + c_{n-1} r^{n-1} + \cdots + c_1 r \end{gather*}

are integers.

B62004

Let A\mathcal{A} be a non-empty set of positive integers, and let N(x)N(x) denote the number of elements of A\mathcal{A} not exceeding xx. Let B\mathcal{B} denote the set of positive integers bb that can be written in the form b=aab = a - a' with aAa \in \mathcal{A} and aAa' \in \mathcal{A}. Let b1<b2<b_1 < b_2 < \cdots be the members of B\mathcal{B}, listed in increasing order. Show that if the sequence bi+1bib_{i+1} - b_i is unbounded, then limxN(x)/x=0.\lim_{x \to\infty} N(x)/x = 0.

A12003

Let nn be a fixed positive integer. How many ways are there to write nn as a sum of positive integers, n=a1+a2++ak,n = a_1 + a_2 + \cdots + a_k, with kk an arbitrary positive integer and a1a2aka1+1a_1 \le a_2 \le \cdots \le a_k \le a_1 + 1? For example, with n=4n=4 there are four ways: 4, 2+2, 1+1+2, 1+1+1+1.

A62003

For a set SS of nonnegative integers, let rS(n)r_S(n) denote the number of ordered pairs (s1,s2)(s_1, s_2) such that s1Ss_1 \in S, s2Ss_2 \in S, s1s2s_1 \ne s_2, and s1+s2=ns_1 + s_2 = n. Is it possible to partition the nonnegative integers into two sets AA and BB in such a way that rA(n)=rB(n)r_A(n) = r_B(n) for all nn ?

B32003

Show that for each positive integer n, n!=i=1nlcm{1,2,,n/i}.n! = \prod_{i=1}^n \mathrm{lcm}\{1, 2, \dots, \lfloor n/i\rfloor\} . (Here lcm\mathrm{lcm} denotes the least common multiple, and x\lfloor x \rfloor denotes the greatest integer x\leq x.)

A32002

Let n2n \geq 2 be an integer and TnT_n be the number of non-empty subsets SS of {1,2,3,,n}\{1, 2, 3, \dots, n\} with the property that the average of the elements of SS is an integer. Prove that TnnT_n - n is always even.

A52002

Define a sequence by a0=1a_0=1, together with the rules a2n+1=ana_{2n+1} = a_n and a2n+2=an+an+1a_{2n+2} = a_n + a_{n+1} for each integer n0n \geq 0. Prove that every positive rational number appears in the set {an1an:n1}={11,12,21,13,32,}.\left\{ \frac{a_{n-1}}{a_n}: n \geq 1 \right\} = \left\{ \frac{1}{1}, \frac{1}{2}, \frac{2}{1}, \frac{1}{3}, \frac{3}{2}, \dots \right\}.

A62002

Fix an integer b2b \geq 2. Let f(1)=1f(1) = 1, f(2)=2f(2) = 2, and for each n3n \geq 3, define f(n)=nf(d)f(n) = n f(d), where dd is the number of base-bb digits of nn. For which values of bb does n=11f(n)\sum_{n=1}^\infty \frac{1}{f(n)} converge?

B52002

A palindrome in base bb is a positive integer whose base-bb digits read the same backwards and forwards; for example, 20022002 is a 4-digit palindrome in base 10. Note that 200 is not a palindrome in base 10, but it is the 3-digit palindrome 242 in base 9, and 404 in base 7. Prove that there is an integer which is a 3-digit palindrome in base bb for at least 2002 different values of bb.

B62002

Let pp be a prime number. Prove that the determinant of the matrix (xyzxpypzpxp2yp2zp2)\begin{pmatrix} x & y & z \\ x^p & y^p & z^p \\ x^{p^2} & y^{p^2} & z^{p^2} \end{pmatrix} is congruent modulo pp to a product of polynomials of the form ax+by+czax+by+cz, where a,b,ca,b,c are integers. (We say two integer polynomials are congruent modulo pp if corresponding coefficients are congruent modulo pp.)

A52001

Prove that there are unique positive integers aa, nn such that an+1(a+1)n=2001a^{n+1}-(a+1)^n=2001.

B12001

Let nn be an even positive integer. Write the numbers 1,2,,n21,2,\ldots,n^2 in the squares of an n×nn\times n grid so that the kk-th row, from left to right, is (k1)n+1,(k1)n+2,,(k1)n+n.(k-1)n+1,(k-1)n+2,\ldots, (k-1)n+n. Color the squares of the grid so that half of the squares in each row and in each column are red and the other half are black (a checkerboard coloring is one possibility). Prove that for each coloring, the sum of the numbers on the red squares is equal to the sum of the numbers on the black squares.

B32001

For any positive integer nn, let n\langle n\rangle denote the closest integer to n\sqrt{n}. Evaluate n=12n+2n2n.\sum_{n=1}^\infty \frac{2^{\langle n\rangle}+2^{-\langle n\rangle}} {2^n}.

B42001

Let SS denote the set of rational numbers different from {1,0,1}\{-1,0,1\}. Define f:SSf:S\rightarrow S by f(x)=x1/xf(x)=x-1/x. Prove or disprove that n=1f(n)(S)=,\bigcap_{n=1}^\infty f^{(n)}(S) = \emptyset, where f(n)f^{(n)} denotes ff composed with itself nn times.

A22000

Prove that there exist infinitely many integers nn such that n,n+1,n+2n,n+1,n+2 are each the sum of the squares of two integers. [Example: 0=02+020=0^2+0^2, 1=02+121=0^2+1^2, 2=12+122=1^2+1^2.]

A52000

Three distinct points with integer coordinates lie in the plane on a circle of radius r>0r>0. Show that two of these points are separated by a distance of at least r1/3r^{1/3}.

A62000

Let f(x)f(x) be a polynomial with integer coefficients. Define a sequence a0,a1,a_0,a_1,\ldots of integers such that a0=0a_0=0 and an+1=f(an)a_{n+1}=f(a_n) for all n0n\geq 0. Prove that if there exists a positive integer mm for which am=0a_m=0 then either a1=0a_1=0 or a2=0a_2=0.

B22000

Prove that the expression gcd(m,n)n(nm)\frac{gcd(m,n)}{n}\binom{n}{m} is an integer for all pairs of integers nm1n\geq m\geq 1.

A31999

Consider the power series expansion 112xx2=n=0anxn.\frac{1}{1-2x-x^2} = \sum_{n=0}^\infty a_n x^n. Prove that, for each integer n0n\geq 0, there is an integer mm such that an2+an+12=am.a_n^2 + a_{n+1}^2 = a_m .

A61999

The sequence (an)n1(a_n)_{n\geq 1} is defined by a1=1,a2=2,a3=24,a_1=1, a_2=2, a_3=24, and, for n4n\geq 4, an=6an12an38an1an22an2an3.a_n = \frac{6a_{n-1}^2a_{n-3} - 8a_{n-1}a_{n-2}^2}{a_{n-2}a_{n-3}}. Show that, for all n, ana_n is an integer multiple of nn.

B61999

Let SS be a finite set of integers, each greater than 1. Suppose that for each integer nn there is some sSs\in S such that gcd(s,n)=1\gcd(s,n)=1 or gcd(s,n)=s\gcd(s,n)=s. Show that there exist s,tSs,t\in S such that gcd(s,t)\gcd(s,t) is prime.

A41998

Let A1=0A_1=0 and A2=1A_2=1. For n>2n>2, the number AnA_n is defined by concatenating the decimal expansions of An1A_{n-1} and An2A_{n-2} from left to right. For example A3=A2A1=10A_3=A_2 A_1=10, A4=A3A2=101A_4=A_3 A_2 = 101, A5=A4A3=10110A_5=A_4 A_3 = 10110, and so forth. Determine all nn such that 1111 divides AnA_n.

A61998

Let A,B,CA, B, C denote distinct points with integer coordinates in R2\mathbb R^2. Prove that if (AB+BC)2<8[ABC]+1(|AB|+|BC|)^2<8\cdot [ABC]+1 then A,B,CA, B, C are three vertices of a square. Here XY|XY| is the length of segment XYXY and [ABC][ABC] is the area of triangle ABCABC.

B51998

Let NN be the positive integer with 1998 decimal digits, all of them 1; that is, N=111111.N=1111\cdots 11. Find the thousandth digit after the decimal point of N\sqrt N.

B61998

Prove that, for any integers a,b,ca, b, c, there exists a positive integer nn such that n3+an2+bn+c\sqrt{n^3+an^2+bn+c} is not an integer.

A51997

Let NnN_n denote the number of ordered nn-tuples of positive integers (a1,a2,,an)(a_1,a_2,\ldots,a_n) such that 1/a1+1/a2++1/an=11/a_1 + 1/a_2 +\ldots + 1/a_n=1. Determine whether N10N_{10} is even or odd.

B11997

Let {x}\{x\} denote the distance between the real number xx and the nearest integer. For each positive integer nn, evaluate Fn=m=16n1min({m6n},{m3n}).F_n=\sum_{m=1}^{6n-1} \min(\{\frac{m}{6n}\},\{\frac{m}{3n}\}). (Here min(a,b)\min(a,b) denotes the minimum of aa and bb.)

B31997

For each positive integer nn, write the sum m=1n1/m\sum_{m=1}^n 1/m in the form pn/qnp_n/q_n, where pnp_n and qnq_n are relatively prime positive integers. Determine all nn such that 5 does not divide qnq_n.

B51997

Prove that for n2n\geq 2, 222n terms222n1 terms(modn).\overbrace{2^{2^{\cdots^{2}}}}^{\mbox{$n$ terms}} \equiv \overbrace{2^{2^{\cdots^{2}}}}^{\mbox{$n-1$ terms}} \quad \pmod{n}.

A51996

If pp is a prime number greater than 3 and k=2p/3k = \lfloor 2p/3 \rfloor, prove that the sum (p1)+(p2)++(pk)\binom p1 + \binom p2 + \cdots + \binom pk of binomial coefficients is divisible by p2p^2.

A31995

The number d1d2d9d_{1}d_{2}\dots d_{9} has nine (not necessarily distinct) decimal digits. The number e1e2e9e_{1}e_{2}\dots e_{9} is such that each of the nine 9-digit numbers formed by replacing just one of the digits did_{i} is d1d2d9d_{1}d_{2}\dots d_{9} by the corresponding digit eie_{i} (1i91 \leq i \leq 9) is divisible by 7. The number f1f2f9f_{1}f_{2}\dots f_{9} is related to e1e2e9e_{1}e_{2}\dots e_{9} is the same way: that is, each of the nine numbers formed by replacing one of the eie_{i} by the corresponding fif_{i} is divisible by 7. Show that, for each ii, difid_{i}-f_{i} is divisible by 7. [For example, if d1d2d9=199501996d_{1}d_{2}\dots d_{9} = 199501996, then e6e_{6} may be 2 or 9, since 199502996199502996 and 199509996199509996 are multiples of 7.]

B41995

Evaluate 220712207122078.\sqrt[8]{2207 - \frac{1}{2207-\frac{1}{2207-\dots}}}. Express your answer in the form a+bcd\frac{a+b\sqrt{c}}{d}, where a,b,c,da,b,c,d are integers.

B61995

For a positive real number α\alpha, define S(α)={nα:n=1,2,3,}.S(\alpha) = \{ \lfloor n\alpha \rfloor : n = 1,2,3,\dots \}. Prove that {1,2,3,}\{1,2,3,\dots\} cannot be expressed as the disjoint union of three sets S(α),S(β)S(\alpha), S(\beta) and S(γ)S(\gamma). [As usual, x\lfloor x \rfloor is the greatest integer x\leq x.]

B11994

Find all positive integers nn that are within 250 of exactly 15 perfect squares.

B41994

For n1n \geq 1, let dnd_n be the greatest common divisor of the entries of AnIA^n - I, where A=(3243) and I=(1001).A = \begin{pmatrix} 3 & 2 \\ 4 & 3 \end{pmatrix} \quad \mbox{ and } \quad I = \begin{pmatrix} 1 & 0 \\ 0 & 1 \end{pmatrix}. Show that limndn=\lim_{n \to \infty} d_n = \infty.

B51994

For any real number α\alpha, define the function fα(x)=αxf_{\alpha}(x) = \lfloor \alpha x \rfloor. Let nn be a positive integer. Show that there exists an α\alpha such that for 1kn1 \leq k \leq n, fαk(n2)=n2k=fαk(n2).f_\alpha^k(n^2) = n^2 - k = f_{\alpha^k}(n^2).

B61994

For any integer nn, set na=101a1002a.n_a = 101a - 100\cdot 2^a. Show that for 0a,b,c,d990 \leq a,b,c,d \leq 99, na+nbnc+nd(mod10100)n_a + n_b \equiv n_c + n_d \pmod{10100} implies {a,b}={c,d}\{a,b\} = \{c,d\}.

A61993

The infinite sequence of 2's and 3's

2,3,3,2,3,3,3,2,3,3,3,2,3,3,2,3,3,3,2,3,3,3,2,3,3,3,2,3,3,2,3,3,3,2,\begin{align*} &2,3,3,2,3,3,3,2,3,3,3,2,3,3,2,3,3, \\ &3,2,3,3,3,2,3,3,3,2,3,3,2,3,3,3,2,\dots \end{align*}

has the property that, if one forms a second sequence that records the number of 3's between successive 2's, the result is identical to the given sequence. Show that there exists a real number rr such that, for any nn, the nnth term of the sequence is 2 if and only if n=1+rmn = 1 + \lfloor rm \rfloor for some nonnegative integer mm. (Note: x\lfloor x \rfloor denotes the largest integer less than or equal to xx.)

B11993

Find the smallest positive integer nn such that for every integer mm with 0<m<19930 < m < 1993, there exists an integer kk for which m1993<kn<m+11994.\frac{m}{1993} < \frac{k}{n} < \frac{m+1}{1994}.

B51993

Show there do not exist four points in the Euclidean plane such that the pairwise distances between the points are all odd integers.

B61993

Let SS be a set of three, not necessarily distinct, positive integers. Show that one can transform SS into a set containing 0 by a finite number of applications of the following rule: Select two of the three integers, say xx and yy, where xyx \leq y and replace them with 2x2x and yxy-x.

A31992

For a given positive integer mm, find all triples (n,x,y)(n, x, y) of positive integers, with nn relatively prime to mm, which satisfy (x2+y2)m=(xy)n.(x^2 + y^2)^m = (xy)^n.

A51992

For each positive integer nn, let an=0a_n = 0 (or 1) if the number of 1's in the binary representation of nn is even (or odd), respectively. Show that there do not exist positive integers kk and mm such that ak+j=ak+m+j=ak+2m+j,a_{k+j} = a_{k+m+j} = a_{k+2m+j}, for 0jm10 \leq j \leq m-1.

B11991

For each integer n0n \geq 0, let S(n)=nm2S(n) = n - m^2, where mm is the greatest integer with m2nm^2 \leq n. Define a sequence (ak)k=0(a_k)_{k=0}^\infty by a0=Aa_0 = A and ak+1=ak+S(ak)a_{k+1} = a_k + S(a_k) for k0k \geq 0. For what positive integers AA is this sequence eventually constant?

B41991

Suppose pp is an odd prime. Prove that j=0p(pj)(p+jj)2p+1(modp2).\sum_{j=0}^p \binom{p}{j} \binom{p+j}{j} \equiv 2^p + 1\pmod{p^2}.

B51991

Let pp be an odd prime and let Zp\Z_p denote (the field of) integers modulo pp. How many elements are in the set {x2:xZp}{y2+1:yZp}?\{x^2: x \in \Z_p\} \cap \{y^2 + 1 : y \in \Z_p\}?

A21990

Is 2\sqrt{2} the limit of a sequence of numbers of the form n3m3\sqrt[3]{n} - \sqrt[3]{m} (n,m=0,1,2,n,m = 0, 1, 2, \dots)?

A31990

Prove that any convex pentagon whose vertices (no three of which are collinear) have integer coordinates must have area greater than or equal to 5/2.

A11989

How many primes among the positive integers, written as usual in base 10, are alternating 1's and 0's, beginning and ending with 1?

A61989

Let α=1+a1x+a2x2+\alpha=1+a_1x+a_2x^2+\cdots be a formal power series with coefficients in the field of two elements. Let an={1if every block of zeros in the binary expansion of n has an even number of zeros in the block0otherwise.a_n = \begin{cases} 1 & \text{if every block of zeros in the binary expansion of $n$ has an even number of zeros in the block} \\[.3in] 0 & \text{otherwise.} \end{cases} (For example, a36=1a_{36}=1 because 36=100100236=100100_2 and a20=0a_{20}=0 because 20=101002.20=10100_2.) Prove that α3+xα+1=0.\alpha^3+x\alpha+1=0.

B11988

A composite (positive integer) is a product abab with aa and bb not necessarily distinct integers in {2,3,4,}\{2,3,4,\dots\}. Show that every composite is expressible as xy+xz+yz+1xy+xz+yz+1, with x,y,zx,y,z positive integers.

B31988

For every nn in the set N={1,2,}\mathrm{N} = \{1,2,\dots \} of positive integers, let rnr_n be the minimum value of cd3|c-d\sqrt{3}| for all nonnegative integers cc and dd with c+d=nc+d=n. Find, with proof, the smallest positive real number gg with rngr_n \leq g for all nNn \in \mathrm{N}.

B61988

Prove that there exist an infinite number of ordered pairs (a,b)(a,b) of integers such that for every positive integer tt, the number at+bat+b is a triangular number if and only if tt is a triangular number. (The triangular numbers are the tn=n(n+1)/2t_n = n(n+1)/2 with nn in {0,1,2,}\{0,1,2,\dots\}.)

A21987

The sequence of digits 1234567891011121314151617181920211 2 3 4 5 6 7 8 9 1 0 1 1 1 2 1 3 1 4 1 5 1 6 1 7 1 8 1 9 2 0 2 1 \dots is obtained by writing the positive integers in order. If the 10n10^n-th digit in this sequence occurs in the part of the sequence in which the mm-digit numbers are placed, define f(n)f(n) to be mm. For example, f(2)=2f(2)=2 because the 100th digit enters the sequence in the placement of the two-digit integer 55. Find, with proof, f(1987)f(1987).

A61987

For each positive integer nn, let a(n)a(n) be the number of zeroes in the base 3 representation of nn. For which positive real numbers xx does the series n=1xa(n)n3\sum_{n=1}^\infty \frac{x^{a(n)}}{n^3} converge?

B31987

Let FF be a field in which 1+101+1 \neq 0. Show that the set of solutions to the equation x2+y2=1x^2+y^2=1 with xx and yy in FF is given by (x,y)=(1,0)(x,y)=(1,0) and (x,y)=(r21r2+1,2rr2+1)(x,y) = \left( \frac{r^2-1}{r^2+1}, \frac{2r}{r^2+1} \right) where rr runs through the elements of FF such that r21r^2\neq -1.

B61987

Let FF be the field of p2p^2 elements, where pp is an odd prime. Suppose SS is a set of (p21)/2(p^2-1)/2 distinct nonzero elements of FF with the property that for each a0a\neq 0 in FF, exactly one of aa and a-a is in SS. Let NN be the number of elements in the intersection S{2a:aS}S \cap \{2a: a \in S\}. Prove that NN is even.

A21986

What is the units (i.e., rightmost) digit of 102000010100+3?\left\lfloor \frac{10^{20000}}{10^{100}+3}\right\rfloor ? %Here x\lfloor x \rfloor is the greatest integer less than or equal to %xx.

B31986

Let Γ\Gamma consist of all polynomials in xx with integer coefficients. For ff and gg in Γ\Gamma and mm a positive integer, let fg(modm)f \equiv g \pmod{m} mean that every coefficient of fgf-g is an integral multiple of mm. Let nn and pp be positive integers with pp prime. Given that f,g,h,rf,g,h,r and ss are in Γ\Gamma with rf+sg1(modp)rf+sg\equiv 1 \pmod{p} and fgh(modp)fg \equiv h \pmod{p}, prove that there exist FF and GG in Γ\Gamma with Ff(modp)F \equiv f \pmod{p}, Gg(modp)G \equiv g \pmod{p}, and FGh(modpn)FG \equiv h \pmod{p^n}.

B41986

For a positive real number rr, let G(r)G(r) be the minimum value of rm2+2n2|r - \sqrt{m^2+2n^2}| for all integers mm and nn. Prove or disprove the assertion that limrG(r)\lim_{r\to \infty}G(r) exists and equals 0.

A41985

Define a sequence {ai}\{a_i\} by a1=3a_1=3 and ai+1=3aia_{i+1}=3^{a_i} for i1i\geq 1. Which integers between 00 and 99 inclusive occur as the last two digits in the decimal expansion of infinitely many aia_i?

A51985

Let Im=02πcos(x)cos(2x)cos(mx)dxI_m = \int_0^{2\pi} \cos(x)\cos(2x)\cdots \cos(mx)\,dx. For which integers mm, 1m101 \leq m \leq 10 is Im0I_m \neq 0?

B21985

Define polynomials fn(x)f_n(x) for n0n \geq 0 by f0(x)=1f_0(x)=1, fn(0)=0f_n(0)=0 for n1n \geq 1, and ddxfn+1(x)=(n+1)fn(x+1)\frac{d}{dx} f_{n+1}(x) = (n+1)f_n(x+1) for n0n \geq 0. Find, with proof, the explicit factorization of f100(1)f_{100}(1) into powers of distinct primes.